Created
March 20, 2023 16:47
-
-
Save oketariq/73fef5beac05c512e2ace0d381c1b4cb to your computer and use it in GitHub Desktop.
clearvision modified
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| :root{ | |
| --main-color: #2780e6; | |
| --hover-color: #1e63b3; | |
| --success-color: #43b581; | |
| --danger-color: #982929; | |
| --channel-unread: var(--main-color); | |
| --channel-color: rgba(255, 255, 255, 0.3); | |
| --muted-color: rgba(255, 255, 255, 0.1); | |
| --channel-text-selected: #fff; | |
| --url-color: var(--main-color); | |
| --online-color: #43b581; | |
| --idle-color: #faa61a; | |
| --dnd-color: #982929; | |
| --offline-color: #808080; | |
| --streaming-color: #593695; | |
| --main-font: gg sans, Helvetica Neue, Helvetica, Arial, sans-serif; | |
| --code-font: Consolas, Liberation Mono, Menlo, Courier, monospace; | |
| --font-display: var(--main-font); | |
| --text-normal: rgb(220, 221, 222); | |
| --text-muted: rgb(114, 118, 125); | |
| --channels-width: 220px; | |
| --members-width: 240px; | |
| --background-shading: 100%; | |
| --background-overlay: rgba(0, 0, 0, 0.6); | |
| --background-image: url(https://clearvision.github.io/images/sapphire.jpg); | |
| --background-position: center; | |
| --background-size: cover; | |
| --background-repeat: no-repeat; | |
| --background-attachment: fixed; | |
| --background-brightness: 100%; | |
| --background-contrast: 100%; | |
| --background-saturation: 100%; | |
| --background-invert: 0%; | |
| --background-grayscale: 0%; | |
| --background-sepia: 0%; | |
| --background-blur: 0px; | |
| --backdrop-overlay: rgba(0, 0, 0, 0.8); | |
| --backdrop-image: var(--background-image); | |
| --backdrop-position: var(--background-position); | |
| --backdrop-size: var(--background-size); | |
| --backdrop-repeat: var(--background-repeat); | |
| --backdrop-attachment: var(--background-attachment); | |
| --backdrop-brightness: var(--background-brightness); | |
| --backdrop-contrast: var(--background-contrast); | |
| --backdrop-saturation: var(--background-saturation); | |
| --backdrop-invert: var(--background-invert); | |
| --backdrop-grayscale: var(--background-grayscale); | |
| --backdrop-sepia: var(--background-sepia); | |
| --backdrop-blur: var(--background-blur); | |
| --user-popout-image: var(--background-image); | |
| --user-popout-position: var(--background-position); | |
| --user-popout-size: var(--background-size); | |
| --user-popout-repeat: var(--background-repeat); | |
| --user-popout-attachment: var(--background-attachment); | |
| --user-popout-brightness: var(--background-brightness); | |
| --user-popout-contrast: var(--background-contrast); | |
| --user-popout-saturation: var(--background-saturation); | |
| --user-popout-invert: var(--background-invert); | |
| --user-popout-grayscale: var(--background-grayscale); | |
| --user-popout-sepia: var(--background-sepia); | |
| --user-popout-blur: calc(var(--background-blur) + 3px); | |
| --user-popout-overlay: rgba(0, 0, 0, 0.65); | |
| --user-modal-image: var(--background-image); | |
| --user-modal-position: var(--background-position); | |
| --user-modal-size: var(--background-size); | |
| --user-modal-repeat: var(--background-repeat); | |
| --user-modal-attachment: var(--background-attachment); | |
| --user-modal-brightness: var(--background-brightness); | |
| --user-modal-contrast: var(--background-contrast); | |
| --user-modal-saturation: var(--background-saturation); | |
| --user-modal-invert: var(--background-invert); | |
| --user-modal-grayscale: var(--background-grayscale); | |
| --user-modal-sepia: var(--background-sepia); | |
| --user-modal-blur: calc(var(--background-blur) + 3px); | |
| --home-icon: url(https://clearvision.github.io/icons/discord.svg); | |
| --home-position: center; | |
| --home-size: 40px; | |
| --bd-blue: var(--main-color); | |
| --bd-blue-hover: var(--hover-color); | |
| --bd-blue-active: var(--hover-color) | |
| } | |
| @keyframes cv-fade-in{ | |
| from{ | |
| opacity:0 | |
| } | |
| to{ | |
| opacity:1 | |
| } | |
| } | |
| @keyframes cv-fade-to-1{ | |
| from{ | |
| opacity:0 | |
| } | |
| to{ | |
| opacity:0.1 | |
| } | |
| } | |
| @keyframes cv-fade-to-2{ | |
| from{ | |
| opacity:0 | |
| } | |
| to{ | |
| opacity:0.2 | |
| } | |
| } | |
| @keyframes cv-fade-to-3{ | |
| from{ | |
| opacity:0 | |
| } | |
| to{ | |
| opacity:0.3 | |
| } | |
| } | |
| @keyframes cv-fade-to-4{ | |
| from{ | |
| opacity:0 | |
| } | |
| to{ | |
| opacity:0.4 | |
| } | |
| } | |
| @keyframes cv-fade-to-5{ | |
| from{ | |
| opacity:0 | |
| } | |
| to{ | |
| opacity:0.5 | |
| } | |
| } | |
| @keyframes cv-fade-to-6{ | |
| from{ | |
| opacity:0 | |
| } | |
| to{ | |
| opacity:0.6 | |
| } | |
| } | |
| @keyframes cv-fade-to-7{ | |
| from{ | |
| opacity:0 | |
| } | |
| to{ | |
| opacity:0.7 | |
| } | |
| } | |
| @keyframes cv-fade-to-8{ | |
| from{ | |
| opacity:0 | |
| } | |
| to{ | |
| opacity:0.8 | |
| } | |
| } | |
| @keyframes cv-fade-to-9{ | |
| from{ | |
| opacity:0 | |
| } | |
| to{ | |
| opacity:0.9 | |
| } | |
| } | |
| @keyframes cv-slide-top{ | |
| from{ | |
| top:100% | |
| } | |
| to{ | |
| top:0 | |
| } | |
| } | |
| @keyframes cv-slide-right{ | |
| from{ | |
| right:100% | |
| } | |
| to{ | |
| right:0 | |
| } | |
| } | |
| @keyframes cv-slide-bottom{ | |
| from{ | |
| bottom:100% | |
| } | |
| to{ | |
| bottom:0 | |
| } | |
| } | |
| @keyframes cv-slide-left{ | |
| from{ | |
| left:100% | |
| } | |
| to{ | |
| left:0 | |
| } | |
| } | |
| @keyframes cv-channel-select{ | |
| from{ | |
| right:100%; | |
| background-color:rgba(0,0,0,0) | |
| } | |
| to{ | |
| right:0; | |
| background-color:var(--main-color) | |
| } | |
| } | |
| @keyframes cv-message-jump{ | |
| from{ | |
| background:rgba(255,255,255,.3) | |
| } | |
| to{ | |
| background:rgba(0,0,0,0) | |
| } | |
| } | |
| @keyframes cv-update-spin{ | |
| from{ | |
| transform:rotateZ(0) scaleX(-1) | |
| } | |
| to{ | |
| transform:rotateZ(360deg) scaleX(-1) | |
| } | |
| } | |
| @keyframes cv-update-downloading{ | |
| 0%{ | |
| background-size:24px,10px 0 | |
| } | |
| 50%{ | |
| background-position:center,50% 10px; | |
| background-size:24px,10px 10px | |
| } | |
| 100%{ | |
| background-position:center,50% 20px; | |
| background-size:24px,10px 0 | |
| } | |
| } | |
| @keyframes cv-spin{ | |
| from{ | |
| transform:rotateZ(0) | |
| } | |
| to{ | |
| transform:rotateZ(360deg) | |
| } | |
| } | |
| @keyframes cv-spinner-glow{ | |
| from{ | |
| filter:drop-shadow(0 0 3px var(--main-color)) | |
| } | |
| to{ | |
| filter:drop-shadow(0 0 3px var(--main-color)) drop-shadow(0 0 15px var(--main-color)) | |
| } | |
| } | |
| @keyframes cv-spinner-pulse{ | |
| from{ | |
| transform:scale(0.8); | |
| opacity:.3 | |
| } | |
| to{ | |
| transform:none; | |
| opacity:1 | |
| } | |
| } | |
| @keyframes cv-menu-fold-y{ | |
| from{ | |
| transform:rotateX(-90deg); | |
| opacity:0 | |
| } | |
| to{ | |
| transform:none; | |
| opacity:1 | |
| } | |
| } | |
| @keyframes cv-menu-fold-x{ | |
| from{ | |
| transform:rotateY(-90deg); | |
| opacity:0 | |
| } | |
| to{ | |
| transform:none; | |
| opacity:1 | |
| } | |
| } | |
| @keyframes cv-menu-slide-top{ | |
| from{ | |
| transform:translateY(-100%); | |
| opacity:0 | |
| } | |
| to{ | |
| transform:none; | |
| opacity:1 | |
| } | |
| } | |
| @keyframes cv-menu-slide-bottom{ | |
| from{ | |
| transform:translateY(100%); | |
| opacity:0 | |
| } | |
| to{ | |
| transform:none; | |
| opacity:1 | |
| } | |
| } | |
| @keyframes cv-menu-slide-left{ | |
| from{ | |
| transform:translateX(-100%); | |
| opacity:0 | |
| } | |
| to{ | |
| transform:none; | |
| opacity:1 | |
| } | |
| } | |
| @keyframes cv-menu-slide-right{ | |
| from{ | |
| transform:translateX(100%); | |
| opacity:0 | |
| } | |
| to{ | |
| transform:none; | |
| opacity:1 | |
| } | |
| } | |
| @keyframes cv-shadow-pulse{ | |
| 0%{ | |
| box-shadow:0 0 6px 2px var(--main-color) | |
| } | |
| 50%{ | |
| box-shadow:0 0 10px 2px var(--main-color) | |
| } | |
| 100%{ | |
| box-shadow:0 0 6px 2px var(--main-color) | |
| } | |
| } | |
| @keyframes cv-shake{ | |
| 0%,100%{ | |
| transform:none | |
| } | |
| 15%,45%,75%{ | |
| transform:translate3d(-13px, -8px, 0px) | |
| } | |
| 30%,60%,90%{ | |
| transform:translate3d(13px, 8px, 0px) | |
| } | |
| } | |
| .theme-dark .appMount-2yBXZl{ | |
| background:var(--background-overlay) | |
| } | |
| .app-2CXKsg{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .bg-1QIAus{ | |
| background:var(--background-image) var(--background-position)/var(--background-size) var(--background-repeat) var(--background-attachment); | |
| filter:grayscale(var(--background-grayscale)) sepia(var(--background-sepia)) invert(var(--background-invert)) brightness(var(--background-brightness)) contrast(var(--background-contrast)) saturate(var(--background-saturation)) blur(var(--background-blur)); | |
| z-index:-9999 | |
| } | |
| .appMount-2yBXZl .layers-OrUESM,.appMount-2yBXZl .layer-86YKbF{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .layer-86YKbF .container-1eFtFS,.layer-86YKbF .standardSidebarView-E9Pc3j{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .container-1eFtFS .base-2jDfDU{ | |
| border-radius:0 | |
| } | |
| .backdrop-2ByYRN:before{ | |
| content:""; | |
| position:fixed; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| background:var(--backdrop-image) var(--backdrop-position)/var(--backdrop-size) var(--backdrop-repeat) var(--backdrop-attachment); | |
| filter:grayscale(var(--backdrop-grayscale)) sepia(var(--backdrop-sepia)) invert(var(--backdrop-invert)) brightness(var(--backdrop-brightness)) contrast(var(--backdrop-contrast)) saturate(var(--backdrop-saturation)) blur(var(--backdrop-blur)); | |
| pointer-events:none | |
| } | |
| .backdrop-2ByYRN:after{ | |
| content:""; | |
| position:fixed; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| background:var(--backdrop-overlay); | |
| pointer-events:none | |
| } | |
| .loading-1yrGTe{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .loading-1yrGTe:before,.loading-1yrGTe:after{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| border:3px solid rgba(0,0,0,0); | |
| border-radius:50%; | |
| margin:auto; | |
| filter:drop-shadow(0 0 3px var(--main-color)); | |
| animation:cv-spin 1s ease-in-out infinite | |
| } | |
| .loading-1yrGTe:before{ | |
| height:26px; | |
| width:26px; | |
| border-left-color:var(--main-color); | |
| border-right-color:var(--main-color) | |
| } | |
| .loading-1yrGTe:after{ | |
| height:16px; | |
| width:16px; | |
| border-top-color:var(--main-color); | |
| border-bottom-color:var(--main-color); | |
| animation-direction:reverse | |
| } | |
| body,button,input,select,textarea,::placeholder{ | |
| font-family:var(--main-font) | |
| } | |
| ::selection{ | |
| color:#fff; | |
| background:var(--main-color) | |
| } | |
| .notice-2HEN-u{ | |
| border-radius:3px | |
| } | |
| .notice-2HEN-u.colorDefault-1e8tQv{ | |
| background:rgba(67,181,129,.6) | |
| } | |
| .notice-2HEN-u.noticePremium-12Zvj9{ | |
| background:rgba(32,34,37,.6) | |
| } | |
| .notice-2HEN-u.noticeInfo-3_iTE1{ | |
| background:rgba(74,144,226,.6) | |
| } | |
| .notice-2HEN-u.noticeSuccess-3Y62ob{ | |
| background:rgba(67,181,129,.6) | |
| } | |
| .notice-2HEN-u.colorDanger-2YLzLC{ | |
| background:rgba(240,71,71,.6) | |
| } | |
| .notice-2HEN-u.colorStreamerMode-8uoRWd{ | |
| background:rgba(145,70,255,.6) | |
| } | |
| .notice-2HEN-u.noticeFacebook-3equ5g{ | |
| background:rgba(24,119,242,.6) | |
| } | |
| .notice-2HEN-u.noticeSpotify-27dhr0{ | |
| background:rgba(29,185,84,.6) | |
| } | |
| .notice-2HEN-u.colorBrand1-2u_MN9{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .notice-2HEN-u.colorBrand1-2u_MN9:before{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| background-color:var(--main-color); | |
| opacity:.6; | |
| z-index:-1; | |
| border-radius:3px | |
| } | |
| .notice-2HEN-u .textLink-2oCmaf{ | |
| color:#fff | |
| } | |
| .notice-2HEN-u.notice-1x8lm-{ | |
| background:rgba(0,0,0,.6) | |
| } | |
| .typeWindows-2-g3UY{ | |
| height:18px; | |
| width:100vw; | |
| margin:0; | |
| padding-top:2px; | |
| padding-bottom:2px; | |
| background:rgba(0, 0, 0, calc(var(--background-shading) * 0.6)); | |
| box-shadow:0 0 20px rgba(0, 0, 0, calc(var(--background-shading) * 0.6)) | |
| } | |
| .typeWindows-2-g3UY>.wordmark-2u86JB{ | |
| position:static; | |
| margin-right:auto; | |
| display:flex; | |
| align-items:center; | |
| justify-content:center; | |
| opacity:1; | |
| pointer-events:none; | |
| user-select:none; | |
| order:1 | |
| } | |
| .typeWindows-2-g3UY>.wordmark-2u86JB:before,.typeWindows-2-g3UY>.wordmark-2u86JB:after{ | |
| margin-left:3px; | |
| font-weight:600; | |
| white-space:nowrap; | |
| order:1 | |
| } | |
| .typeWindows-2-g3UY>.wordmark-2u86JB>svg{ | |
| filter:drop-shadow(0 0 5px var(--main-color)); | |
| margin-top:6px | |
| } | |
| .typeWindows-2-g3UY>.wordmark-2u86JB>svg>g>path{ | |
| fill:var(--main-color) | |
| } | |
| .typeWindows-2-g3UY>.wordmark-2u86JB>svg>g>path:first-child{ | |
| d:path("M3.57642276,0.141304348 L0,0.141304348 L0,4.22826087 L2.38069106,6.40217391 L2.38069106,2.43478261 L3.66260163,2.43478261 C4.47052846,2.43478261 4.86910569,2.83695652 4.86910569,3.4673913 L4.86910569,6.5 C4.86910569,7.13043478 4.49207317,7.55434783 3.66260163,7.55434783 L0,7.55434783 L0,9.85869565 L3.57642276,9.85869565 C5.49390244,9.86956522 7.29288618,8.90217391 7.29288618,6.66304348 L7.29288618,3.39130435 C7.29288618,1.13043478 5.49390244,0.141304348 3.57642276,0.141304348 Z M22.3310976,6.67391304 L22.3310976,3.32608696 C22.3310976,2.11956522 24.4640244,1.83695652 25.1103659,3.05434783 L27.0817073,2.23913043 C26.3168699,0.510869565 24.8949187,0 23.7207317,0 C21.803252,0 19.9073171,1.13043478 19.9073171,3.32608696 L19.9073171,6.67391304 C19.9073171,8.88043478 21.803252,10 23.6776423,10 C24.8841463,10 26.3276423,9.39130435 27.1247967,7.81521739 L25.0134146,6.82608696 C24.4963415,8.17391304 22.3310976,7.84782609 22.3310976,6.67391304 Z M15.8030488,3.7826087 C15.0597561,3.61956522 14.5642276,3.34782609 14.5319106,2.88043478 C14.575,1.75 16.2878049,1.7173913 17.2896341,2.79347826 L18.8731707,1.55434783 C17.8821138,0.326086957 16.7617886,0 15.598374,0 C13.8424797,0 12.1404472,1 12.1404472,2.91304348 C12.1404472,4.77173913 13.5408537,5.76086957 15.0813008,6 C15.8676829,6.10869565 16.7402439,6.42391304 16.7186992,6.97826087 C16.654065,8.02173913 14.5426829,7.9673913 13.5839431,6.7826087 L12.0650407,8.23913043 C12.9591463,9.40217391 14.1764228,10 15.3182927,10 C17.074187,10 19.0239837,8.9673913 19.0993902,7.08695652 C19.2071138,4.69565217 17.5050813,4.09782609 15.8030488,3.7826087 Z M8.59634146,9.85869565 L11.0093496,9.85869565 L11.0093496,0.141304348 L8.59634146,0.141304348 L8.59634146,9.85869565 Z M49.2835366,0.141304348 L45.7071138,0.141304348 L45.7071138,4.22826087 L48.0878049,6.40217391 L48.0878049,2.43478261 L49.3589431,2.43478261 C50.1668699,2.43478261 50.5654472,2.83695652 50.5654472,3.4673913 L50.5654472,6.5 C50.5654472,7.13043478 50.1884146,7.55434783 49.3589431,7.55434783 L45.6963415,7.55434783 L45.6963415,9.85869565 L49.2727642,9.85869565 C51.1902439,9.86956522 52.9892276,8.90217391 52.9892276,6.66304348 L52.9892276,3.39130435 C53,1.13043478 51.2010163,0.141304348 49.2835366,0.141304348 Z M31.7353659,0 C29.753252,0 27.7819106,1.09782609 27.7819106,3.33695652 L27.7819106,6.66304348 C27.7819106,8.89130435 29.7640244,10 31.7569106,10 C33.7390244,10 35.7103659,8.89130435 35.7103659,6.66304348 L35.7103659,3.33695652 C35.7103659,1.10869565 33.7174797,0 31.7353659,0 Z M33.2865854,6.66304348 C33.2865854,7.35869565 32.5109756,7.7173913 31.7461382,7.7173913 C30.9705285,7.7173913 30.1949187,7.36956522 30.1949187,6.66304348 L30.1949187,3.33695652 C30.1949187,2.61956522 30.9489837,2.23913043 31.7030488,2.23913043 C32.4894309,2.23913043 33.2865854,2.58695652 33.2865854,3.33695652 L33.2865854,6.66304348 Z M44.3605691,3.33695652 C44.3067073,1.05434783 42.7770325,0.141304348 40.8056911,0.141304348 L36.9815041,0.141304348 L36.9815041,9.86956522 L39.4268293,9.86956522 L39.4268293,6.77173913 L39.8577236,6.77173913 L42.0768293,9.85869565 L45.0930894,9.85869565 L42.4861789,6.52173913 C43.6495935,6.15217391 44.3605691,5.14130435 44.3605691,3.33695652 Z M40.8487805,4.65217391 L39.4268293,4.65217391 L39.4268293,2.43478261 L40.8487805,2.43478261 C42.3784553,2.43478261 42.3784553,4.65217391 40.8487805,4.65217391 Z") | |
| } | |
| .typeWindows-2-g3UY>.wordmark-2u86JB>svg>g>path:not(:first-child){ | |
| display:none | |
| } | |
| .typeWindows-2-g3UY>.winButton-3UMjdg{ | |
| top:-2px; | |
| opacity:.7; | |
| transition:all .15s ease-in-out | |
| } | |
| .typeWindows-2-g3UY>.winButton-3UMjdg:hover{ | |
| background:rgba(255,255,255,.1); | |
| opacity:1 | |
| } | |
| .typeWindows-2-g3UY>.winButtonClose-3Q8ZH5:hover{ | |
| background:var(--danger-color) | |
| } | |
| .typeMacOS-3V4xXE{ | |
| width:70px; | |
| height:48px; | |
| display:flex; | |
| flex-direction:column; | |
| align-items:center; | |
| justify-content:space-evenly | |
| } | |
| .typeMacOS-3V4xXE.unfocused-1U-yOa .macButton-2M5W_9{ | |
| background:rgba(255,255,255,.7) | |
| } | |
| .typeMacOS-3V4xXE>.macButtons-eIdy0e{ | |
| padding:0 10px | |
| } | |
| .typeMacOS-3V4xXE:before,.typeMacOS-3V4xXE:after{ | |
| margin:0 2px; | |
| font-size:10px; | |
| order:1 | |
| } | |
| .typeMacOS-3V4xXE:before{ | |
| content:"CV"; | |
| color:var(--main-color); | |
| font-weight:700; | |
| text-shadow:0 0 3px | |
| } | |
| .typeMacOS-3V4xXE:after{ | |
| content:"6.3.0"; | |
| color:rgba(255,255,255,.3) | |
| } | |
| .container-27tlK1{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .selectAll-1ZP46u .text-xs-medium-2LRpEj{ | |
| color:rgba(255,255,255,.5) !important; | |
| transition:all .15s ease-in-out | |
| } | |
| .selectAll-1ZP46u .checked-1pZh2h+.text-xs-medium-2LRpEj{ | |
| color:rgba(255,255,255,.7) !important | |
| } | |
| .channelRow-4X_3fi{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .channelRow-4X_3fi:hover:not(.disabled-3cfocy){ | |
| background-color:rgba(0,0,0,.6) | |
| } | |
| .sidebar-1tnWFu{ | |
| width:var(--channels-width); | |
| background:rgba(0, 0, 0, calc(var(--background-shading) * 0.3)) | |
| } | |
| .platform-win .sidebar-1tnWFu{ | |
| border-radius:0 | |
| } | |
| .theme-dark .container-1NXEtd{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .theme-dark .container-1NXEtd .header-3OsQeK{ | |
| height:48px; | |
| color:#fff; | |
| font-family:var(--main-font); | |
| font-weight:600; | |
| text-shadow:0 0 3px #000 | |
| } | |
| .theme-dark .container-1NXEtd .header-3OsQeK:hover,.selected-1GtAC5 v .theme-dark .container-1NXEtd .header-3OsQeK{ | |
| background-color:rgba(255,255,255,.1) | |
| } | |
| .theme-dark .container-1NXEtd .animatedContainer-2laTjx{ | |
| background:rgba(0,0,0,0); | |
| box-shadow:none | |
| } | |
| .theme-dark .container-1NXEtd .bannerImage-ubW8K-{ | |
| width:var(--channels-width); | |
| -webkit-mask:linear-gradient(to bottom, #000, transparent); | |
| mask:linear-gradient(to bottom, #000, transparent) | |
| } | |
| .theme-dark .container-1NXEtd .spine-29OFwR{ | |
| color:var(--main-color) | |
| } | |
| .theme-dark .container-1NXEtd .spineBorder-1-F4s1{ | |
| background:var(--main-color) | |
| } | |
| .theme-dark .container-1NXEtd .container-1-ERn5 .flowerStarContainer-1QeD-L{ | |
| color:var(--main-color) | |
| } | |
| .theme-dark .container-1NXEtd .container-1-ERn5 .childContainer-U_a6Yh>svg{ | |
| color:#fff | |
| } | |
| .content-1gYQeQ{ | |
| transition:all .15s ease-in-out | |
| } | |
| .content-1gYQeQ{ | |
| position:relative; | |
| background:rgba(0,0,0,0) !important | |
| } | |
| .content-1gYQeQ:before{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| transition:all .15s ease-in-out; | |
| z-index:-1; | |
| pointer-events:none; | |
| border-radius:4px | |
| } | |
| .content-1gYQeQ:after{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:100%; | |
| bottom:0; | |
| left:0; | |
| opacity:.9; | |
| transition:all .3s ease-in-out; | |
| z-index:-1; | |
| pointer-events:none; | |
| border-radius:4px | |
| } | |
| .content-1gYQeQ .icon-2W8DHg{ | |
| width:18px; | |
| height:18px; | |
| margin-right:3px; | |
| color:var(--channel-color); | |
| opacity:1; | |
| transition:all .15s ease-in-out | |
| } | |
| .content-1gYQeQ .icon-2W8DHg>path{ | |
| opacity:.7 | |
| } | |
| .content-1gYQeQ .icon-2W8DHg>path:last-of-type{ | |
| opacity:1 | |
| } | |
| .content-1gYQeQ .name-28HaxV{ | |
| color:var(--channel-color); | |
| transition:all .15s ease-in-out | |
| } | |
| .children-Bmpf2Q{ | |
| margin-left:1px; | |
| animation:cv-fade-to-3 .15s ease-in-out | |
| } | |
| .actionIcon-2sw4Sl{ | |
| color:#fff; | |
| opacity:.3; | |
| transition:all .15s ease-in-out | |
| } | |
| .actionIcon-2sw4Sl:hover{ | |
| opacity:.7 | |
| } | |
| .wrapper-NhbLHG:hover .content-1gYQeQ:before{ | |
| background:rgba(255,255,255,.1) | |
| } | |
| .containerDefault-YUSmu3 .wrapper-NhbLHG:hover .content-1gYQeQ .mainContent-20q_Hp .icon-2W8DHg,.containerDefault-YUSmu3 .wrapper-NhbLHG:hover .content-1gYQeQ .mainContent-20q_Hp .name-28HaxV{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .wrapper-NhbLHG.modeUnread-3Cxepe .content-1gYQeQ .mainContent-20q_Hp .name-28HaxV{ | |
| color:var(--channel-unread); | |
| text-shadow:0 0 3px | |
| } | |
| .wrapper-NhbLHG.modeUnread-3Cxepe .content-1gYQeQ .mainContent-20q_Hp .icon-2W8DHg{ | |
| color:var(--channel-unread); | |
| filter:drop-shadow(0 0 3px); | |
| opacity:1 | |
| } | |
| .wrapper-NhbLHG.modeUnread-3Cxepe:hover .content-1gYQeQ .mainContent-20q_Hp .name-28HaxV{ | |
| color:var(--channel-text-selected) | |
| } | |
| .wrapper-NhbLHG.modeUnread-3Cxepe:hover .content-1gYQeQ .mainContent-20q_Hp .icon-2W8DHg{ | |
| color:var(--channel-text-selected) | |
| } | |
| .wrapper-NhbLHG.modeSelected-3DmyhH .content-1gYQeQ:before{ | |
| background:rgba(255,255,255,.1) | |
| } | |
| .wrapper-NhbLHG.modeSelected-3DmyhH .content-1gYQeQ:after{ | |
| right:0; | |
| background:var(--main-color); | |
| animation:cv-channel-select .3s ease-in-out | |
| } | |
| .containerDefault-YUSmu3 .wrapper-NhbLHG.modeSelected-3DmyhH .content-1gYQeQ .icon-2W8DHg,.containerDefault-YUSmu3 .wrapper-NhbLHG.modeSelected-3DmyhH .content-1gYQeQ .name-28HaxV{ | |
| color:var(--channel-text-selected) | |
| } | |
| .containerDefault-YUSmu3 .wrapper-NhbLHG.modeSelected-3DmyhH .content-1gYQeQ .live-1V2D-f{ | |
| color:var(--channel-text-selected) !important | |
| } | |
| .wrapper-NhbLHG.modeSelected-3DmyhH .content-1gYQeQ .actionIcon-2sw4Sl{ | |
| opacity:.7 | |
| } | |
| .wrapper-NhbLHG.modeSelected-3DmyhH .content-1gYQeQ .actionIcon-2sw4Sl:hover{ | |
| opacity:1 | |
| } | |
| .wrapper-NhbLHG.modeSelected-3DmyhH .text-xs-medium-2LRpEj,.wrapper-NhbLHG.modeSelected-3DmyhH .text-xs-normal-3SiVjE{ | |
| color:#fff !important | |
| } | |
| .wrapper-NhbLHG.modeConnected-NrO4cP .content-1gYQeQ .mainContent-20q_Hp .name-28HaxV{ | |
| color:var(--main-color); | |
| text-shadow:0 0 3px | |
| } | |
| .wrapper-NhbLHG.modeConnected-NrO4cP .content-1gYQeQ .mainContent-20q_Hp .icon-2W8DHg{ | |
| color:var(--main-color); | |
| filter:drop-shadow(0 0 3px) | |
| } | |
| .wrapper-NhbLHG.modeMuted-2T4MDZ .content-1gYQeQ .mainContent-20q_Hp .icon-2W8DHg,.wrapper-NhbLHG.modeMuted-2T4MDZ .content-1gYQeQ .mainContent-20q_Hp .name-28HaxV{ | |
| color:var(--muted-color) | |
| } | |
| .wrapper-NhbLHG.modeMuted-2T4MDZ:hover .content-1gYQeQ .mainContent-20q_Hp:before{ | |
| background:rgba(255,255,255,.07) | |
| } | |
| .containerDefault-YUSmu3 .wrapper-NhbLHG.modeMuted-2T4MDZ:hover .content-1gYQeQ .mainContent-20q_Hp .icon-2W8DHg,.containerDefault-YUSmu3 .wrapper-NhbLHG.modeMuted-2T4MDZ:hover .content-1gYQeQ .mainContent-20q_Hp .name-28HaxV{ | |
| color:var(--channel-color) | |
| } | |
| .unread-36eUEm{ | |
| display:none | |
| } | |
| .live-1V2D-f{ | |
| background-color:var(--main-color) !important | |
| } | |
| .users-2JoyGL,.total-1c5KCN{ | |
| width:24px; | |
| color:rgba(255,255,255,.3); | |
| font-weight:600; | |
| text-align:right; | |
| transition:all .15s ease-in-out | |
| } | |
| .users-2JoyGL{ | |
| padding:0 4px 0 6px; | |
| background:rgba(0,0,0,.15) | |
| } | |
| .total-1c5KCN{ | |
| padding:0 6px 0 4px; | |
| background:rgba(255,255,255,.04); | |
| box-shadow:inset 1px 0 rgba(255,255,255,.07) | |
| } | |
| .total-1c5KCN:after{ | |
| display:none | |
| } | |
| .modeConnected-NrO4cP .users-2JoyGL{ | |
| color:var(--main-color); | |
| text-shadow:0 0 1px | |
| } | |
| .listDefault-2F-w65{ | |
| padding-left:24px | |
| } | |
| .voiceUser-3nRK-K{ | |
| z-index:1 | |
| } | |
| .voiceUser-3nRK-K .content-3xS9Lh{ | |
| border-radius:3px; | |
| transition:all .15s ease-in-out | |
| } | |
| .voiceUser-3nRK-K .avatarSpeaking-2pCGrZ{ | |
| position:relative; | |
| transition:all .1s ease-in-out | |
| } | |
| .voiceUser-3nRK-K .avatarSpeaking-2pCGrZ:after{ | |
| content:""; | |
| position:absolute; | |
| height:1.7em; | |
| background:linear-gradient(to right, var(--main-color) 10%, transparent); | |
| opacity:.5; | |
| transition:all .1s ease-in-out,width .15s ease-in-out; | |
| pointer-events:none; | |
| z-index:-1; | |
| border-radius:999px; | |
| border-top-right-radius:0; | |
| border-bottom-right-radius:0 | |
| } | |
| .voiceUser-3nRK-K .avatarSpeaking-2pCGrZ{ | |
| box-shadow:0 0 0 2px var(--main-color),inset 0 0 3px rgba(0,0,0,.5) | |
| } | |
| .voiceUser-3nRK-K .avatarSpeaking-2pCGrZ:after{ | |
| top:-2px; | |
| bottom:-2px; | |
| width:150px | |
| } | |
| .voiceUser-3nRK-K .username-vAneIW{ | |
| color:rgba(255,255,255,.5); | |
| transition:all .1s ease-in-out | |
| } | |
| .voiceUser-3nRK-K .usernameSpeaking-3FKv6H{ | |
| color:#fff !important | |
| } | |
| .audienceVoiceUserIconContainer-1aQGLF{ | |
| background-color:var(--main-color); | |
| color:#fff | |
| } | |
| .icon-3akWb2{ | |
| width:18px; | |
| height:18px; | |
| margin-right:3px; | |
| color:rgba(255,255,255,.3) | |
| } | |
| .moreUsers-_v6T-L{ | |
| padding:0 4px; | |
| background:rgba(0,0,0,.3); | |
| border-radius:10px | |
| } | |
| .containerDragAfter-1J_-1V:before,.containerDragBefore-ei4h1m:before,.containerDragAfter-1J_-1V:after,.containerDragBefore-ei4h1m:after,.containerDragAfter-3aBiOW:before,.containerDragBefore-1s5Qg6:before,.containerDragAfter-3aBiOW:after,.containerDragBefore-1s5Qg6:after{ | |
| background:var(--main-color); | |
| border-radius:0 | |
| } | |
| .containerUserOver-SDa1HW:after{ | |
| background:var(--main-color); | |
| border-color:rgba(0,0,0,0); | |
| opacity:.1 | |
| } | |
| .containerDefault-3TQ5YN,.containerDragAfter-1J_-1V,.containerDragBefore-ei4h1m,.containerUserOver-3woq86{ | |
| padding-top:16px | |
| } | |
| .wrapper-1S43wv{ | |
| padding-left:10px; | |
| padding-right:0; | |
| transition:all .3s ease-in-out | |
| } | |
| .icon-3zI3d2{ | |
| display:none | |
| } | |
| .name-3BUDLf{ | |
| display:flex; | |
| align-items:center; | |
| justify-content:center; | |
| color:var(--main-color); | |
| font-weight:700; | |
| text-align:center; | |
| transition:all .3s ease-in-out; | |
| opacity:.7 | |
| } | |
| .name-3BUDLf:before{ | |
| content:""; | |
| height:2px; | |
| flex-grow:1; | |
| transition:all .3s ease-in-out; | |
| background:linear-gradient(to left, var(--main-color) 50%, transparent); | |
| margin-right:5px | |
| } | |
| .name-3BUDLf:after{ | |
| content:""; | |
| height:2px; | |
| flex-grow:1; | |
| transition:all .3s ease-in-out; | |
| background:linear-gradient(to right, var(--main-color) 50%, transparent); | |
| margin-left:5px | |
| } | |
| .mainContent-uDGa6R:hover .name-3BUDLf{ | |
| opacity:1 | |
| } | |
| .sidebar-1tnWFu .containerDefault-3TQ5YN .wrapper-1S43wv .name-3BUDLf,.sidebar-1tnWFu .containerDragAfter-1J_-1V .wrapper-1S43wv .name-3BUDLf,.sidebar-1tnWFu .containerDragBefore-ei4h1m .wrapper-1S43wv .name-3BUDLf,.sidebar-1tnWFu .containerUserOver-3woq86 .wrapper-1S43wv .name-3BUDLf{ | |
| color:var(--main-color) | |
| } | |
| .children-3MeUvj{ | |
| margin-left:3px | |
| } | |
| .collapsed-2KOacR .name-3BUDLf:before,.collapsed-2KOacR .name-3BUDLf:after{ | |
| flex-grow:0 | |
| } | |
| .muted-19J0ih{ | |
| opacity:.5 | |
| } | |
| .addButtonIcon-3rJeaD{ | |
| color:var(--main-color); | |
| opacity:.7; | |
| transition:all .3s ease-in-out | |
| } | |
| .addButtonIcon-3rJeaD:hover{ | |
| color:var(--main-color); | |
| opacity:1 | |
| } | |
| .button-1kija8,.buttonIcon-1TxM6f{ | |
| color:var(--url-color) | |
| } | |
| .channelNotices-41mJbj .channelNotice-tO6Tus:after{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| background-image:inherit; | |
| background-position:inherit; | |
| background-size:auto; | |
| background-repeat:no-repeat; | |
| opacity:.3; | |
| filter:grayscale(1) brightness(1.5); | |
| pointer-events:none | |
| } | |
| .channelNotices-41mJbj .channelNotice-tO6Tus .close-2ISPTL{ | |
| opacity:.3; | |
| transition:all .15s ease-in-out | |
| } | |
| .channelNotices-41mJbj .channelNotice-tO6Tus .close-2ISPTL:hover{ | |
| opacity:.7 | |
| } | |
| .channelNotices-41mJbj .channelNotice-tO6Tus .message-3KLVy1{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .channelNotices-41mJbj .channelNotice-tO6Tus .message-3KLVy1 .btn-38SvSS{ | |
| background:rgba(255,255,255,.1); | |
| border-color:rgba(0,0,0,0); | |
| color:rgba(255,255,255,.7); | |
| transition:all .15s ease-in-out | |
| } | |
| .channelNotices-41mJbj .channelNotice-tO6Tus .message-3KLVy1 .btn-38SvSS:hover{ | |
| background:rgba(255,255,255,.2); | |
| color:#fff | |
| } | |
| .unread-2wipsx,.mention-3XBnnZ{ | |
| position:relative; | |
| background:rgba(0,0,0,0) | |
| } | |
| .unread-2wipsx:after,.mention-3XBnnZ:after{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| background:var(--main-color); | |
| border-radius:3px; | |
| opacity:.9; | |
| z-index:-1; | |
| transition:all .15s ease-in-out | |
| } | |
| .unread-2wipsx:hover:after,.mention-3XBnnZ:hover:after{ | |
| opacity:1 | |
| } | |
| .ring-370dIp{ | |
| box-shadow:inset 0px 0px 0 4px var(--main-color) | |
| } | |
| .keyboard-mode .focusStroke-3V8pid{ | |
| fill:var(--main-color); | |
| stroke:var(--main-color) | |
| } | |
| .panels-3wFtMD{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .panels-3wFtMD>:first-child{ | |
| box-shadow:0 -2px 10px rgba(0, 0, 0, calc(var(--background-shading) * 0.3)) | |
| } | |
| .theme-dark .panel-2ZFCRb{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .container-YkUktl>.flex-3BkGQD{ | |
| background:rgba(0,0,0,.3); | |
| border-radius:15px | |
| } | |
| .container-YkUktl>.flex-3BkGQD>:nth-child(n+2){ | |
| position:relative; | |
| margin-left:-1px | |
| } | |
| .container-YkUktl>.flex-3BkGQD>:nth-child(n+2):before{ | |
| content:""; | |
| position:absolute; | |
| left:0; | |
| top:2px; | |
| bottom:2px; | |
| width:1px; | |
| background:rgba(255,255,255,.2) | |
| } | |
| .button-12Fmur{ | |
| width:32px; | |
| height:32px; | |
| opacity:1 | |
| } | |
| .button-12Fmur>.contents-3NembX>svg{ | |
| background-position:center; | |
| background-size:18px; | |
| background-repeat:no-repeat; | |
| color:#fff; | |
| opacity:.5; | |
| transition:all .1s ease-in-out | |
| } | |
| .button-12Fmur.enabled-9OeuTA:hover{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .button-12Fmur:hover>.contents-3NembX>svg{ | |
| opacity:.7 | |
| } | |
| .button-12Fmur.disabled-GROwTe>.contents-3NembX>svg{ | |
| opacity:.1 | |
| } | |
| .actionButtons-2vEOUh{ | |
| grid-gap:6px | |
| } | |
| .button-1EGGcP.buttonColor-3bP3fX{ | |
| padding:2px 14px | |
| } | |
| .button-1EGGcP.buttonColor-3bP3fX.buttonActive-Uc1jHx{ | |
| background-color:#fff; | |
| color:var(--main-color) | |
| } | |
| .button-1EGGcP.buttonColor-3bP3fX.buttonActive-Uc1jHx:hover{ | |
| background:rgba(255,255,255,.95); | |
| color:var(--hover-color) | |
| } | |
| .theme-dark .container-YkUktl{ | |
| position:relative; | |
| background:rgba(0,0,0,0); | |
| margin-bottom:10px | |
| } | |
| .theme-dark .container-YkUktl:before,.theme-dark .container-YkUktl:after{ | |
| bottom:-8px; | |
| position:absolute; | |
| color:rgba(255,255,255,.3); | |
| font-size:11px; | |
| font-weight:700; | |
| transition:all .5s ease-in-out | |
| } | |
| .theme-dark .container-YkUktl:hover:before{ | |
| margin-right:1px; | |
| transform:none | |
| } | |
| .theme-dark .container-YkUktl:hover:after{ | |
| margin-left:1px; | |
| opacity:1; | |
| transform:none | |
| } | |
| .theme-dark .container-YkUktl .withTagAsButton-OsgQ9L,.theme-dark .container-YkUktl .withTagless-10ooWt{ | |
| min-width:calc(100% - 100px); | |
| width:auto | |
| } | |
| .theme-dark .container-YkUktl .withTagAsButton-OsgQ9L:hover,.theme-dark .container-YkUktl .withTagless-10ooWt:hover{ | |
| background-color:rgba(0,0,0,.3); | |
| color:#fff | |
| } | |
| .theme-dark .container-YkUktl .avatar-1EWyVD{ | |
| width:32px !important; | |
| height:32px !important; | |
| transition:all .15s ease-in-out | |
| } | |
| .theme-dark .container-YkUktl .avatar-1EWyVD:after{ | |
| content:"Status"; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| color:#fff; | |
| font-size:5px; | |
| font-weight:700; | |
| text-align:center; | |
| line-height:32px; | |
| text-transform:uppercase; | |
| opacity:0; | |
| transition:all .15s ease-in-out; | |
| pointer-events:none | |
| } | |
| .theme-dark .container-YkUktl .avatar-1EWyVD foreignObject{ | |
| transition:all .15s ease-in-out | |
| } | |
| .theme-dark .container-YkUktl .avatar-1EWyVD:hover{ | |
| width:40px !important; | |
| height:40px !important; | |
| opacity:1 | |
| } | |
| .theme-dark .container-YkUktl .avatar-1EWyVD:hover:after{ | |
| font-size:10px; | |
| line-height:40px; | |
| opacity:1 | |
| } | |
| .theme-dark .container-YkUktl .avatar-1EWyVD:hover foreignObject{ | |
| opacity:.5 | |
| } | |
| .theme-dark .container-YkUktl .title-338goq{ | |
| color:#fff | |
| } | |
| .theme-dark .container-YkUktl .subtext-2HDqJ7{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .container-1zzFcN{ | |
| border-color:rgba(0,0,0,0); | |
| background:rgba(0,0,0,0) | |
| } | |
| .container-1zzFcN>.flex-3BkGQD{ | |
| background:rgba(0,0,0,.3); | |
| border-radius:5px; | |
| padding:5px | |
| } | |
| .container-1zzFcN .inner-llGtyq .rtcConnectionStatus-c5A6Av .ping-2IpLcU{ | |
| width:16px; | |
| height:16px; | |
| margin-right:3px; | |
| background-size:16px | |
| } | |
| .container-1zzFcN .channel-3prF2u{ | |
| color:rgba(255,255,255,.3); | |
| opacity:1; | |
| transition:all .15s ease-in-out | |
| } | |
| .container-1zzFcN .channel-3prF2u:hover{ | |
| color:rgba(255,255,255,.5); | |
| text-decoration:none | |
| } | |
| .activityPanel-9icbyU{ | |
| border-color:rgba(0,0,0,0) | |
| } | |
| .activityPanel-9icbyU .actions-zk2vB_{ | |
| background:rgba(0,0,0,.3); | |
| border-radius:15px | |
| } | |
| .activityPanel-9icbyU .actions-zk2vB_>:nth-child(n+2){ | |
| position:relative; | |
| margin-left:-1px | |
| } | |
| .activityPanel-9icbyU .actions-zk2vB_>:nth-child(n+2):before{ | |
| content:""; | |
| position:absolute; | |
| left:0; | |
| top:2px; | |
| bottom:2px; | |
| width:1px; | |
| background:rgba(255,255,255,.2) | |
| } | |
| .liveBadge-3E8LQj{ | |
| background-color:var(--main-color) | |
| } | |
| .noiseCancellationPopout-2-e5Xz{ | |
| background-color:rgba(0,0,0,.7) | |
| } | |
| .privateChannels-oVe7HL{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .privateChannels-oVe7HL .scroller-WSmht3{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .privateChannels-oVe7HL .privateChannelsHeaderContainer-1UWASm{ | |
| display:flex; | |
| align-items:center; | |
| justify-content:center; | |
| color:var(--main-color); | |
| font-weight:700; | |
| text-align:center | |
| } | |
| .privateChannels-oVe7HL .privateChannelsHeaderContainer-1UWASm:before{ | |
| content:""; | |
| height:2px; | |
| flex-grow:1; | |
| transition:all .3s ease-in-out; | |
| background:linear-gradient(to left, var(--main-color) 50%, transparent); | |
| margin-right:5px | |
| } | |
| .privateChannels-oVe7HL .privateChannelsHeaderContainer-1UWASm:after{ | |
| content:""; | |
| height:2px; | |
| flex-grow:1; | |
| transition:all .3s ease-in-out; | |
| background:linear-gradient(to right, var(--main-color) 50%, transparent); | |
| margin-left:5px | |
| } | |
| .privateChannels-oVe7HL .privateChannelsHeaderContainer-1UWASm .headerText-1qIDDT{ | |
| overflow:visible | |
| } | |
| .privateChannels-oVe7HL .privateChannelsHeaderContainer-1UWASm .privateChannelRecipientsInviteButtonIcon-1ObKXK{ | |
| color:var(--main-color); | |
| transition:all .1s ease-in-out | |
| } | |
| .privateChannels-oVe7HL .privateChannelsHeaderContainer-1UWASm .privateChannelRecipientsInviteButtonIcon-1ObKXK:hover{ | |
| color:var(--hover-color) | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0{ | |
| max-width:none | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x{ | |
| position:relative; | |
| z-index:1 | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x:before{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| border-radius:3px; | |
| transition:all .15s ease-in-out; | |
| z-index:-1; | |
| pointer-events:none | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x:after{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:100%; | |
| bottom:0; | |
| left:0; | |
| border-radius:3px; | |
| opacity:.9; | |
| transition:all .3s ease-in-out; | |
| z-index:-1; | |
| pointer-events:none | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x .linkButtonIcon-7rsZcu,.privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x .name-2m3Cms{ | |
| font-size:14px; | |
| transition:all .15s ease-in-out; | |
| overflow:hidden | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x .activityText-ev7Z1T strong{ | |
| color:var(--main-color); | |
| font-weight:700; | |
| transition:all .15s ease-in-out | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x .closeButton-mupH76{ | |
| color:#fff | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x:hover{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x:hover:before{ | |
| background:rgba(255,255,255,.1) | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x:hover .linkButtonIcon-7rsZcu,.privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x:hover .name-2m3Cms{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x:hover .closeButton-mupH76{ | |
| opacity:.3 | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x:hover .closeButton-mupH76:hover{ | |
| opacity:.7 | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x.interactiveSelected-29CP8y{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x.interactiveSelected-29CP8y:before{ | |
| background:rgba(255,255,255,.1) | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x.interactiveSelected-29CP8y:after{ | |
| right:0; | |
| background:var(--main-color); | |
| animation:cv-channel-select .3s ease-in-out | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x.interactiveSelected-29CP8y .linkButtonIcon-7rsZcu,.privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x.interactiveSelected-29CP8y .name-2m3Cms{ | |
| color:#fff | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x.interactiveSelected-29CP8y .activityEmoji-24oKjc,.privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x.interactiveSelected-29CP8y .icon-Lupfh-{ | |
| filter:drop-shadow(0 0 3px rgba(0, 0, 0, 0.7)) | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x.interactiveSelected-29CP8y .activityText-ev7Z1T strong{ | |
| color:#fff | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x.interactiveSelected-29CP8y .closeButton-mupH76{ | |
| opacity:.7 | |
| } | |
| .privateChannels-oVe7HL .channel-1Shao0 .interactive-iyXY_x.interactiveSelected-29CP8y .closeButton-mupH76:hover{ | |
| opacity:1 | |
| } | |
| .empty-yQo7LQ{ | |
| fill:rgba(255,255,255,.15) | |
| } | |
| .searchBar-3TnChZ .searchBarComponent-3N7dCG{ | |
| background:rgba(255,255,255,.1); | |
| color:rgba(255,255,255,.3) | |
| } | |
| .base-2jDfDU .chat-2ZfjoI{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .chatContent-3KubbW,.resizeHandle-PBRzPC{ | |
| background:rgba(0, 0, 0, calc(var(--background-shading) * 0.5)) | |
| } | |
| .chat-2ZfjoI .content-1jQy2l{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .chat-2ZfjoI .content-1jQy2l:before{ | |
| display:none | |
| } | |
| .chat-2ZfjoI .base-34jWEe{ | |
| border-bottom:1px solid rgba(255,255,255,.02) | |
| } | |
| .chat-2ZfjoI .base-34jWEe>h1{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .chat-2ZfjoI .base-34jWEe>h1>strong{ | |
| color:rgba(255,255,255,.5); | |
| font-weight:700 | |
| } | |
| .content-1jQy2l>.scrollerWrap-2lJEkd{ | |
| background:rgba(0,0,0,.5) | |
| } | |
| .gatedContent-31-gID .image-3HC6rC{ | |
| filter:hue-rotate(-47deg) saturate(2); | |
| opacity:.5 | |
| } | |
| .gatedContent-31-gID .title-FyH9jw{ | |
| color:var(--danger-color); | |
| font-weight:600; | |
| text-shadow:0 0 3px #000 | |
| } | |
| .gatedContent-31-gID .description-fPkcPm{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .gatedContent-31-gID .separator-17R7Yp{ | |
| background:rgba(255,255,255,.07) | |
| } | |
| .gatedContent-31-gID .actionRed-gYn8D3{ | |
| position:relative; | |
| background:rgba(0,0,0,0); | |
| color:rgba(255,255,255,.7); | |
| z-index:1 | |
| } | |
| .gatedContent-31-gID .actionRed-gYn8D3:after{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| background:var(--danger-color); | |
| border-radius:3px; | |
| opacity:.5; | |
| transition:inherit; | |
| z-index:-1 | |
| } | |
| .gatedContent-31-gID .actionRed-gYn8D3:hover{ | |
| color:#fff | |
| } | |
| .gatedContent-31-gID .actionRed-gYn8D3:hover:after{ | |
| opacity:.7 | |
| } | |
| .emptyChannelIcon-1YdEz2{ | |
| background-color:var(--main-color) | |
| } | |
| .role-23oyrw{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .role-23oyrw .roleColor-3cA0as{ | |
| position:absolute; | |
| height:100%; | |
| width:100%; | |
| margin:0; | |
| right:-1px; | |
| border-radius:3px; | |
| z-index:-1; | |
| opacity:.2 | |
| } | |
| .role-23oyrw:hover{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .role-23oyrw:hover .roleColor-3cA0as{ | |
| opacity:.3 | |
| } | |
| .base-2jDfDU .noChannel-1GDIAZ{ | |
| background:rgba(0,0,0,.5) | |
| } | |
| .noChannel-1GDIAZ .image-20MDYu{ | |
| filter:grayscale(1) brightness(2); | |
| opacity:.3 | |
| } | |
| .noChannel-1GDIAZ .title-2CL_z0{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .noChannel-1GDIAZ .text-27cdrj{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .wrapper-3HVHpV,.wrapper-15CKyy{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .uploadModalIn-2w48Zf .uploadDropModal-13Kd20 .bgScale-1iWuPF{ | |
| background-color:var(--main-color) | |
| } | |
| .uploadModalIn-2w48Zf .uploadDropModal-13Kd20 .inner-rBP-MS{ | |
| border:2px dashed rgba(255,255,255,.5) | |
| } | |
| .newMessagesBar-1hF-9G{ | |
| background:rgba(0,0,0,0); | |
| transition:all .15s ease-in-out | |
| } | |
| .newMessagesBar-1hF-9G:before{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| background:var(--main-color); | |
| border-radius:0 0 3px 3px; | |
| opacity:.8; | |
| z-index:-1; | |
| transition:all .15s ease-in-out | |
| } | |
| .newMessagesBar-1hF-9G:hover:before,.newMessagesBar-1hF-9G:active:before{ | |
| opacity:1 | |
| } | |
| .newMessagesBar-1hF-9G:active{ | |
| padding-top:0; | |
| transform:scale(0.99) | |
| } | |
| .newMessagesBar-1hF-9G button{ | |
| color:#fff | |
| } | |
| .jumpToPresentBar-1cEnH0{ | |
| background:rgba(0,0,0,.7); | |
| border-radius:3px; | |
| transition:all .15s ease-in-out; | |
| padding-bottom:0px; | |
| max-height:24px | |
| } | |
| .jumpToPresentBar-1cEnH0>button{ | |
| color:rgba(255,255,255,.7); | |
| transition:inherit | |
| } | |
| .jumpToPresentBar-1cEnH0:hover{ | |
| background:var(--main-color) | |
| } | |
| .jumpToPresentBar-1cEnH0:hover>button{ | |
| color:#fff | |
| } | |
| .jumpToPresentBar-1cEnH0:active{ | |
| transform:scale(0.99) | |
| } | |
| .messagesErrorBar-1IQ1rH{ | |
| background:var(--danger-color); | |
| border-radius:3px; | |
| transition:all .15s ease-in-out; | |
| padding-bottom:0px | |
| } | |
| .bar-wDIGjg{ | |
| background-color:var(--main-color) | |
| } | |
| .bar-wDIGjg>*{ | |
| color:#fff !important | |
| } | |
| .wrapper-1gVUIN{ | |
| background:rgba(0, 0, 0, calc(var(--background-shading) * 0.6)) | |
| } | |
| .wrapper-1gVUIN.minimum-fXpVNc{ | |
| background:rgba(0, 0, 0, calc(var(--background-shading) * 0.6)) | |
| } | |
| .callContainer-HtHELf{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .tile-2TcwiO{ | |
| background-color:rgba(0,0,0,.7) | |
| } | |
| .button-3Vyz67{ | |
| background-color:var(--main-color) | |
| } | |
| .tile-2Dr6M1{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .participantsButton-1WBdFP{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .participantsButton-1WBdFP:hover{ | |
| background-color:rgba(0,0,0,.6) | |
| } | |
| .border-2Vy6FN.speaking-7QZEkv{ | |
| box-shadow:inset 0 0 0 2px var(--main-color) | |
| } | |
| .button-38aScr.centerButton-1IShs7{ | |
| border-radius:50% | |
| } | |
| .colorable-3rVGna.primaryDark-2UJt1G{ | |
| background-color:rgba(0,0,0,.6); | |
| color:#fff | |
| } | |
| .colorable-3rVGna.primaryDark-2UJt1G:hover{ | |
| background-color:var(--hover-color); | |
| color:#fff | |
| } | |
| .colorable-3rVGna.white-11auuQ{ | |
| color:#fff; | |
| background-color:var(--main-color) | |
| } | |
| .colorable-3rVGna.white-11auuQ:hover{ | |
| background-color:var(--hover-color) | |
| } | |
| .colorable-3rVGna.white-11auuQ.active-3D763s{ | |
| background-color:#fff | |
| } | |
| .colorable-3rVGna.white-11auuQ.active-3D763s:hover{ | |
| background-color:rgba(255,255,255,.7) | |
| } | |
| .colorable-3rVGna.white-11auuQ .centerIcon-JYpTUi,.colorable-3rVGna.white-11auuQ .slash-2yrR11{ | |
| color:#fff | |
| } | |
| .colorable-3rVGna.white-11auuQ .centerIcon-JYpTUi.active-3D763s{ | |
| color:var(--main-color) | |
| } | |
| .colorable-3rVGna.red-3T8maV{ | |
| background-color:var(--danger-color) | |
| } | |
| .isUnread-3Lojb-{ | |
| border-color:var(--main-color) | |
| } | |
| .unreadPill-3nEWYM{ | |
| background-color:var(--main-color) | |
| } | |
| .unreadPillCapStroke-1nE1Q8{ | |
| fill:var(--main-color); | |
| color:var(--main-color) | |
| } | |
| .content-3spvdd{ | |
| color:var(--main-color); | |
| background:rgba(0, 0, 0, calc(var(--background-shading) * 0.5)); | |
| text-transform:uppercase; | |
| border-radius:0; | |
| position:relative | |
| } | |
| .isUnread-3Lojb- .content-3spvdd{ | |
| color:var(--main-color) | |
| } | |
| .content-3spvdd:before{ | |
| content:""; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| position:absolute; | |
| z-index:-1; | |
| background:var(--background-image) var(--background-position)/var(--background-size) var(--background-repeat) var(--background-attachment); | |
| filter:grayscale(var(--background-grayscale)) sepia(var(--background-sepia)) invert(var(--background-invert)) brightness(var(--background-brightness)) contrast(var(--background-contrast)) saturate(var(--background-saturation)) blur(var(--background-blur)) | |
| } | |
| .content-3spvdd:after{ | |
| content:""; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| position:absolute; | |
| z-index:-1; | |
| background:var(--background-overlay) | |
| } | |
| .stageIconBackground-5uF4K9{ | |
| background-color:var(--main-color) | |
| } | |
| .textInput-2xgsSa{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .container-cH6QoY{ | |
| background:rgba(0, 0, 0, calc(var(--background-shading) * 0.5)) | |
| } | |
| .callContainer-BGIngG,.scroller-35tvpe{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .gradientContainer-phMG8d{ | |
| background-image:none | |
| } | |
| .container-2t1JyW,.rowContainer-jDvyA4,.participants-3hk3ND{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .container-36u7Lw>svg{ | |
| fill:#fff | |
| } | |
| .container-36u7Lw>svg>rect{ | |
| fill:var(--main-color) | |
| } | |
| .tileContainer-Os085F:hover{ | |
| background-color:rgba(255,255,255,.05) | |
| } | |
| .container-lqPArA{ | |
| background-color:rgba(0,0,0,.6) | |
| } | |
| .background-29WdEM{ | |
| background-color:var(--main-color) | |
| } | |
| .background-29WdEM .foreground-uvONBR{ | |
| color:#fff | |
| } | |
| .form-3gdLxP{ | |
| margin-top:1px | |
| } | |
| .form-3gdLxP:before{ | |
| display:none | |
| } | |
| .form-3gdLxP .charcounter{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .channelTextArea-1VQBuV{ | |
| background:rgba(0,0,0,.6); | |
| transition:all .15s ease-in-out | |
| } | |
| .channelTextArea-1VQBuV:focus-within{ | |
| box-shadow:0 0 2px 2px var(--main-color) | |
| } | |
| .channelTextArea-1VQBuV .scrollableContainer-15eg7h{ | |
| background:rgba(0,0,0,0); | |
| border:2px solid rgba(0,0,0,0) | |
| } | |
| .channelTextArea-1VQBuV .attachButton-_ACFSu{ | |
| padding:10px 10px 10px 12px | |
| } | |
| .channelTextArea-1VQBuV .attachButton-_ACFSu .attachButtonPlus-3IYelE{ | |
| color:rgba(255,255,255,.7); | |
| transition:all .15s ease-in-out | |
| } | |
| .channelTextArea-1VQBuV .attachButton-_ACFSu:hover .attachButtonPlus-3IYelE{ | |
| color:rgba(255,255,255,.9) | |
| } | |
| .channelTextArea-1VQBuV .textArea-2CLwUE .placeholder-1_mJY1{ | |
| color:rgba(255,255,255,.4) | |
| } | |
| .channelTextArea-1VQBuV .textArea-2CLwUE.textAreaSlate-9-y-k2{ | |
| margin-left:10px | |
| } | |
| .channelTextArea-1VQBuV .button-2fCJ0o{ | |
| color:rgba(255,255,255,.7); | |
| transition:all .15s ease-in-out | |
| } | |
| .channelTextArea-1VQBuV .button-2fCJ0o:hover{ | |
| color:rgba(255,255,255,.9) | |
| } | |
| .channelTextArea-1VQBuV .typing-2J1mQU{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .channelTextArea-1VQBuV .typing-2J1mQU .text-3S7XCz{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .channelTextArea-1VQBuV .typing-2J1mQU .text-3S7XCz>strong{ | |
| color:rgba(255,255,255,.7); | |
| font-weight:700 | |
| } | |
| .fakeLink-1wGafz{ | |
| color:var(--url-color) | |
| } | |
| .wrapper-2SplAX{ | |
| background-color:rgba(0,0,0,.6) | |
| } | |
| .attachedBars-2BCP3l{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .stackedAttachedBar-u4gXN8{ | |
| border-bottom:1px solid rgba(255,255,255,.07) | |
| } | |
| .replyBar-1oi75v,.threadSuggestionBar-3ExSyc{ | |
| background:rgba(0,0,0,0); | |
| border:2px solid rgba(0,0,0,0); | |
| box-shadow:none | |
| } | |
| .mentionButton-3C5YMI{ | |
| padding:4px; | |
| margin-right:3px | |
| } | |
| .mentionButton-3C5YMI.colorMuted-1jNaVo{ | |
| color:#f04747 | |
| } | |
| .mentionButton-3C5YMI.colorLink-12GX9V{ | |
| color:#43b581 | |
| } | |
| .closeButton-3IEry2{ | |
| padding:8px 16px 8px 4px; | |
| margin-left:4px | |
| } | |
| .separator-8ngZ3p{ | |
| visibility:hidden; | |
| height:0px; | |
| width:0px | |
| } | |
| .theme-dark .optionPill-2kmuZR{ | |
| background-color:rgba(255,255,255,.05); | |
| border-color:rgba(255,255,255,.07) | |
| } | |
| .theme-dark .optionPill-2kmuZR.selectedPill-3cOyS6{ | |
| border-color:var(--main-color) !important | |
| } | |
| .theme-dark .optionPillKey-2JyeoP{ | |
| background-color:rgba(255,255,255,.07) | |
| } | |
| .remainingOptions-2kCt8U{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .upload-vLbqu-{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .spamBanner-1auiob{ | |
| background:rgba(0,0,0,.6) | |
| } | |
| .container-lJuBHq{ | |
| background:rgba(0,0,0,.5) | |
| } | |
| .container-lJuBHq .iconContainer-2k2ykS{ | |
| background:rgba(0,0,0,.2) | |
| } | |
| .before_inlineCode-1zngJj,.after_inlineCode-2_JXPm{ | |
| background:rgba(255,255,255,.05); | |
| padding:3.5px .5px | |
| } | |
| .inlineCode-ERyvy_{ | |
| background:rgba(255,255,255,.1); | |
| padding:3.5px .5px | |
| } | |
| .chat-2ZfjoI .autocomplete-3NRXG8{ | |
| background:rgba(0,0,0,0); | |
| overflow:hidden | |
| } | |
| .autocomplete-3NRXG8 .autocompleteInner-y1mjDl{ | |
| background:rgba(0,0,0,.8); | |
| animation:cv-menu-slide-bottom .2s ease-in-out; | |
| transform-origin:50% 100% | |
| } | |
| .autocomplete-3NRXG8 .contentTitle-3CylD3{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .autocomplete-3NRXG8 .iconForeground-2P-YQq{ | |
| fill:rgba(255,255,255,.3) | |
| } | |
| .autocomplete-3NRXG8 [aria-selected=true].clickable-2V8YKY .base-2v-uc0,.autocomplete-3NRXG8 [aria-disabled=false].clickable-2V8YKY .base-2v-uc0:hover{ | |
| background:var(--main-color) | |
| } | |
| .autocomplete-3NRXG8 .base-2v-uc0 .text-xs-medium-2LRpEj,.autocomplete-3NRXG8 .base-2v-uc0 .text-xs-normal-3SiVjE{ | |
| color:#fff !important | |
| } | |
| .autocomplete-3NRXG8 .iconForeground-2P-YQq{ | |
| fill:rgba(255,255,255,.7) | |
| } | |
| .autocomplete-3NRXG8 .autocompleteRowContentSecondary-Oobh2b,.autocomplete-3NRXG8 .autocompleteRowSubheading-6CMP2P{ | |
| color:#fff | |
| } | |
| .wrapper-3z7DuG,.list-33W-Tv,.categoryHeader-OpJ1Ly{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .selected-3B2w1z{ | |
| background-color:var(--main-color) | |
| } | |
| .selected-3B2w1z:hover{ | |
| background-color:var(--main-color) | |
| } | |
| .theme-dark .option-Tt7anD{ | |
| background-color:rgba(0,0,0,.5) | |
| } | |
| .optionals-2w-NPQ{ | |
| border:none | |
| } | |
| .optionalCount-1BzEgg{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .container-1PloNW{ | |
| background:rgba(0,0,0,.3); | |
| border:2px solid var(--main-color) | |
| } | |
| .container-1PloNW:hover{ | |
| background:rgba(0,0,0,.3); | |
| border:2px solid var(--hover-color) | |
| } | |
| .container-1PloNW.isOpen-O7ANQc{ | |
| background-color:rgba(255,255,255,.1); | |
| border-color:var(--main-color) | |
| } | |
| .contentPreview-3fWiuC{ | |
| background-color:rgba(255,255,255,.05); | |
| border-color:rgba(255,255,255,.09) | |
| } | |
| .container-3XgAHv{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .iconWrapper-3plkqh{ | |
| background-color:var(--main-color) | |
| } | |
| .welcomeMessage-3_Mcht .h1-1IDj26{ | |
| color:var(--main-color) | |
| } | |
| .welcomeMessage-3_Mcht .itemContainer-WiE19S .icon-2shpbb{ | |
| filter:grayscale(1); | |
| opacity:.3 | |
| } | |
| .welcomeMessage-3_Mcht .itemContainer-WiE19S p{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .welcomeMessage-3_Mcht .itemContainer-WiE19S strong{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .welcomeMessage-3_Mcht .itemContainer-WiE19S a{ | |
| color:var(--main-color); | |
| transition:all .1s ease-in-out | |
| } | |
| .welcomeMessage-3_Mcht .itemContainer-WiE19S a:hover{ | |
| text-shadow:0 0 1px; | |
| text-decoration:none !important | |
| } | |
| .wrapper-22ayhK{ | |
| background:var(--main-color); | |
| box-shadow:0 0 10px -3px var(--main-color),0 0 0 1px var(--main-color); | |
| color:#fff; | |
| font-size:12px; | |
| font-weight:600; | |
| text-shadow:0 1px 0 rgba(0,0,0,.25); | |
| line-height:12px; | |
| transition:all .3s ease-in-out | |
| } | |
| .selected-1sf9UK .wrapper-22ayhK{ | |
| background:#fff; | |
| box-shadow:none; | |
| color:#000; | |
| mix-blend-mode:screen | |
| } | |
| .numberBadge-37OJ3S,.textBadge-1fdDPJ{ | |
| background:var(--main-color) !important; | |
| box-shadow:0 0 10px -3px var(--main-color),0 0 0 1px var(--main-color); | |
| color:#fff; | |
| font-weight:600; | |
| text-shadow:0 1px 0 rgba(0,0,0,.25); | |
| transition:all .3s ease-in-out | |
| } | |
| .numberBadge-37OJ3S{ | |
| font-size:12px; | |
| line-height:12px | |
| } | |
| .modeSelected-3DmyhH .numberBadge-37OJ3S,.modeSelected-3DmyhH .textBadge-1fdDPJ,.interactiveSelected-29CP8y .numberBadge-37OJ3S,.interactiveSelected-29CP8y .textBadge-1fdDPJ,.selected-g-kMVV .numberBadge-37OJ3S,.selected-g-kMVV .textBadge-1fdDPJ{ | |
| background:#fff !important; | |
| box-shadow:none; | |
| color:var(--main-color); | |
| mix-blend-mode:screen | |
| } | |
| .flowerStarContainer-1QeD-L{ | |
| color:var(--main-color) | |
| } | |
| .flowerStarContainer-1QeD-L .icon-3BYlXK{ | |
| color:#fff | |
| } | |
| .flowerStarContainer-1QeD-L .childContainer-U_a6Yh>svg{ | |
| color:#fff | |
| } | |
| .gameVerifiedIcon-1YMUdQ>svg>path{ | |
| fill:var(--main-color) | |
| } | |
| .button-38aScr{ | |
| border-radius:3px; | |
| transition:all .3s ease-in-out | |
| } | |
| .lookFilled-1H2Jvj.colorGrey-2DXtkV,.lookFilled-1H2Jvj.colorBrand-2M3O3N,.lookFilled-1H2Jvj.colorGreen-jIPCAS,.lookFilled-1H2Jvj.colorBrandNew-abZT3v,.lookFilled-1H2Jvj.colorPrimary-2-Lusz,.lookFilled-1H2Jvj.buttonColor-1u-3JF{ | |
| background:var(--main-color); | |
| color:#fff | |
| } | |
| .lookFilled-1H2Jvj.colorGrey-2DXtkV:hover,.lookFilled-1H2Jvj.colorBrand-2M3O3N:hover,.lookFilled-1H2Jvj.colorGreen-jIPCAS:hover,.lookFilled-1H2Jvj.colorBrandNew-abZT3v:hover,.lookFilled-1H2Jvj.colorPrimary-2-Lusz:hover,.lookFilled-1H2Jvj.buttonColor-1u-3JF:hover{ | |
| background:var(--hover-color) | |
| } | |
| .lookFilled-1H2Jvj.colorGrey-2DXtkV:disabled,.lookFilled-1H2Jvj.colorBrand-2M3O3N:disabled,.lookFilled-1H2Jvj.colorGreen-jIPCAS:disabled,.lookFilled-1H2Jvj.colorBrandNew-abZT3v:disabled,.lookFilled-1H2Jvj.colorPrimary-2-Lusz:disabled,.lookFilled-1H2Jvj.buttonColor-1u-3JF:disabled{ | |
| background:var(--main-color) !important | |
| } | |
| .lookFilled-1H2Jvj.colorGrey-2DXtkV:active,.lookFilled-1H2Jvj.colorBrand-2M3O3N:active,.lookFilled-1H2Jvj.colorGreen-jIPCAS:active,.lookFilled-1H2Jvj.colorBrandNew-abZT3v:active,.lookFilled-1H2Jvj.colorPrimary-2-Lusz:active,.lookFilled-1H2Jvj.buttonColor-1u-3JF:active{ | |
| background:var(--main-color) | |
| } | |
| .lookFilled-1H2Jvj.colorRed-2VFhM4{ | |
| background-color:var(--danger-color) | |
| } | |
| .container-2sjPya .lookFilled-1H2Jvj.colorGreen-jIPCAS{ | |
| background-color:var(--success-color) | |
| } | |
| .container-2sjPya .lookFilled-1H2Jvj.colorGreen-jIPCAS:hover,.container-2sjPya .lookFilled-1H2Jvj.colorGreen-jIPCAS:active{ | |
| background-color:hsl(139, calc(var(--saturation-factor, 1) * 47.1%), 33.3%) | |
| } | |
| .lookInverted-2GrLaB.colorBrand-2M3O3N,.lookInverted-2GrLaB.colorGreen-jIPCAS{ | |
| background:#fff; | |
| color:var(--main-color) | |
| } | |
| .lookInverted-2GrLaB.colorBrand-2M3O3N:hover,.lookInverted-2GrLaB.colorBrand-2M3O3N:active,.lookInverted-2GrLaB.colorGreen-jIPCAS:hover,.lookInverted-2GrLaB.colorGreen-jIPCAS:active{ | |
| background:rgba(255,255,255,.95); | |
| color:var(--hover-color) | |
| } | |
| .lookInverted-2GrLaB.colorBrand-2M3O3N:disabled,.lookInverted-2GrLaB.colorGreen-jIPCAS:disabled{ | |
| background:rgba(255,255,255,.3) | |
| } | |
| .lookOutlined-3RTC7c.colorWhite-1H92hK,.lookOutlined-3RTC7c.colorPrimary-2-Lusz,.lookOutlined-3RTC7c.colorGreen-jIPCAS,.lookOutlined-3RTC7c.colorBrand-2M3O3N{ | |
| border-color:var(--main-color); | |
| color:rgba(255,255,255,.8) | |
| } | |
| .lookOutlined-3RTC7c.colorWhite-1H92hK:hover,.lookOutlined-3RTC7c.colorPrimary-2-Lusz:hover,.lookOutlined-3RTC7c.colorGreen-jIPCAS:hover,.lookOutlined-3RTC7c.colorBrand-2M3O3N:hover{ | |
| background-color:rgba(0,0,0,0); | |
| border-color:var(--hover-color); | |
| color:#fff | |
| } | |
| .lookOutlined-3RTC7c.colorRed-2VFhM4{ | |
| border-color:var(--danger-color); | |
| color:rgba(255,255,255,.8) | |
| } | |
| .lookOutlined-3RTC7c.colorRed-2VFhM4:hover{ | |
| background-color:rgba(0,0,0,0); | |
| color:#fff | |
| } | |
| .lookLink-13iF2K.colorWhite-1H92hK,.lookLink-13iF2K.colorPrimary-2-Lusz{ | |
| color:#fff | |
| } | |
| .lookLink-13iF2K.colorBrand-2M3O3N{ | |
| color:var(--main-color) | |
| } | |
| .lookLink-13iF2K.colorLink-34zig_{ | |
| color:var(--url-color) | |
| } | |
| .lookLink-13iF2K.colorLink-34zig_:disabled:hover .contents-3NembX{ | |
| text-decoration:none | |
| } | |
| .lookLink-13iF2K.colorRed-2VFhM4{ | |
| color:var(--danger-color) | |
| } | |
| .lookLink-13iF2K:hover .contents-3NembX{ | |
| background-image:none; | |
| text-decoration:underline | |
| } | |
| .theme-dark .checkbox-1LuCGM{ | |
| border-color:rgba(255,255,255,.5) | |
| } | |
| .theme-dark .checkbox-1LuCGM.checked-22NTbO{ | |
| background-color:rgba(0,0,0,0) !important; | |
| border-color:var(--main-color) !important | |
| } | |
| .theme-dark .checkbox-1LuCGM.checked-22NTbO>svg>path{ | |
| fill:#fff | |
| } | |
| .inputWrapper-1YNMmM{ | |
| padding:0 2px 2px 2px | |
| } | |
| .input-2g-os5{ | |
| color:var(--text-normal); | |
| background-color:rgba(255,255,255,.07); | |
| border:none; | |
| box-shadow:0 0 0 2px rgba(255,255,255,.09) | |
| } | |
| .input-2g-os5::placeholder{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .input-2g-os5:hover{ | |
| border:none | |
| } | |
| .input-2g-os5:focus,.input-2g-os5.focused-1AtTHC{ | |
| box-shadow:0 0 2px 2px var(--main-color) | |
| } | |
| .input-2g-os5.noBorder-2p63tM{ | |
| border:none; | |
| box-shadow:none; | |
| background:none | |
| } | |
| .input-2g-os5.multiInput-1VARjC{ | |
| background:rgba(0,0,0,0); | |
| box-shadow:none | |
| } | |
| .input-2g-os5 .multiInputFirst-3-OxIz .multiInputField-1zyopx{ | |
| border-radius:3px 0 0 3px | |
| } | |
| .input-2g-os5 .multiInputLast-35zVz0:before{ | |
| height:0; | |
| width:0 | |
| } | |
| .input-2g-os5 .multiInputLast-35zVz0 .multiInputField-1zyopx{ | |
| border-radius:0 3px 3px 0 | |
| } | |
| .theme-dark .pageButton-uta6J3.activeButton-2K2Fwx{ | |
| background-color:var(--main-color) | |
| } | |
| .theme-dark .pageButton-uta6J3:hover{ | |
| background-color:var(--hover-color) | |
| } | |
| .theme-dark .pageButton-uta6J3:hover:disabled{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .endButton-pLBGXH:disabled{ | |
| border-color:var(--main-color); | |
| color:#fff; | |
| opacity:.5; | |
| cursor:not-allowed | |
| } | |
| .endButton-pLBGXH:not(:disabled):hover{ | |
| border-color:var(--hover-color) | |
| } | |
| .item-1TA5qI{ | |
| background-color:rgba(0,0,0,0); | |
| color:#fff | |
| } | |
| .item-1TA5qI:hover:not([aria-checked=true]):not(.disabled-WBmOu_){ | |
| background-color:rgba(0,0,0,0); | |
| color:#fff | |
| } | |
| .item-1TA5qI .radioBar-1XgZqD{ | |
| background-color:rgba(0,0,0,.4); | |
| border-left:3px solid var(--radio-bar-accent-color); | |
| transition:all .15s ease-in-out | |
| } | |
| [aria-checked=true].item-1TA5qI .radioBar-1XgZqD{ | |
| background-color:var(--radio-bar-accent-color, var(--main-color)) | |
| } | |
| .item-1TA5qI .radioIconForeground-3wH3aU{ | |
| color:#fff | |
| } | |
| [style*="--radio-bar-accent-color:var(--status-green-600)"].radioBar-1XgZqD{ | |
| --radio-bar-accent-color: #43b581 !important | |
| } | |
| [style*="--radio-bar-accent-color:var(--status-yellow-560)"].radioBar-1XgZqD{ | |
| --radio-bar-accent-color: #faa61a !important | |
| } | |
| [style*="--radio-bar-accent-color:hsl(21, calc(var(--saturation-factor, 1) * 90.7%), 57.6%)"].radioBar-1XgZqD{ | |
| --radio-bar-accent-color: #e67727 !important | |
| } | |
| [style*="--radio-bar-accent-color:var(--status-red-500)"].radioBar-1XgZqD{ | |
| --radio-bar-accent-color: #982929 !important | |
| } | |
| ::-webkit-scrollbar{ | |
| width:14px !important | |
| } | |
| ::-webkit-scrollbar-thumb,::-webkit-scrollbar-track,::-webkit-scrollbar-track-piece{ | |
| border:3px solid rgba(0,0,0,0) !important; | |
| border-radius:7px !important; | |
| background-clip:padding-box !important | |
| } | |
| ::-webkit-scrollbar-thumb{ | |
| background-color:var(--main-color) !important | |
| } | |
| ::-webkit-scrollbar-thumb:active{ | |
| background-color:var(--hover-color) !important | |
| } | |
| ::-webkit-scrollbar-track,::-webkit-scrollbar-track-piece{ | |
| background-color:rgba(0,0,0,0) !important | |
| } | |
| .membersWrap-3NUR2t .scrollerBase-_bVAAt::-webkit-scrollbar-thumb,.membersWrap-3NUR2t .scrollerBase-_bVAAt::-webkit-scrollbar-track-piece{ | |
| visibility:hidden | |
| } | |
| .membersWrap-3NUR2t .scrollerBase-_bVAAt:hover::-webkit-scrollbar-thumb,.membersWrap-3NUR2t .scrollerBase-_bVAAt:hover::-webkit-scrollbar-track-piece{ | |
| visibility:visible | |
| } | |
| .chat-2ZfjoI .scrollerBase-_bVAAt::-webkit-scrollbar-track-piece,.membersWrap-3NUR2t .scrollerBase-_bVAAt::-webkit-scrollbar-track-piece{ | |
| background-color:rgba(0,0,0,.3) !important | |
| } | |
| textarea::-webkit-scrollbar{ | |
| display:none | |
| } | |
| .none-1rXy4P::-webkit-scrollbar{ | |
| width:0px !important | |
| } | |
| .thin-RnSY0a::-webkit-scrollbar{ | |
| width:10px !important | |
| } | |
| .slider-1mmyV6 .bar-2H7Q9u{ | |
| background:rgba(255,255,255,.04); | |
| transition:all .15s ease-in-out | |
| } | |
| .slider-1mmyV6 .barFill-3RgCsY{ | |
| background:var(--main-color) | |
| } | |
| .slider-1mmyV6 .grabber-3R-Rx9{ | |
| background:#fff; | |
| border:none; | |
| border-radius:5px; | |
| box-shadow:0 0 1px 1px rgba(0,0,0,.3) | |
| } | |
| .slider-1mmyV6:focus .grabber-3R-Rx9{ | |
| box-shadow:0 0 3px 3px var(--hover-color) | |
| } | |
| .loadingPopout-1tyQMM{ | |
| background-color:rgba(0,0,0,.6) | |
| } | |
| .pulsingEllipsisItem-3pNmEc{ | |
| background-color:var(--main-color); | |
| border-radius:50%; | |
| animation:cv-spinner-pulse 1s ease-in-out infinite alternate; | |
| opacity:.3 | |
| } | |
| .pulsingEllipsisItem-3pNmEc:nth-child(2){ | |
| animation-delay:.2s | |
| } | |
| .pulsingEllipsisItem-3pNmEc:nth-child(3){ | |
| animation-delay:.4s | |
| } | |
| .wanderingCubes-2A046F .item-2VgEex{ | |
| width:100%; | |
| height:100%; | |
| background:rgba(0,0,0,0); | |
| animation:none; | |
| filter:drop-shadow(0 0 3px var(--main-color)) | |
| } | |
| .wanderingCubes-2A046F .item-2VgEex:before,.wanderingCubes-2A046F .item-2VgEex:after{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| border:3px solid rgba(0,0,0,0); | |
| border-radius:50% | |
| } | |
| .wanderingCubes-2A046F .item-2VgEex:before{ | |
| animation:cv-spin 1s ease-in-out infinite | |
| } | |
| .wanderingCubes-2A046F .item-2VgEex:after{ | |
| border-color:var(--main-color); | |
| opacity:.1 | |
| } | |
| .wanderingCubes-2A046F .item-2VgEex:first-child:before{ | |
| border-left-color:var(--main-color); | |
| border-right-color:var(--main-color) | |
| } | |
| .wanderingCubes-2A046F .item-2VgEex:last-child{ | |
| width:calc(100% - 10px); | |
| height:calc(100% - 10px); | |
| margin:5px | |
| } | |
| .wanderingCubes-2A046F .item-2VgEex:last-child:before{ | |
| border-top-color:var(--main-color); | |
| border-bottom-color:var(--main-color); | |
| animation-direction:reverse | |
| } | |
| .spinningCircle-3aZig- .path-_o_4bT{ | |
| stroke:var(--main-color) | |
| } | |
| .spinningCircle-3aZig- .path-_o_4bT .path3-3TAamH{ | |
| opacity:.2 | |
| } | |
| .container-1QtPKm{ | |
| background-color:rgba(0,0,0,0) !important | |
| } | |
| .container-1QtPKm:before{ | |
| background-color:rgba(255,255,255,.15); | |
| content:""; | |
| position:absolute; | |
| height:100%; | |
| width:100%; | |
| border-radius:inherit; | |
| transition:all .1s ease-in-out | |
| } | |
| .container-1QtPKm.checked-16gMAN:before{ | |
| background-color:var(--main-color) | |
| } | |
| .container-1QtPKm path{ | |
| fill:var(--main-color) | |
| } | |
| .theme-dark .tooltip-33Jwqe{ | |
| padding:5px 10px; | |
| box-shadow:0 2px 10px rgba(0,0,0,.2); | |
| border-radius:3px; | |
| font-size:13px; | |
| font-weight:600 | |
| } | |
| .layerContainer-2v_Sit .theme-dark .tooltip-33Jwqe{ | |
| color:#fff | |
| } | |
| .theme-dark .tooltip-33Jwqe .tooltipContent-38tm3I{ | |
| padding:0 | |
| } | |
| .theme-dark .tooltip-33Jwqe.tooltipPrimary-2466a2{ | |
| background:rgba(0,0,0,.9) | |
| } | |
| .theme-dark .tooltip-33Jwqe.tooltipPrimary-2466a2>.tooltipPointer-sMBQqe{ | |
| border-top-color:rgba(0,0,0,.9) | |
| } | |
| .theme-dark .tooltip-33Jwqe.tooltipBrand-20XsMA{ | |
| background:var(--main-color) | |
| } | |
| .theme-dark .tooltip-33Jwqe.tooltipBrand-20XsMA>.tooltipPointer-sMBQqe{ | |
| border-top-color:var(--main-color) | |
| } | |
| .theme-dark .tooltip-33Jwqe.tooltipRed-2z14Wl{ | |
| background:var(--danger-color) | |
| } | |
| .theme-dark .tooltip-33Jwqe.tooltipRed-2z14Wl>.tooltipPointer-sMBQqe{ | |
| border-top-color:var(--danger-color) | |
| } | |
| .theme-dark .tooltip-33Jwqe.tooltipGreen-oouJdx{ | |
| background:var(--success-color) | |
| } | |
| .theme-dark .tooltip-33Jwqe.tooltipGreen-oouJdx>.tooltipPointer-sMBQqe{ | |
| border-top-color:var(--success-color) | |
| } | |
| .theme-dark .tooltip-33Jwqe.tooltipTop-CgYHUZ{ | |
| animation:cv-menu-fold-y .15s cubic-bezier(0.2, 0.6, 0.5, 1.1); | |
| transform-origin:50% 100% | |
| } | |
| .theme-dark .tooltip-33Jwqe.tooltipBottom-1itlv3{ | |
| animation:cv-menu-fold-y .15s cubic-bezier(0.2, 0.6, 0.5, 1.1); | |
| transform-origin:50% 0 | |
| } | |
| .theme-dark .tooltip-33Jwqe.tooltipRight-1UPNyA{ | |
| animation:cv-menu-fold-x .15s cubic-bezier(0.2, 0.6, 0.5, 1.1); | |
| transform-origin:0 50% | |
| } | |
| .theme-dark .tooltip-33Jwqe.tooltipLeft-3H43DQ{ | |
| animation:cv-menu-fold-x .15s cubic-bezier(0.2, 0.6, 0.5, 1.1); | |
| transform-origin:100% 50% | |
| } | |
| .theme-dark .tooltip-33Jwqe .hub-3NNcVs>.icon-3BYlXK>circle{ | |
| fill:var(--main-color) | |
| } | |
| .tooltip-1T4pLi{ | |
| background:rgba(0,0,0,.9) | |
| } | |
| .tooltip-1T4pLi>.tooltipPointer-r3VntW{ | |
| border-top-color:rgba(0,0,0,.9) | |
| } | |
| .subscribeTooltipWrapper-3ipXtC{ | |
| background-color:var(--main-color) | |
| } | |
| .subscribeTooltipWrapper-3ipXtC:after{ | |
| border-bottom-color:var(--main-color) | |
| } | |
| .upsellTooltipWrapper-1wqikQ{ | |
| background-color:rgba(0,0,0,.8) | |
| } | |
| .upsellTooltipWrapper-1wqikQ:after{ | |
| border-bottom-color:rgba(0,0,0,.8) | |
| } | |
| .layer-86YKbF .wrapper-1_HaEi{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .platform-osx .unreadMentionsIndicatorTop-2bTgUU{ | |
| top:24px | |
| } | |
| .platform-osx .wrapper-1_HaEi{ | |
| margin-top:0; | |
| padding-top:48px | |
| } | |
| .platform-osx .wrapper-1_HaEi:before{ | |
| content:""; | |
| height:48px; | |
| margin-top:-48px; | |
| background-color:rgba(0,0,0,.3) | |
| } | |
| .wrapper-1_HaEi{ | |
| box-shadow:inset 0 0 20px rgba(0, 0, 0, calc(var(--background-shading) * 0.3)) | |
| } | |
| .theme-dark .scroller-3X7KbA{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .tree-3agP2X{ | |
| outline:none | |
| } | |
| .homeIcon-r0w4ny{ | |
| width:100%; | |
| height:100%; | |
| background:var(--home-icon) var(--home-position)/var(--home-size) no-repeat | |
| } | |
| .homeIcon-r0w4ny>path{ | |
| display:none | |
| } | |
| .icon-3AqZ2e{ | |
| background-color:rgba(0,0,0,.3) | |
| } | |
| .pill-2RsI5Q{ | |
| overflow:hidden | |
| } | |
| .item-2LIpTv{ | |
| width:12px; | |
| margin-left:-6px; | |
| border-radius:20px; | |
| background:var(--main-color); | |
| box-shadow:0 0 20px -1px var(--main-color) | |
| } | |
| [style*="height: 8px"].item-2LIpTv{ | |
| height:10px !important | |
| } | |
| .childWrapper-1j_1ub{ | |
| background-color:rgba(0,0,0,.3); | |
| color:rgba(255,255,255,.7); | |
| transition:all .3s ease-in-out | |
| } | |
| .wrapper-3kah-n:hover .childWrapper-1j_1ub,.wrapper-3kah-n.selected-1Drb7Z .childWrapper-1j_1ub{ | |
| background-color:var(--main-color); | |
| color:#fff | |
| } | |
| .dragInner-1CUBf_{ | |
| background:rgba(255,255,255,.1) | |
| } | |
| .iconBadge-32fMme{ | |
| background:rgba(0,0,0,.7); | |
| box-shadow:0 0 0 1px rgba(0,0,0,.7) | |
| } | |
| .iconBadge-32fMme.participating-2Z81oO{ | |
| background:var(--main-color); | |
| box-shadow:0 0 0 1px var(--main-color) | |
| } | |
| .iconBadge-32fMme.participating-2Z81oO .icon-2Ug6UV{ | |
| color:#fff | |
| } | |
| .icon-2Ug6UV{ | |
| padding:1px; | |
| color:var(--main-color); | |
| filter:drop-shadow(0 0 3px var(--main-color)) | |
| } | |
| .folder-241Joy{ | |
| background-color:rgba(0,0,0,0); | |
| transition:all .3s ease-in-out | |
| } | |
| .folder-241Joy.hover-3m7-WT{ | |
| background-color:rgba(255,255,255,.1) | |
| } | |
| .noIcon-3gSX9V{ | |
| background:rgba(0,0,0,.4) | |
| } | |
| .expandedFolderBackground-1kSAf6{ | |
| background:rgba(255,255,255,.07); | |
| border-radius:16px 16px 24px 24px; | |
| transition:background-color .3s ease-in-out | |
| } | |
| .circleIconButton-1VxDrg{ | |
| background:rgba(0,0,0,.3); | |
| color:rgba(255,255,255,.7); | |
| transition:all .3s ease-in-out | |
| } | |
| .circleIconButton-1VxDrg:hover,.circleIconButton-1VxDrg.selected-2r1Hvo{ | |
| background:var(--main-color); | |
| color:#fff | |
| } | |
| .guildsError-g6NwOI{ | |
| background:rgba(0,0,0,.5); | |
| border:2px solid var(--danger-color); | |
| color:#fff; | |
| transition:all .3s ease-in-out | |
| } | |
| .guildsError-g6NwOI:hover{ | |
| background:var(--danger-color); | |
| border-color:var(--danger-color) | |
| } | |
| .guildSeparator-a4uisj{ | |
| background:rgba(255,255,255,.1) | |
| } | |
| .base-2jDfDU .container-ZMc96U{ | |
| height:48px; | |
| background:rgba(0, 0, 0, calc(var(--background-shading) * 0.6)); | |
| box-shadow:0 0 10px rgba(0, 0, 0, calc(var(--background-shading) * 0.6)); | |
| color:rgba(255,255,255,.5) | |
| } | |
| .base-2jDfDU .chatHeaderBar-2fUORh{ | |
| background:rgba(0, 0, 0, calc(var(--background-shading) * 0.6)); | |
| box-shadow:0 0 10px rgba(0, 0, 0, calc(var(--background-shading) * 0.6)); | |
| color:rgba(255,255,255,.5) | |
| } | |
| .container-ZMc96U .children-3xh0VB{ | |
| -webkit-mask:linear-gradient(to left, transparent, #000 20px); | |
| mask:linear-gradient(to left, transparent, #000 20px) | |
| } | |
| .container-ZMc96U .children-3xh0VB:after{ | |
| display:none | |
| } | |
| .container-ZMc96U .children-3xh0VB .icon-2xnN2Y{ | |
| color:var(--main-color); | |
| filter:drop-shadow(0 0 3px); | |
| width:22px | |
| } | |
| .container-ZMc96U .base-21yXnu{ | |
| margin-left:0; | |
| color:#fff; | |
| text-shadow:0 0 3px #000; | |
| font-family:var(--main-font) | |
| } | |
| .container-ZMc96U .base-21yXnu.muted-eZM05q{ | |
| color:rgba(255,255,255,.3); | |
| text-shadow:none | |
| } | |
| .container-ZMc96U .topic-11NuQZ{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .container-ZMc96U .topic-11NuQZ a{ | |
| color:var(--main-color); | |
| transition:all .1s ease-in-out | |
| } | |
| .container-ZMc96U .topic-11NuQZ a:hover{ | |
| text-shadow:0 0 1px; | |
| text-decoration:none !important | |
| } | |
| .container-ZMc96U .akaBadge-3i7V3p{ | |
| background:rgba(255,255,255,.1); | |
| color:#fff | |
| } | |
| .container-ZMc96U .nicknames-10Sg6e{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .container-ZMc96U .divider-q3P9HC{ | |
| background:rgba(255,255,255,.1) | |
| } | |
| .iconWrapper-2awDjA{ | |
| margin:0 1px; | |
| padding:2px 3px; | |
| box-sizing:content-box | |
| } | |
| .iconWrapper-2awDjA>svg>foreignObject{ | |
| mask:none | |
| } | |
| .input-1nrc5P:focus{ | |
| background-color:rgba(255,255,255,.1) | |
| } | |
| .content-FDHp32 a{ | |
| color:var(--main-color) | |
| } | |
| .breadcrumbs-2uP7wU{ | |
| margin-left:2px | |
| } | |
| .breadcrumbs-2uP7wU .breadcrumb-2tlXzO{ | |
| margin:0 3px; | |
| transition:all .15s ease-in-out | |
| } | |
| .breadcrumbs-2uP7wU .breadcrumbArrow-1LY2zF{ | |
| transition:all .15s ease-in-out | |
| } | |
| .breadcrumbs-2uP7wU .breadcrumbWrapper-3rpYiO{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .breadcrumbs-2uP7wU .breadcrumbWrapper-3rpYiO:hover .breadcrumb-2tlXzO{ | |
| color:rgba(255,255,255,.7); | |
| text-decoration:none | |
| } | |
| .breadcrumbs-2uP7wU .breadcrumbWrapper-3rpYiO:hover .breadcrumbArrow-1LY2zF.directionRight-2cNgoe{ | |
| color:rgba(255,255,255,.7); | |
| transform:rotateY(180deg) rotateZ(-90deg) translateY(3px) | |
| } | |
| .search-2Mwzzq .searchBar-jGtisZ,.libraryFilter-1nwg6T,.browseSearch-e9jF-f{ | |
| width:140px; | |
| height:28px; | |
| padding:2px; | |
| background:rgba(255,255,255,.1); | |
| border-radius:3px; | |
| transition:width .2s ease-in-out .1s | |
| } | |
| .focused-1xh-wG .searchBar-jGtisZ,.open-1F8u2c .searchBar-jGtisZ,.focused-mTQKRf,.focused-20l6Zp{ | |
| width:240px | |
| } | |
| .search-2Mwzzq>.DraftEditor-root{ | |
| color:#fff | |
| } | |
| .search-2Mwzzq .public-DraftEditorPlaceholder-root{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .search-2Mwzzq .searchFilter-2UfsDk,.search-2Mwzzq .searchAnswer-23w-CH{ | |
| background:var(--main-color); | |
| color:#fff | |
| } | |
| .search-2Mwzzq .searchFilter-2UfsDk{ | |
| padding:0 3px | |
| } | |
| .search-2Mwzzq .searchAnswer-23w-CH{ | |
| margin:0 2px 0 0; | |
| padding:0 3px 0 0 | |
| } | |
| .libraryFilter-1nwg6T .container-2oNtJn{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .libraryFilter-1nwg6T .input-2m5SfJ{ | |
| color:#fff | |
| } | |
| .libraryFilter-1nwg6T .input-2m5SfJ::placeholder{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .libraryFilter-1nwg6T .icon-3CDcPB{ | |
| color:rgba(255,255,255,.5); | |
| transition:all .15s ease-in-out | |
| } | |
| .libraryFilter-1nwg6T .iconLayout-3Bjizv:hover .clear-3102V9{ | |
| color:#fff | |
| } | |
| .browseSearch-e9jF-f .container-2oNtJn{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .browseSearch-e9jF-f .input-2m5SfJ{ | |
| color:#fff | |
| } | |
| .browseSearch-e9jF-f .input-2m5SfJ::placeholder{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .browseSearch-e9jF-f .icon-3CDcPB{ | |
| color:rgba(255,255,255,.5); | |
| transition:all .15s ease-in-out | |
| } | |
| .browseSearch-e9jF-f .iconLayout-3Bjizv:hover .clear-3102V9{ | |
| color:#fff | |
| } | |
| .container-2McqkF .queryContainer-ZunrLZ .keybindShortcutSearchPopout-pt_bn5>span{ | |
| display:none | |
| } | |
| .toolbar-3_r2xA .iconWrapper-2awDjA{ | |
| border-radius:3px; | |
| transition:all .3s ease-in-out | |
| } | |
| .toolbar-3_r2xA .iconWrapper-2awDjA .icon-2xnN2Y{ | |
| color:#fff; | |
| opacity:.5; | |
| transition:all .15s ease-in-out | |
| } | |
| .toolbar-3_r2xA .iconWrapper-2awDjA.selected-29KTGM,.toolbar-3_r2xA .iconWrapper-2awDjA.icon-2xnN2Y.popout-open{ | |
| background:rgba(255,255,255,.1) | |
| } | |
| .toolbar-3_r2xA .iconWrapper-2awDjA.selected-29KTGM .icon-2xnN2Y,.toolbar-3_r2xA .iconWrapper-2awDjA.icon-2xnN2Y.popout-open .icon-2xnN2Y{ | |
| opacity:.7 | |
| } | |
| .toolbar-3_r2xA .iconWrapper-2awDjA.clickable-ZD7xvu:hover .icon-2xnN2Y{ | |
| opacity:1 | |
| } | |
| .toolbar-3_r2xA .iconWrapper-2awDjA>svg:not(.icon-2xnN2Y){ | |
| color:var(--main-color); | |
| filter:drop-shadow(0 0 5px); | |
| transition:filter .3s ease-in-out | |
| } | |
| .toolbar-3_r2xA .iconWrapper-2awDjA:hover>svg:not(.icon-2xnN2Y){ | |
| filter:drop-shadow(0 0 5px) drop-shadow(0 0 10px) | |
| } | |
| .toolbar-3_r2xA .iconWrapper-2awDjA .iconBadge-3Mmg92{ | |
| background-color:var(--main-color) | |
| } | |
| .container-ZMc96U .topPill-3DJJNV .item-3XjbnG{ | |
| font-size:14px | |
| } | |
| .container-ZMc96U .topPill-3DJJNV .item-3XjbnG.themed-2-lozF{ | |
| background-color:rgba(0,0,0,0); | |
| color:rgba(255,255,255,.5); | |
| transition:all .3s ease-in-out | |
| } | |
| .container-ZMc96U .topPill-3DJJNV .item-3XjbnG.themed-2-lozF:hover{ | |
| background-color:rgba(0,0,0,.5); | |
| color:rgba(255,255,255,.7) | |
| } | |
| .container-ZMc96U .topPill-3DJJNV .item-3XjbnG.themed-2-lozF.selected-g-kMVV{ | |
| background-color:var(--main-color); | |
| color:#fff | |
| } | |
| .base-2jDfDU .activityFeed-1C0EmJ{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .activityFeed-1C0EmJ .layout-1cQCv2,.activityFeed-1C0EmJ>.flex-3BkGQD:last-child{ | |
| background-color:rgba(0, 0, 0, calc(var(--background-shading) * 0.5)) | |
| } | |
| .activityFeed-1C0EmJ .layout-1cQCv2{ | |
| margin-left:-1px; | |
| padding-left:17px | |
| } | |
| .activityFeed-1C0EmJ .h5-2RwDNl{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .activityFeed-1C0EmJ .coloredText-1kAd0O,.activityFeed-1C0EmJ .body-2d4vNQ{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .activityFeed-1C0EmJ .title-3mg8_z,.activityFeed-1C0EmJ .header-3uLGFv{ | |
| color:#fff | |
| } | |
| .activityFeed-1C0EmJ .colorStandard-21JIj7{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .activityFeed-1C0EmJ .colorMuted-20987_{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .activityFeed-1C0EmJ .card-GqTca8{ | |
| border-radius:5px; | |
| backface-visibility:hidden | |
| } | |
| .activityFeed-1C0EmJ .outer-2IVh5n{ | |
| background-color:rgba(0,0,0,.3); | |
| transition:all .15s ease-in-out | |
| } | |
| .activityFeed-1C0EmJ .outer-2IVh5n.interactive-1BeKSi:hover{ | |
| box-shadow:0 8px 16px rgba(0,0,0,.3); | |
| background-color:rgba(0,0,0,.5) | |
| } | |
| .activityFeed-1C0EmJ .coloredBackground-37Z6Gv{ | |
| background:var(--main-color) | |
| } | |
| .activityFeed-1C0EmJ .wrapper-9ppXpy{ | |
| box-shadow:inset 0 1px rgba(255,255,255,.04) | |
| } | |
| .activityFeed-1C0EmJ .interactive-1FxC7B{ | |
| transition:all .15s ease-in-out | |
| } | |
| .activityFeed-1C0EmJ .interactive-1FxC7B:hover{ | |
| background-color:rgba(255,255,255,.04) | |
| } | |
| .activityFeed-1C0EmJ .shareButton-3w0M74{ | |
| background:rgba(0,0,0,.5); | |
| box-shadow:0 2px 5px rgba(0,0,0,.3); | |
| color:#fff; | |
| transition:all .15s ease-in-out | |
| } | |
| .activityFeed-1C0EmJ .shareButton-3w0M74:hover{ | |
| background:var(--main-color) | |
| } | |
| .activityFeed-1C0EmJ .wrapped-15rg6t,.activityFeed-1C0EmJ .unwrapped-37iUtM{ | |
| background-color:rgba(255,255,255,.07); | |
| border-radius:4px | |
| } | |
| .activityFeed-1C0EmJ .wrapped-15rg6t.clickable-nnkAZy,.activityFeed-1C0EmJ .unwrapped-37iUtM.clickable-nnkAZy{ | |
| transition:all .15s ease-in-out | |
| } | |
| .activityFeed-1C0EmJ .wrapped-15rg6t.clickable-nnkAZy:hover,.activityFeed-1C0EmJ .unwrapped-37iUtM.clickable-nnkAZy:hover{ | |
| background-color:var(--main-color) | |
| } | |
| .activityFeed-1C0EmJ .empty-hejAOj{ | |
| background-color:rgba(255,255,255,.01); | |
| border-radius:4px | |
| } | |
| .activityFeed-1C0EmJ .wrapper-2ULRsd,.activityFeed-1C0EmJ .recentlyPlayedContainer-2F3MqS{ | |
| background-color:rgba(0,0,0,.3) | |
| } | |
| .activityFeed-1C0EmJ [src="/assets/b09888a1a6c74c8bb9af76ee61eb70e7.svg"].headerIcon-2AzihC{ | |
| opacity:.7; | |
| filter:contrast(5); | |
| mix-blend-mode:screen | |
| } | |
| .activityFeed-1C0EmJ .popoutContainer-3WC9HR{ | |
| transition:all .15s ease-in-out | |
| } | |
| .activityFeed-1C0EmJ .popoutContainer-3WC9HR:hover{ | |
| background-color:rgba(255,255,255,.07) | |
| } | |
| .activityFeed-1C0EmJ .body-1BpgWG{ | |
| background-color:rgba(255,255,255,.04); | |
| border-radius:5px | |
| } | |
| .activityFeed-1C0EmJ .section-2VKIPC{ | |
| background-color:rgba(0,0,0,0); | |
| border-radius:5px | |
| } | |
| .activityFeed-1C0EmJ .separator-2c4hi3{ | |
| background-color:rgba(255,255,255,.04) | |
| } | |
| .activityFeed-1C0EmJ .popout-3G62UL{ | |
| background-color:rgba(0,0,0,.8) | |
| } | |
| .activityFeed-1C0EmJ .popout-3G62UL .colorStandard-21JIj7{ | |
| color:inherit | |
| } | |
| .activityFeed-1C0EmJ .enabled-5QKLzu,.activityFeed-1C0EmJ .memberListItem-3V-x8Q{ | |
| color:rgba(255,255,255,.7); | |
| transition:all .15s ease-in-out | |
| } | |
| .activityFeed-1C0EmJ .enabled-5QKLzu:hover,.activityFeed-1C0EmJ .memberListItem-3V-x8Q:hover{ | |
| background-color:var(--main-color); | |
| color:#fff | |
| } | |
| .activityFeed-1C0EmJ .avatarMask-2Mo_pM{ | |
| -webkit-mask:none; | |
| mask:none | |
| } | |
| .activityFeed-1C0EmJ .wrapper-3UweLa{ | |
| background-color:rgba(0,0,0,.3); | |
| border-radius:5px | |
| } | |
| .activityFeed-1C0EmJ .gdprWrapper-33M2Mg{ | |
| background-color:rgba(255,255,255,.07) | |
| } | |
| .activityFeed-1C0EmJ .close-C7sU74{ | |
| color:#fff; | |
| opacity:.5; | |
| transition:all .15s ease-in-out | |
| } | |
| .activityFeed-1C0EmJ .close-C7sU74:hover{ | |
| opacity:1 | |
| } | |
| .activityFeed-1C0EmJ .placeholderWrapper-3FaLtZ{ | |
| background-color:rgba(0,0,0,.1) | |
| } | |
| .theme-dark .container-2cd8Mz{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .peopleColumn-1wMU14{ | |
| background:rgba(0, 0, 0, calc(var(--background-shading) * 0.4)) | |
| } | |
| .peopleListItem-u6dGxF{ | |
| border-top:1px solid rgba(255,255,255,.1) | |
| } | |
| .peopleListItem-u6dGxF:hover,.peopleListItem-u6dGxF.active-2UF8Zh{ | |
| background-color:rgba(255,255,255,.05) | |
| } | |
| .activity-1KqKY2{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .activity-1KqKY2 strong{ | |
| color:var(--main-color) | |
| } | |
| .actionButton-3-B2x-{ | |
| background-color:rgba(0,0,0,.6); | |
| color:#fff | |
| } | |
| .actionButton-3-B2x-.highlight-3DSi7b{ | |
| background-color:rgba(0,0,0,.6); | |
| color:#fff | |
| } | |
| .actionButton-3-B2x-:hover{ | |
| background-color:var(--hover-color); | |
| color:#fff | |
| } | |
| .actionButton-3-B2x-.actionAccept-2nmnLv{ | |
| color:var(--success-color) | |
| } | |
| .actionButton-3-B2x-.actionAccept-2nmnLv:hover{ | |
| background-color:var(--success-color); | |
| color:#fff !important | |
| } | |
| .actionButton-3-B2x-.actionDeny-1pQVuZ{ | |
| color:var(--danger-color) | |
| } | |
| .actionButton-3-B2x-.actionDeny-1pQVuZ:hover{ | |
| background-color:var(--danger-color); | |
| color:#fff !important | |
| } | |
| [aria-controls=add_friend-tab][aria-selected=false].item-2GWPIy{ | |
| background-color:var(--success-color) !important; | |
| color:#fff !important | |
| } | |
| [aria-controls=add_friend-tab][aria-selected=true].item-2GWPIy{ | |
| background-color:rgba(0,0,0,0) !important; | |
| color:var(--success-color) !important; | |
| box-shadow:0 0 0 1px var(--success-color) inset | |
| } | |
| [aria-controls=add_friend-tab][aria-selected=true].item-2GWPIy:before{ | |
| content:""; | |
| position:absolute; | |
| background-color:var(--success-color); | |
| opacity:.2; | |
| width:100%; | |
| height:100%; | |
| z-index:-1 | |
| } | |
| .addFriendInputWrapper-kkoSV9{ | |
| background-color:rgba(255,255,255,.07); | |
| box-shadow:0 0 0 2px rgba(255,255,255,.09); | |
| border:none | |
| } | |
| .addFriendInputWrapper-kkoSV9:focus-within{ | |
| box-shadow:0 0 2px 2px var(--main-color) | |
| } | |
| .addFriendInputWrapper-kkoSV9 .input-2g-os5{ | |
| background-color:rgba(0,0,0,0); | |
| box-shadow:none | |
| } | |
| .addFriendInputWrapper-kkoSV9 .input-2g-os5:focus,.addFriendInputWrapper-kkoSV9 .input-2g-os5.focused-1AtTHC{ | |
| box-shadow:none | |
| } | |
| .addFriendInput-1Ta-rO::placeholder{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .addFriendHint-1EVQJY{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .nowPlayingColumn-1eCBCN{ | |
| background-color:rgba(0, 0, 0, calc(var(--background-shading) * 0.6)) | |
| } | |
| .container-1oAagU{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .scroller-hE2gWq{ | |
| border-left:none | |
| } | |
| .consentCard-1MV_A4{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .theme-dark .outer-2JOHae{ | |
| background-color:rgba(0,0,0,.4); | |
| border:1px solid rgba(0,0,0,0) | |
| } | |
| .theme-dark .outer-2JOHae.interactive-2zD88a:hover,.theme-dark .outer-2JOHae.active-1W_Gl9{ | |
| background-color:rgba(0,0,0,.6) | |
| } | |
| .theme-dark .inset-SbsSFp{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .theme-dark .partyMemberOverflow-3G1oZz{ | |
| background-color:var(--background-overlay) | |
| } | |
| .section-3G9aLW{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .applicationStreamingPreviewWrapper-7j27t8{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .emptyCard-KDifrB{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .emptyText-29ycwI{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .userProfileOuterUnthemed-2b2rsv{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .userProfileOuterUnthemed-2b2rsv .userPanelInnerThemed-2xZFjl{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .overlayBackground-1KgwVi{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .container-36u7Lw,.applicationStore-2nk7Lo{ | |
| background-color:rgba(0, 0, 0, calc(var(--background-shading) * 0.5)) | |
| } | |
| .libraryFilterInput-3JzqZD{ | |
| background-color:rgba(255,255,255,.1); | |
| color:#fff | |
| } | |
| .libraryFilterInput-3JzqZD::placeholder{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .scroller-2XLwLg{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .header-2EadGG{ | |
| background-color:rgba(0,0,0,0); | |
| border-bottom:1px solid rgba(255,255,255,.07) | |
| } | |
| .header-2EadGG>.headerCell-3WoADH{ | |
| border-left-color:rgba(255,255,255,.07); | |
| color:rgba(255,255,255,.3); | |
| transition:all .3s ease-in-out | |
| } | |
| .header-2EadGG>.headerCell-3WoADH:hover:not(.headerCellSorted-2sXjX3){ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .header-2EadGG>.headerCellSorted-2sXjX3{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .rowWrapper-N-4fji{ | |
| background-color:rgba(0,0,0,0); | |
| border-radius:0; | |
| transition:all .15s ease-in-out | |
| } | |
| .rowWrapper-N-4fji{ | |
| margin:0 20px; | |
| padding:0 | |
| } | |
| .rowWrapper-N-4fji+.rowWrapper-N-4fji>.row-1_1Nya{ | |
| margin-top:-1px; | |
| border-top:1px solid rgba(255,255,255,.04) | |
| } | |
| .rowWrapper-N-4fji:hover{ | |
| background-color:rgba(0,0,0,.3) | |
| } | |
| .row-1_1Nya{ | |
| margin:0; | |
| color:rgba(255,255,255,.7) | |
| } | |
| .row-1_1Nya .actionsCell-20cP38 .button-38aScr{ | |
| background-color:rgba(255,255,255,.07); | |
| color:rgba(255,255,255,.7); | |
| transition:all .15s ease-in-out | |
| } | |
| .row-1_1Nya .actionsCell-20cP38:hover .button-38aScr:hover{ | |
| background-color:var(--main-color); | |
| color:#fff | |
| } | |
| .buttonShine-p5V5TB{ | |
| margin-left:-4px | |
| } | |
| .rowBackground-1vJ4Ix{ | |
| border-radius:0; | |
| animation:cv-fade-in 1s ease-in-out | |
| } | |
| .textCell-sKsLUQ{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .lastPlayedCellNew-2sRIP_{ | |
| color:var(--main-color) | |
| } | |
| .settingIcon-1PlYq2{ | |
| color:#fff; | |
| opacity:.5; | |
| transition:all .15s ease-in-out | |
| } | |
| .settingIcon-1PlYq2:hover{ | |
| opacity:1 | |
| } | |
| .rowWrapperDim-huz1mA .nameBodyCell-2RYQL9,.rowWrapperDim-huz1mA .textCell-sKsLUQ,.rowWrapperDim-huz1mA .settingIcon-1PlYq2{ | |
| transition:all .15s ease-in-out | |
| } | |
| .scroller-1TOeMq{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .theme-dark .installationPath-2PbaRC{ | |
| box-shadow:0 1px 0 0 rgba(255,255,255,.06) | |
| } | |
| .theme-dark .background-3laMJt{ | |
| stroke:rgba(0,0,0,.6) | |
| } | |
| .theme-dark .foreground-2JnqVD{ | |
| stroke:var(--main-color) | |
| } | |
| .theme-dark .defaultIndicator-1AxErs{ | |
| background-color:var(--main-color) | |
| } | |
| .selected-11Gl-y,.selected-5uRER3,.messageRequestItem-1_NNAR.active-1iRyqF,.messageRequestItem-1_NNAR:hover{ | |
| background:var(--hover-color); | |
| animation:cv-fade-to-8 .3s ease-in-out | |
| } | |
| .hamBanner-2jDGhV{ | |
| background:rgba(0,0,0,.3) | |
| } | |
| .container-2o3qEW{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .membersWrap-3NUR2t{ | |
| min-width:auto; | |
| min-height:100%; | |
| flex-basis:var(--members-width) | |
| } | |
| .members-3WRCEx{ | |
| width:var(--members-width); | |
| background:rgba(0, 0, 0, calc(var(--background-shading) * 0.6)) | |
| } | |
| .members-3WRCEx>div{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .members-3WRCEx .membersGroup-2eiWxl{ | |
| padding-top:20px; | |
| display:flex; | |
| align-items:center; | |
| justify-content:center; | |
| color:var(--main-color); | |
| font-size:11px; | |
| font-weight:700; | |
| text-align:center; | |
| transition:all .15s ease-in-out; | |
| opacity:.85 | |
| } | |
| .members-3WRCEx .membersGroup-2eiWxl:hover{ | |
| opacity:1 | |
| } | |
| .members-3WRCEx .membersGroup-2eiWxl:before{ | |
| content:""; | |
| height:2px; | |
| flex-grow:1; | |
| background:linear-gradient(to left, currentColor 50%, transparent); | |
| margin-right:5px | |
| } | |
| .members-3WRCEx .membersGroup-2eiWxl:after{ | |
| content:""; | |
| height:2px; | |
| flex-grow:1; | |
| background:linear-gradient(to right, currentColor 50%, transparent); | |
| margin-left:5px | |
| } | |
| .members-3WRCEx .member-2gU6Ar{ | |
| background:rgba(0,0,0,0) !important; | |
| backface-visibility:hidden | |
| } | |
| .members-3WRCEx .member-2gU6Ar.offline-22aM7E .avatar-6qzftW{ | |
| filter:grayscale(100%) blur(1px); | |
| transition:all .5s ease-in-out | |
| } | |
| .members-3WRCEx .member-2gU6Ar.offline-22aM7E:hover .avatar-6qzftW{ | |
| filter:none | |
| } | |
| .members-3WRCEx .member-2gU6Ar .layout-1qmrhw{ | |
| position:relative; | |
| background:rgba(0,0,0,0); | |
| transition:all .15s ease-in-out,transform .1s ease-in-out; | |
| z-index:1 | |
| } | |
| .members-3WRCEx .member-2gU6Ar .layout-1qmrhw:active{ | |
| transform:scale(0.9) | |
| } | |
| .members-3WRCEx .member-2gU6Ar .username-i5-wv->span{ | |
| max-width:100%; | |
| overflow:visible; | |
| transition:all .15s ease-in-out | |
| } | |
| .members-3WRCEx .member-2gU6Ar .username-i5-wv->span:before{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| background:linear-gradient(to right, hsla(0deg, 0%, 100%, 0.07) 90%, transparent); | |
| border-radius:3px; | |
| opacity:0; | |
| transition:all .15s ease-in-out; | |
| z-index:-1; | |
| pointer-events:none | |
| } | |
| .members-3WRCEx .member-2gU6Ar .username-i5-wv->span:after{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:100%; | |
| bottom:0; | |
| left:0; | |
| background:linear-gradient(to right, var(--main-color) 90%, transparent); | |
| border-radius:3px; | |
| opacity:.8; | |
| transition:all .3s ease-in-out; | |
| z-index:-1; | |
| pointer-events:none | |
| } | |
| .members-3WRCEx .member-2gU6Ar .username-i5-wv->span[style^="color:"]:before,.members-3WRCEx .member-2gU6Ar .username-i5-wv->span[style^="color:"]:after{ | |
| background:linear-gradient(to right, currentColor 90%, transparent) | |
| } | |
| .members-3WRCEx .member-2gU6Ar:hover .username-i5-wv->span:before,.members-3WRCEx .member-2gU6Ar.selected-1-Z6gm .username-i5-wv->span:before{ | |
| opacity:1 | |
| } | |
| .members-3WRCEx .member-2gU6Ar:hover .username-i5-wv->span[style^="color:"]:before,.members-3WRCEx .member-2gU6Ar.selected-1-Z6gm .username-i5-wv->span[style^="color:"]:before{ | |
| opacity:.07 | |
| } | |
| .members-3WRCEx .member-2gU6Ar.selected-1-Z6gm .username-i5-wv->span{ | |
| -webkit-text-fill-color:#fff; | |
| text-shadow:0 0 3px rgba(0,0,0,.7) | |
| } | |
| .members-3WRCEx .member-2gU6Ar.selected-1-Z6gm .username-i5-wv->span:after{ | |
| right:0 | |
| } | |
| .members-3WRCEx .member-2gU6Ar .name-3Vmqxm{ | |
| font-size:14px; | |
| color:rgba(255,255,255,.6); | |
| transition:all .15s ease-in-out; | |
| overflow:hidden | |
| } | |
| .members-3WRCEx .member-2gU6Ar .activityText-1rR-8O{ | |
| color:rgba(255,255,255,.4); | |
| transition:all .15s ease-in-out | |
| } | |
| .members-3WRCEx .member-2gU6Ar .activityText-1rR-8O strong{ | |
| color:var(--main-color); | |
| font-weight:700; | |
| transition:all .15s ease-in-out | |
| } | |
| .members-3WRCEx .member-2gU6Ar.selected-1-Z6gm .name-3Vmqxm{ | |
| color:#fff | |
| } | |
| .members-3WRCEx .member-2gU6Ar.selected-1-Z6gm .activityText-1rR-8O{ | |
| text-shadow:0 0 3px rgba(0,0,0,.7); | |
| color:rgba(255,255,255,.7) | |
| } | |
| .members-3WRCEx .member-2gU6Ar.selected-1-Z6gm .activityText-1rR-8O strong{ | |
| color:#fff | |
| } | |
| .members-3WRCEx .member-2gU6Ar.selected-1-Z6gm .ownerIcon-255uKo{ | |
| filter:drop-shadow(0 0 3px rgba(0, 0, 0, 0.7)); | |
| opacity:.7 | |
| } | |
| .members-3WRCEx .member-2gU6Ar.selected-1-Z6gm .icon-Lupfh-,.members-3WRCEx .member-2gU6Ar.selected-1-Z6gm .activityEmoji-SDBJp8{ | |
| filter:drop-shadow(0 0 3px rgba(0, 0, 0, 0.7)) | |
| } | |
| .members-3WRCEx .memberGroupsPlaceholder-9tqX9V{ | |
| margin:0 25%; | |
| display:flex; | |
| align-items:center; | |
| justify-content:center; | |
| flex-basis:50%; | |
| color:rgba(255,255,255,.3) | |
| } | |
| .members-3WRCEx .memberGroupsPlaceholder-9tqX9V:before,.members-3WRCEx .memberGroupsPlaceholder-9tqX9V:after{ | |
| content:""; | |
| height:2px; | |
| flex-grow:1 | |
| } | |
| .members-3WRCEx .memberGroupsPlaceholder-9tqX9V:before{ | |
| background:linear-gradient(to left, currentColor 50%, transparent); | |
| margin-right:calc(50% + 5px); | |
| margin-left:-50% | |
| } | |
| .members-3WRCEx .memberGroupsPlaceholder-9tqX9V:after{ | |
| background:linear-gradient(to right, currentColor 50%, transparent); | |
| margin-right:-50%; | |
| margin-left:calc(50% + 5px) | |
| } | |
| .members-3WRCEx .memberGroupsPlaceholder-9tqX9V,.members-3WRCEx .placeholderAvatar-1qAcRZ,.members-3WRCEx .placeholderUsername-3iQi_D,.members-3WRCEx .mulitplePlaceholderUsername-2T3DCI{ | |
| background:rgba(255,255,255,.3) | |
| } | |
| .addMembersIcon-2xvix1{ | |
| background-color:var(--background-overlay) | |
| } | |
| .emptyStateHeader-3X-dcc{ | |
| padding-top:20px; | |
| display:flex; | |
| align-items:center; | |
| justify-content:center; | |
| color:var(--main-color); | |
| font-size:11px; | |
| font-weight:700; | |
| text-align:center; | |
| transition:all .15s ease-in-out; | |
| opacity:1 | |
| } | |
| .emptyStateHeader-3X-dcc:before{ | |
| content:""; | |
| height:2px; | |
| flex-grow:1; | |
| background:linear-gradient(to left, currentColor 50%, transparent); | |
| margin-right:5px | |
| } | |
| .emptyStateHeader-3X-dcc:after{ | |
| content:""; | |
| height:2px; | |
| flex-grow:1; | |
| background:linear-gradient(to right, currentColor 50%, transparent); | |
| margin-left:5px | |
| } | |
| .emptyStateIcon-2xfcFG{ | |
| background-color:var(--main-color); | |
| color:#fff | |
| } | |
| .contents-2MsGLg>img~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:none; | |
| color:currentcolor; | |
| text-shadow:0 0 2px currentcolor; | |
| border:1px solid; | |
| border-radius:6px; | |
| margin-left:8px; | |
| background-color:rgba(255,255,255,.07); | |
| font-size:10px; | |
| padding:0 5px | |
| } | |
| .contents-2MsGLg>img[src*="194151269399527425"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Admin" | |
| } | |
| .contents-2MsGLg>img[src*="144881947557101568"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Admin" | |
| } | |
| .contents-2MsGLg>img[src*="332394843743584256"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Team" | |
| } | |
| .contents-2MsGLg>img[src*="240437190339854337"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Team" | |
| } | |
| .contents-2MsGLg>img[src*="126652966265421824"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Team" | |
| } | |
| .contents-2MsGLg>img[src*="393900343135830016"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Team" | |
| } | |
| .contents-2MsGLg>img[src*="335677038830682112"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Contributor" | |
| } | |
| .contents-2MsGLg>img[src*="195270435015884800"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Contributor" | |
| } | |
| .contents-2MsGLg>img[src*="236579127090610176"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Contributor" | |
| } | |
| .contents-2MsGLg>img[src*="97797564866236416"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Contributor" | |
| } | |
| .contents-2MsGLg>img[src*="150750980097441792"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Contributor" | |
| } | |
| .contents-2MsGLg>img[src*="213067580531933196"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Contributor" | |
| } | |
| .contents-2MsGLg>img[src*="262989909411758080"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="168551219135119361"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="241500427105992704"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="151995147150819328"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="157699533134888961"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="157492606752784384"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="174525242939670528"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="78890013378486272"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="213263668312408066"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="152431535914614785"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="112619227466182656"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="297873043265552384"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="258031697646321666"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="109933711142719488"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="251260900252712962"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="199184208319610880"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="122731339890950145"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="436228721033216009"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="66214870705516544"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="172426681800196096"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="158311402677731328"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="284122164582416385"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="107965218868457472"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="183795147236966412"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="245133485688225793"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Donator" | |
| } | |
| .contents-2MsGLg>img[src*="538745942493495298"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Translator" | |
| } | |
| .contents-2MsGLg>img[src*="265627010733178892"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"CV Guide Maker" | |
| } | |
| .contents-2MsGLg>img[src*="309976820109803520"]~.header-2jRmjb>.headerText-2z4IhQ>.username-h_Y3Us::after{ | |
| content:"Former CV Team" | |
| } | |
| .message-2CShn3 .avatar-2e8lTP{ | |
| transition:all .3s ease-in-out,transform .1s ease-in-out | |
| } | |
| .message-2CShn3 .avatar-2e8lTP:active{ | |
| transform:scale(0.9) | |
| } | |
| .message-2CShn3 .timestamp-p1Df1m{ | |
| text-align:center; | |
| color:rgba(255,255,255,.5) | |
| } | |
| .message-2CShn3 .container-x059i8{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .message-2CShn3 .markup-eYLPri{ | |
| color:var(--text-normal) | |
| } | |
| .message-2CShn3 .mentioned-Tre-dv{ | |
| background:rgba(255,255,255,.1) | |
| } | |
| .message-2CShn3 .mentioned-Tre-dv:after{ | |
| background:rgba(255,255,255,.1); | |
| border-left:4px solid var(--main-color); | |
| border-radius:2px 0 0 2px | |
| } | |
| .message-2CShn3 .markup-eYLPri .blockquoteDivider-363utW{ | |
| background:rgba(255,255,255,.2); | |
| border-radius:0 | |
| } | |
| .message-2CShn3>div[style^="border-radius: 2px;"]{ | |
| border-radius:3px !important; | |
| animation:cv-message-jump 2s ease-in-out | |
| } | |
| .message-2CShn3>div[style^="border-radius: 2px;"][style$="0);"]{ | |
| animation:none | |
| } | |
| .inlineMediaEmbed-1m3ApS{ | |
| max-width:max-content | |
| } | |
| .markup-eYLPri a,.anchor-1X4H4q{ | |
| color:var(--url-color) | |
| } | |
| .theme-dark .tile-2mmK5T{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .theme-dark .tile-2mmK5T:hover{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .repliedMessage-3Z6XBG:before{ | |
| border-color:var(--main-color) | |
| } | |
| .repliedMessage-3Z6XBG .repliedTextPreview-1bvxun{ | |
| opacity:.7 | |
| } | |
| .repliedMessage-3Z6XBG .repliedTextPreview-1bvxun.clickable-31pE3P:hover{ | |
| opacity:1 | |
| } | |
| .repliedMessage-3Z6XBG .repliedTextPreview-1bvxun .repliedTextContent-2hOYMB{ | |
| color:#fff | |
| } | |
| .repliedMessage-3Z6XBG .repliedTextPreview-1bvxun .repliedTextPlaceholder-1Njd47{ | |
| color:var(--main-color) | |
| } | |
| .repliedMessage-3Z6XBG .repliedTextContentIcon-1LQXRB{ | |
| opacity:.7 | |
| } | |
| .repliedTextPreview-1bvxun:hover+.repliedMessage-3Z6XBG .repliedTextContentIcon-1LQXRB{ | |
| opacity:1 | |
| } | |
| .repliedMessage-3Z6XBG.executedCommand-14-SNW .commandName-1KhvGm{ | |
| color:var(--main-color) | |
| } | |
| .icon-3OHhZU{ | |
| color:var(--main-color); | |
| filter:drop-shadow(0 0 3px); | |
| width:22px | |
| } | |
| .container-3i3IzO{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .cta-1XhfrG{ | |
| color:var(--main-color) | |
| } | |
| .cozy-VmLDNB.hasThread-3h-KJV:after{ | |
| border-color:var(--main-color) | |
| } | |
| .jump-1vIlrw{ | |
| background-color:var(--main-color); | |
| color:#fff | |
| } | |
| .jump-1vIlrw:hover{ | |
| background-color:var(--hover-color); | |
| color:#fff | |
| } | |
| .wrapper-2vIMkT{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .wrapper-2vIMkT .button-3bklZh{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .wrapper-2vIMkT .button-3bklZh:hover,.wrapper-2vIMkT .button-3bklZh.selected-69H4ua{ | |
| background-color:rgba(255,255,255,.1); | |
| color:#fff | |
| } | |
| .theme-dark .operations-3q3u6E{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .theme-dark .operations-3q3u6E>a{ | |
| color:var(--main-color) | |
| } | |
| .replying-eZ7p5z{ | |
| background-color:rgba(255,255,255,.05) | |
| } | |
| .mouse-mode.full-motion .replying-eZ7p5z:hover{ | |
| background-color:rgba(255,255,255,.08) | |
| } | |
| .replying-eZ7p5z:before{ | |
| background-color:var(--main-color) | |
| } | |
| .compactButton-3hG-bs,.compactButtonDisabled-MwB2d6{ | |
| background-color:var(--main-color) | |
| } | |
| .compactButton-3hG-bs:hover{ | |
| background-color:var(--hover-color) | |
| } | |
| .bumpBox-1Pp4td{ | |
| background:rgba(0,0,0,.4) | |
| } | |
| .icon-3N9zCW,.tagline-7EjHTm{ | |
| color:#fff | |
| } | |
| .closeIcon-2Qp1gl,.hidePermanently-3f2ZH0{ | |
| color:rgba(255,255,255,.4) !important | |
| } | |
| .invite-3uuHYQ .header-1Fx4D1{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .invite-3uuHYQ .partyStatus-2-VcyG{ | |
| color:#fff | |
| } | |
| .invite-3uuHYQ .helpIcon-24pk1Z{ | |
| display:flex; | |
| background:rgba(255,255,255,.07); | |
| transition:all .15s ease-in-out; | |
| opacity:0 | |
| } | |
| .invite-3uuHYQ:hover .helpIcon-24pk1Z{ | |
| opacity:.7 | |
| } | |
| .invite-3uuHYQ:hover .helpIcon-24pk1Z:hover{ | |
| opacity:1 | |
| } | |
| .invite-3uuHYQ .artworkSpotifySessionEnded-D18iXB{ | |
| filter:grayscale(1) brightness(2); | |
| opacity:.3 | |
| } | |
| .invite-3uuHYQ .partyMemberEmpty-GtlQ_s{ | |
| background:rgba(255,255,255,.07) | |
| } | |
| .theme-dark .attachment-1PZZB2{ | |
| background:rgba(255,255,255,.06); | |
| border-color:rgba(255,255,255,.08) | |
| } | |
| .icon-1KCy88{ | |
| width:30px; | |
| height:30px; | |
| box-sizing:border-box; | |
| padding-left:30px; | |
| background-image:url(https://clearvision.github.io/icons/file.svg); | |
| background-position:center; | |
| background-size:100%; | |
| background-repeat:no-repeat; | |
| opacity:.5 | |
| } | |
| :not(.embedWrapper-1MtIDg)>[title=unknown].icon-1KCy88{ | |
| background-image:url(https://clearvision.github.io/icons/file_upload.svg) | |
| } | |
| [title=document].icon-1KCy88{ | |
| background-image:url(https://clearvision.github.io/icons/file_document.svg) | |
| } | |
| [title=archive].icon-1KCy88{ | |
| background-image:url(https://clearvision.github.io/icons/file_archive.svg) | |
| } | |
| [title=code].icon-1KCy88{ | |
| background-image:url(https://clearvision.github.io/icons/file_code.svg) | |
| } | |
| [title=webcode].icon-1KCy88{ | |
| background-image:url(https://clearvision.github.io/icons/file_webcode.svg) | |
| } | |
| [title=ai].icon-1KCy88,[title=ps].icon-1KCy88,[title=photoshop].icon-1KCy88,[title=sketch].icon-1KCy88{ | |
| background-image:url(https://clearvision.github.io/icons/file_image.svg) | |
| } | |
| [title=ae].icon-1KCy88{ | |
| background-image:url(https://clearvision.github.io/icons/file_video.svg) | |
| } | |
| [title=spreadsheet].icon-1KCy88{ | |
| background-image:url(https://clearvision.github.io/icons/file_table.svg) | |
| } | |
| [title=acrobat].icon-1KCy88{ | |
| background-image:url(https://clearvision.github.io/icons/file_pdf.svg) | |
| } | |
| .fileNameLink-1odyIc{ | |
| color:var(--main-color); | |
| transition:all .1s ease-in-out | |
| } | |
| .fileNameLink-1odyIc:hover{ | |
| text-shadow:0 0 1px; | |
| text-decoration:none !important | |
| } | |
| .downloadButton-2HLFWN,.cancelButton-oOSTov{ | |
| color:rgba(255,255,255,.3); | |
| transition:all .15s ease-in-out | |
| } | |
| .downloadButton-2HLFWN:hover,.cancelButton-oOSTov:hover{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .metadata-1E7Z4i{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .attachment-1PZZB2 .filename-3A5bVl{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .attachment-1PZZB2 .size-2mQ7x9{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .progress-xNqAjK{ | |
| background:rgba(255,255,255,.04) !important | |
| } | |
| .progressBar-1T6LYX{ | |
| background:var(--main-color) !important | |
| } | |
| .messageGroupBlocked-3wrQQX{ | |
| position:relative; | |
| background:rgba(0,0,0,.1) !important; | |
| border:none; | |
| border-radius:0; | |
| transition:all .15s ease-in-out | |
| } | |
| .messageGroupBlocked-3wrQQX:hover{ | |
| box-shadow:none !important | |
| } | |
| .messageGroupBlocked-3wrQQX .messageGroupBlockedBtn-1PBBh-{ | |
| background:rgba(0,0,0,0) !important; | |
| color:rgba(255,255,255,.3) !important; | |
| transition:all .15s ease-in-out | |
| } | |
| .messageGroupBlocked-3wrQQX .messageGroupBlockedBtn-1PBBh-:after{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| border-top:1px solid; | |
| border-bottom:1px solid; | |
| border-color:rgba(255,255,255,.04); | |
| transition:all .15s ease-in-out; | |
| pointer-events:none | |
| } | |
| .messageGroupBlocked-3wrQQX .messageGroupBlockedBtn-1PBBh-:hover{ | |
| color:rgba(255,255,255,.5) !important | |
| } | |
| .messageGroupBlocked-3wrQQX .messageGroupBlockedBtn-1PBBh-:hover:after{ | |
| border-color:rgba(255,255,255,.07) | |
| } | |
| .messageGroupBlocked-3wrQQX+.divider-2rZFJK{ | |
| margin-top:25px | |
| } | |
| .divider-2rZFJK+.messageGroupBlocked-3wrQQX{ | |
| margin-top:25px | |
| } | |
| .blockedAction-2cPk2G{ | |
| color:var(--main-color) | |
| } | |
| .blockedSystemMessage-3FmE9n:hover .blockedAction-2cPk2G{ | |
| color:var(--hover-color) | |
| } | |
| .markup-eYLPri code.inline{ | |
| padding:3.5px 7.5px; | |
| background-color:rgba(255,255,255,.1); | |
| border-radius:3px; | |
| color:rgba(255,255,255,.7); | |
| font-family:var(--code-font); | |
| line-height:22px | |
| } | |
| .markup-eYLPri code.inline+pre{ | |
| margin-top:-1px | |
| } | |
| pre{ | |
| padding:0; | |
| background:rgba(0,0,0,0); | |
| border:2px solid rgba(255,255,255,.05); | |
| border-radius:8px; | |
| font-family:var(--code-font) | |
| } | |
| pre>.hljs{ | |
| position:relative; | |
| padding:6px; | |
| background:rgba(0,0,0,.42); | |
| border:none; | |
| color:rgba(255,255,255,.7) | |
| } | |
| pre>.hljs:before{ | |
| height:10px; | |
| color:rgba(255,255,255,.3); | |
| line-height:10px; | |
| opacity:1 | |
| } | |
| code{ | |
| font-family:var(--code-font) | |
| } | |
| .hljs:before{ | |
| display:block; | |
| float:right; | |
| text-align:right; | |
| line-height:100%; | |
| opacity:.5; | |
| pointer-events:none | |
| } | |
| .hljs[class~="1c"i]:before{ | |
| content:"1C:Enterprise" | |
| } | |
| .hljs[class~=abnf i]:before{ | |
| content:"ABNF" | |
| } | |
| .hljs[class~=accesslog i]:before{ | |
| content:"Access Log" | |
| } | |
| .hljs[class~=as i]:before,.hljs[class~=actionscript i]:before{ | |
| content:"ActionScript" | |
| } | |
| .hljs[class~=ada i]:before{ | |
| content:"Ada" | |
| } | |
| .hljs[class~=apacheconf i]:before,.hljs[class~=apache i]:before{ | |
| content:"Apache" | |
| } | |
| .hljs[class~=osascript i]:before,.hljs[class~=applescript i]:before{ | |
| content:"Applescript" | |
| } | |
| .hljs[class~=arduino i]:before{ | |
| content:"Arduino" | |
| } | |
| .hljs[class~=arm i]:before,.hljs[class~=armasm i]:before{ | |
| content:"ARM Assembly" | |
| } | |
| .hljs[class~=adoc i]:before,.hljs[class~=asciidoc i]:before{ | |
| content:"AsciiDoc" | |
| } | |
| .hljs[class~=aspectj i]:before{ | |
| content:"AspectJ" | |
| } | |
| .hljs[class~=atom i]:before{ | |
| content:"Atom Feed (XML)" | |
| } | |
| .hljs[class~=autohotkey i]:before{ | |
| content:"AutoHotkey" | |
| } | |
| .hljs[class~=autoit i]:before{ | |
| content:"AutoIt" | |
| } | |
| .hljs[class~=avrasm i]:before{ | |
| content:"AVR Assembler" | |
| } | |
| .hljs[class~=awk i]:before{ | |
| content:"awk" | |
| } | |
| .hljs[class~=axapta i]:before{ | |
| content:"Axapta" | |
| } | |
| .hljs[class~=zsh i]:before,.hljs[class~=sh i]:before,.hljs[class~=bash i]:before{ | |
| content:"Bash" | |
| } | |
| .hljs[class~=basic i]:before{ | |
| content:"Basic" | |
| } | |
| .hljs[class~=cmd i]:before,.hljs[class~=bat i]:before,.hljs[class~=dos i]:before{ | |
| content:"Batch" | |
| } | |
| .hljs[class~=bf i]:before,.hljs[class~=bnf i]:before{ | |
| content:"BNF" | |
| } | |
| .hljs[class~=brainfuck i]:before{ | |
| content:"Brainfuck" | |
| } | |
| .hljs[class~=h i]:before,.hljs[class~=c i]:before{ | |
| content:"C/C++" | |
| } | |
| .hljs[class~=hpp i]:before,.hljs[class~=cpp i]:before,.hljs[class~=cc i]:before{ | |
| content:"C++" | |
| } | |
| .hljs[class~=csharp i]:before,.hljs[class~=cs i]:before{ | |
| content:"C#" | |
| } | |
| .hljs[class~=cal i]:before{ | |
| content:"C/AL" | |
| } | |
| .hljs[class~=capnp i]:before,.hljs[class~=capnproto i]:before{ | |
| content:"Cap'n Proto" | |
| } | |
| .hljs[class~=ceylon i]:before{ | |
| content:"Ceylon" | |
| } | |
| .hljs[class~=dcl i]:before,.hljs[class~=icl i]:before,.hljs[class~=clean i]:before{ | |
| content:"Clean" | |
| } | |
| .hljs[class~=clj i]:before,.hljs[class~=clojure i]:before{ | |
| content:"Clojure" | |
| } | |
| .hljs[class~=clojure-repl i]:before{ | |
| content:"Clojure REPL" | |
| } | |
| .hljs[class~=cmake i]:before{ | |
| content:"CMake" | |
| } | |
| .hljs[class~=iced i]:before,.hljs[class~=cson i]:before,.hljs[class~=coffee i]:before,.hljs[class~=coffeescript i]:before{ | |
| content:"CoffeeScript" | |
| } | |
| .hljs[class~=coq i]:before{ | |
| content:"Coq" | |
| } | |
| .hljs[class~=cls i]:before,.hljs[class~=cos i]:before{ | |
| content:"Caché Object Script" | |
| } | |
| .hljs[class~=podspec i]:before{ | |
| content:"CocoaPod" | |
| } | |
| .hljs[class~=pcmk i]:before,.hljs[class~=crm i]:before,.hljs[class~=crmsh i]:before{ | |
| content:"crmsh" | |
| } | |
| .hljs[class~=cr i]:before,.hljs[class~=crystal i]:before{ | |
| content:"Crystal" | |
| } | |
| .hljs[class~=csp i]:before{ | |
| content:"CSP" | |
| } | |
| .hljs[class~=css i]:before{ | |
| content:"CSS" | |
| } | |
| .hljs[class~=d i]:before{ | |
| content:"D" | |
| } | |
| .hljs[class~=dart i]:before{ | |
| content:"Dart" | |
| } | |
| .hljs[class~=dpr i]:before,.hljs[class~=dfm i]:before,.hljs[class~=delphi i]:before{ | |
| content:"Delphi (Object Pascal)" | |
| } | |
| .hljs[class~=patch i]:before,.hljs[class~=diff i]:before{ | |
| content:"Diff" | |
| } | |
| .hljs[class~=django i]:before{ | |
| content:"Django" | |
| } | |
| .hljs[class~=zone i]:before,.hljs[class~=bind i]:before,.hljs[class~=dns i]:before{ | |
| content:"DNS Zone File" | |
| } | |
| .hljs[class~=docker i]:before,.hljs[class~=dockerfile i]:before{ | |
| content:"Dockerfile" | |
| } | |
| .hljs[class~=dsconfig i]:before{ | |
| content:"dsconfig" | |
| } | |
| .hljs[class~=dts i]:before{ | |
| content:"Device Tree" | |
| } | |
| .hljs[class~=dst i]:before,.hljs[class~=dust i]:before{ | |
| content:"Dust" | |
| } | |
| .hljs[class~=ebnf i]:before{ | |
| content:"EBNF" | |
| } | |
| .hljs[class~=elixir i]:before{ | |
| content:"Elixir" | |
| } | |
| .hljs[class~=elm i]:before{ | |
| content:"Elm" | |
| } | |
| .hljs[class~=erb i]:before{ | |
| content:"eRuby" | |
| } | |
| .hljs[class~=erl i]:before,.hljs[class~=erlang i]:before{ | |
| content:"Erlang" | |
| } | |
| .hljs[class~=erlang-repl i]:before{ | |
| content:"Erlang REPL" | |
| } | |
| .hljs[class~=xlsx i]:before,.hljs[class~=xls i]:before,.hljs[class~=excel i]:before{ | |
| content:"Excel" | |
| } | |
| .hljs[class~=fsharp i]:before,.hljs[class~=fs i]:before{ | |
| content:"F#" | |
| } | |
| .hljs[class~=fix i]:before{ | |
| content:"Fix" | |
| } | |
| .hljs[class~=flix i]:before{ | |
| content:"Flix" | |
| } | |
| .hljs[class~=f95 i]:before,.hljs[class~=f90 i]:before,.hljs[class~=fortran i]:before{ | |
| content:"Fortran" | |
| } | |
| .hljs[class~=gms i]:before,.hljs[class~=gams i]:before{ | |
| content:"GAMS" | |
| } | |
| .hljs[class~=gss i]:before,.hljs[class~=gauss i]:before{ | |
| content:"GAUSS" | |
| } | |
| .hljs[class~=nc i]:before,.hljs[class~=gcode i]:before{ | |
| content:"G-code" | |
| } | |
| .hljs[class~=feature i]:before,.hljs[class~=gherkin i]:before{ | |
| content:"Gherkin" | |
| } | |
| .hljs[class~=glsl i]:before{ | |
| content:"GLSL" | |
| } | |
| .hljs[class~=golang i]:before,.hljs[class~=go i]:before{ | |
| content:"Go" | |
| } | |
| .hljs[class~=golo i]:before{ | |
| content:"Golo" | |
| } | |
| .hljs[class~=gradle i]:before{ | |
| content:"Gradle" | |
| } | |
| .hljs[class~=groovy i]:before{ | |
| content:"Groovy" | |
| } | |
| .hljs[class~=haml i]:before{ | |
| content:"Haml" | |
| } | |
| .hljs[class~=hbs i]:before,.hljs[class~=handlebars i]:before{ | |
| content:"Handlebars" | |
| } | |
| .hljs[class~=hs i]:before,.hljs[class~=haskell i]:before{ | |
| content:"Haskell" | |
| } | |
| .hljs[class~=hx i]:before,.hljs[class~=haxe i]:before{ | |
| content:"Haxe" | |
| } | |
| .hljs[class~=hsp i]:before{ | |
| content:"HSP" | |
| } | |
| .hljs[class~=html i]:before{ | |
| content:"HTML" | |
| } | |
| .hljs[class~=htmlbars i]:before{ | |
| content:"HTMLBars" | |
| } | |
| .hljs[class~=http i]:before{ | |
| content:"HTTP" | |
| } | |
| .hljs[class~=https i]:before{ | |
| content:"HTTPS" | |
| } | |
| .hljs[class~=hylang i]:before,.hljs[class~=hy i]:before{ | |
| content:"Hy" | |
| } | |
| .hljs[class~=i7 i]:before,.hljs[class~=inform7 i]:before{ | |
| content:"Inform7" | |
| } | |
| .hljs[class~=ini i]:before{ | |
| content:"INI" | |
| } | |
| .hljs[class~=irb i]:before{ | |
| content:"IRB" | |
| } | |
| .hljs[class~=irpf90 i]:before{ | |
| content:"IRPF90" | |
| } | |
| .hljs[class~=jsp i]:before,.hljs[class~=java i]:before{ | |
| content:"Java" | |
| } | |
| .hljs[class~=jsx i]:before,.hljs[class~=js i]:before,.hljs[class~=javascript i]:before{ | |
| content:"JavaScript/JSX" | |
| } | |
| .hljs[class~=xjb i]:before{ | |
| content:"JAXB (XML)" | |
| } | |
| .hljs[class~=wildfly-cli i]:before,.hljs[class~=jboss-cli i]:before{ | |
| content:"JBoss CLI" | |
| } | |
| .hljs[class~=jinja i]:before{ | |
| content:"Jinja" | |
| } | |
| .hljs[class~=json i]:before{ | |
| content:"JSON" | |
| } | |
| .hljs[class~=julia i]:before{ | |
| content:"Julia" | |
| } | |
| .hljs[class~=julia-repl i]:before{ | |
| content:"Julia REPL" | |
| } | |
| .hljs[class~=kotlin i]:before{ | |
| content:"Kotlin" | |
| } | |
| .hljs[class~=ls i]:before,.hljs[class~=lassoscript i]:before,.hljs[class~=lasso i]:before{ | |
| content:"Lasso" | |
| } | |
| .hljs[class~=ldif i]:before{ | |
| content:"LDIF" | |
| } | |
| .hljs[class~=leaf i]:before{ | |
| content:"Leaf" | |
| } | |
| .hljs[class~=less i]:before{ | |
| content:"Less" | |
| } | |
| .hljs[class~=lisp i]:before{ | |
| content:"Lisp" | |
| } | |
| .hljs[class~=livecodeserver i]:before{ | |
| content:"LiveCode Server" | |
| } | |
| .hljs[class~=ls i]:before,.hljs[class~=livescript i]:before{ | |
| content:"LiveScript" | |
| } | |
| .hljs[class~=llvm i]:before{ | |
| content:"LLVM IR" | |
| } | |
| .hljs[class~=lsl i]:before{ | |
| content:"LSL" | |
| } | |
| .hljs[class~=lua i]:before{ | |
| content:"Lua" | |
| } | |
| .hljs[class~=mak i]:before,.hljs[class~=mk i]:before,.hljs[class~=makefile i]:before{ | |
| content:"Makefile" | |
| } | |
| .hljs[class~=mkdown i]:before,.hljs[class~=mkd i]:before,.hljs[class~=md i]:before,.hljs[class~=markdown i]:before{ | |
| content:"Markdown" | |
| } | |
| .hljs[class~=mma i]:before,.hljs[class~=mathematica i]:before{ | |
| content:"Mathematica" | |
| } | |
| .hljs[class~=matlab i]:before{ | |
| content:"MatLab" | |
| } | |
| .hljs[class~=maxima i]:before{ | |
| content:"Maxima" | |
| } | |
| .hljs[class~=mel i]:before{ | |
| content:"MEL" | |
| } | |
| .hljs[class~=moo i]:before,.hljs[class~=m i]:before,.hljs[class~=mercury i]:before{ | |
| content:"Mercury" | |
| } | |
| .hljs[class~=mips i]:before,.hljs[class~=mipsasm i]:before{ | |
| content:"MIPS Assembly" | |
| } | |
| .hljs[class~=mikrotik i]:before,.hljs[class~=routeros i]:before{ | |
| content:"Mikrotik RouterOS" | |
| } | |
| .hljs[class~=mizar i]:before{ | |
| content:"Mizar" | |
| } | |
| .hljs[class~=mojolicious i]:before{ | |
| content:"Mojolicious" | |
| } | |
| .hljs[class~=monkey i]:before{ | |
| content:"Monkey" | |
| } | |
| .hljs[class~=moon i]:before,.hljs[class~=moonscript i]:before{ | |
| content:"MoonScript" | |
| } | |
| .hljs[class~=n1ql i]:before{ | |
| content:"N1QL" | |
| } | |
| .hljs[class~=nginxconf i]:before,.hljs[class~=nginx i]:before{ | |
| content:"Nginx" | |
| } | |
| .hljs[class~=nim i]:before,.hljs[class~=nimrod i]:before{ | |
| content:"Nimrod" | |
| } | |
| .hljs[class~=nixos i]:before,.hljs[class~=nix i]:before{ | |
| content:"Nix" | |
| } | |
| .hljs[class~=nsis i]:before{ | |
| content:"NSIS" | |
| } | |
| .hljs[class~=mm i]:before,.hljs[class~=obj-c i]:before,.hljs[class~=objc i]:before,.hljs[class~=objectivec i]:before{ | |
| content:"Objective-C" | |
| } | |
| .hljs[class~=ml i]:before,.hljs[class~=ocaml i]:before{ | |
| content:"OCaml" | |
| } | |
| .hljs[class~=scad i]:before,.hljs[class~=openscad i]:before{ | |
| content:"OpenSCAD" | |
| } | |
| .hljs[class~=ruleslanguage i]:before{ | |
| content:"Oracle Rules Language" | |
| } | |
| .hljs[class~=oxygene i]:before{ | |
| content:"Oxygene" | |
| } | |
| .hljs[class~=parser3 i]:before{ | |
| content:"Parser3" | |
| } | |
| .hljs[class~=lpr i]:before,.hljs[class~=lfm i]:before,.hljs[class~=lazarus i]:before,.hljs[class~=freepascal i]:before,.hljs[class~=pas i]:before,.hljs[class~=pascal i]:before{ | |
| content:"Pascal/Object Pascal" | |
| } | |
| .hljs[class~=pm i]:before,.hljs[class~=pl i]:before,.hljs[class~=perl i]:before{ | |
| content:"Perl" | |
| } | |
| .hljs[class~=pf i]:before{ | |
| content:"OpenBSD PF" | |
| } | |
| .hljs[class~=php6 i]:before,.hljs[class~=php5 i]:before,.hljs[class~=php4 i]:before,.hljs[class~=php3 i]:before,.hljs[class~=php i]:before{ | |
| content:"PHP" | |
| } | |
| .hljs[class~=pony i]:before{ | |
| content:"Pony" | |
| } | |
| .hljs[class~=ps i]:before,.hljs[class~=powershell i]:before{ | |
| content:"PowerShell" | |
| } | |
| .hljs[class~=processing i]:before{ | |
| content:"Processing" | |
| } | |
| .hljs[class~=prolog i]:before{ | |
| content:"Prolog" | |
| } | |
| .hljs[class~=plist i]:before{ | |
| content:"Property List" | |
| } | |
| .hljs[class~=protobuf i]:before{ | |
| content:"Protocol Buffers" | |
| } | |
| .hljs[class~=pp i]:before,.hljs[class~=puppet i]:before{ | |
| content:"Puppet" | |
| } | |
| .hljs[class~=pbi i]:before,.hljs[class~=pb i]:before,.hljs[class~=purebasic i]:before{ | |
| content:"PureBASIC" | |
| } | |
| .hljs[class~=gyp i]:before,.hljs[class~=py i]:before,.hljs[class~=python i]:before{ | |
| content:"Python" | |
| } | |
| .hljs[class~=profile i]:before{ | |
| content:"Python profile" | |
| } | |
| .hljs[class~=kdb i]:before,.hljs[class~=k i]:before,.hljs[class~=q i]:before{ | |
| content:"Q" | |
| } | |
| .hljs[class~=qt i]:before,.hljs[class~=qml i]:before{ | |
| content:"QML" | |
| } | |
| .hljs[class~=r i]:before{ | |
| content:"R" | |
| } | |
| .hljs[class~=rib i]:before{ | |
| content:"RenderMan RIB" | |
| } | |
| .hljs[class~=rsl i]:before{ | |
| content:"RenderMan RSL" | |
| } | |
| .hljs[class~=instances i]:before,.hljs[class~=graph i]:before,.hljs[class~=roboconf i]:before{ | |
| content:"Roboconf" | |
| } | |
| .hljs[class~=rss i]:before{ | |
| content:"RSS Feed (XML)" | |
| } | |
| .hljs[class~=rb i]:before,.hljs[class~=ruby i]:before{ | |
| content:"Ruby" | |
| } | |
| .hljs[class~=thor i]:before{ | |
| content:"Thor (Ruby)" | |
| } | |
| .hljs[class~=gemspec i]:before{ | |
| content:"Ruby Gem" | |
| } | |
| .hljs[class~=rs i]:before,.hljs[class~=rust i]:before{ | |
| content:"Rust" | |
| } | |
| .hljs[class~=scala i]:before{ | |
| content:"Scala" | |
| } | |
| .hljs[class~=scheme i]:before{ | |
| content:"Scheme" | |
| } | |
| .hljs[class~=sci i]:before,.hljs[class~=scilab i]:before{ | |
| content:"Scilab" | |
| } | |
| .hljs[class~=scss i]:before{ | |
| content:"SCSS" | |
| } | |
| .hljs[class~=console i]:before,.hljs[class~=shell i]:before{ | |
| content:"Shell" | |
| } | |
| .hljs[class~=smali i]:before{ | |
| content:"Smali" | |
| } | |
| .hljs[class~=st i]:before,.hljs[class~=smalltalk i]:before{ | |
| content:"Smalltalk" | |
| } | |
| .hljs[class~=ml i]:before,.hljs[class~=sml i]:before{ | |
| content:"SML" | |
| } | |
| .hljs[class~=sqf i]:before{ | |
| content:"SQF" | |
| } | |
| .hljs[class~=sql i]:before{ | |
| content:"SQL" | |
| } | |
| .hljs[class~=stan i]:before{ | |
| content:"Stan" | |
| } | |
| .hljs[class~=ado i]:before,.hljs[class~=do i]:before,.hljs[class~=stata i]:before{ | |
| content:"Stata" | |
| } | |
| .hljs[class~=p21 i]:before,.hljs[class~=stp i]:before,.hljs[class~=step i]:before,.hljs[class~=step21 i]:before{ | |
| content:"STEP Part 21" | |
| } | |
| .hljs[class~=styl i]:before,.hljs[class~=stylus i]:before{ | |
| content:"Stylus" | |
| } | |
| .hljs[class~=subunit i]:before{ | |
| content:"SubUnit" | |
| } | |
| .hljs[class~=swift i]:before{ | |
| content:"Swift" | |
| } | |
| .hljs[class~=taggerscript i]:before{ | |
| content:"Tagger Script" | |
| } | |
| .hljs[class~=tap i]:before{ | |
| content:"TAP" | |
| } | |
| .hljs[class~=tk i]:before,.hljs[class~=tcl i]:before{ | |
| content:"Tcl" | |
| } | |
| .hljs[class~=tex i]:before{ | |
| content:"TeX" | |
| } | |
| .hljs[class~=thrift i]:before{ | |
| content:"Thrift" | |
| } | |
| .hljs[class~=toml i]:before{ | |
| content:"TOML" | |
| } | |
| .hljs[class~=tp i]:before{ | |
| content:"TP" | |
| } | |
| .hljs[class~=craftcms i]:before,.hljs[class~=twig i]:before{ | |
| content:"Twig" | |
| } | |
| .hljs[class~=ts i]:before,.hljs[class~=typescript i]:before{ | |
| content:"TypeScript" | |
| } | |
| .hljs[class~=vala i]:before{ | |
| content:"Vala" | |
| } | |
| .hljs[class~=vb i]:before,.hljs[class~=vbnet i]:before{ | |
| content:"VB.NET" | |
| } | |
| .hljs[class~=vbs i]:before,.hljs[class~=vbscript i]:before{ | |
| content:"VBScript" | |
| } | |
| .hljs[class~=vbscript-html i]:before{ | |
| content:"VBScript HTML" | |
| } | |
| .hljs[class~=svh i]:before,.hljs[class~=sv i]:before,.hljs[class~=v i]:before,.hljs[class~=verilog i]:before{ | |
| content:"Verilog" | |
| } | |
| .hljs[class~=vhdl i]:before{ | |
| content:"VHDL" | |
| } | |
| .hljs[class~=vim i]:before{ | |
| content:"Vim Script" | |
| } | |
| .hljs[class~=x86asm i]:before{ | |
| content:"x86 Assembly" | |
| } | |
| .hljs[class~=tao i]:before,.hljs[class~=xl i]:before{ | |
| content:"XL" | |
| } | |
| .hljs[class~=xpath i]:before,.hljs[class~=xq i]:before,.hljs[class~=xquery i]:before{ | |
| content:"XQuery" | |
| } | |
| .hljs[class~=yml i]:before,.hljs[class~=yaml i]:before{ | |
| content:"YAML" | |
| } | |
| .hljs[class~=xhtml i]:before{ | |
| content:"XHTML" | |
| } | |
| .hljs[class~=xml i]:before{ | |
| content:"XML" | |
| } | |
| .hljs[class~=xsd i]:before{ | |
| content:"XML Schema" | |
| } | |
| .hljs[class~=xsl i]:before{ | |
| content:"XSL" | |
| } | |
| .hljs[class~=zep i]:before,.hljs[class~=zephir i]:before{ | |
| content:"Zephir" | |
| } | |
| .embed-hKpSrO .embedFieldName-9LYSyR,.embed-hKpSrO .embedTitle-2n1pEb{ | |
| color:#fff !important | |
| } | |
| .embed-hKpSrO .embedProvider-1GSN0c{ | |
| color:rgba(255,255,255,.7) !important | |
| } | |
| .embed-hKpSrO .embedDescription-1DrJxZ,.embed-hKpSrO .embedFieldValue-3EHtvR{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .embed-hKpSrO .embedLink-1TLNja{ | |
| color:var(--main-color); | |
| transition:all .1s ease-in-out | |
| } | |
| .embed-hKpSrO .embedLink-1TLNja:hover{ | |
| text-shadow:0 0 1px; | |
| text-decoration:none !important | |
| } | |
| .embed-hKpSrO .embedTitleLink-1QbYA-{ | |
| color:var(--main-color) !important | |
| } | |
| .embed-hKpSrO .embedVideoActions-2XdFk2 .wrapper-x4po40{ | |
| background:rgba(0,0,0,.5); | |
| color:#fff; | |
| box-shadow:inset 0 0 10px rgba(0,0,0,.5) | |
| } | |
| .embed-hKpSrO a>code.inline{ | |
| color:var(--main-color) | |
| } | |
| .embed-hKpSrO .embedFooterText-2Mc7H9{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .embed-hKpSrO .embedFooterSeparator-2YCzYT{ | |
| color:rgba(255,255,255,.07) | |
| } | |
| .embedFull-1HGV2S{ | |
| background:rgba(0,0,0,.3) | |
| } | |
| .imageError-dy476I{ | |
| filter:grayscale(1) brightness(2); | |
| opacity:.3 | |
| } | |
| .theme-dark .wrapper-1HIH0j{ | |
| background:rgba(0,0,0,.4); | |
| border-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .wrapper-1HIH0j .h5-2RwDNl{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .theme-dark .wrapper-1HIH0j .guildName-3G4jq-{ | |
| color:var(--main-color); | |
| transition:all .1s ease-in-out | |
| } | |
| .theme-dark .wrapper-1HIH0j .guildName-3G4jq-:hover{ | |
| text-shadow:0 0 1px; | |
| text-decoration:none !important | |
| } | |
| .theme-dark .wrapper-1HIH0j .guildNameExpired-2Hp80V{ | |
| color:var(--danger-color) | |
| } | |
| .theme-dark .wrapper-1HIH0j .guildIcon-3ZfRfI{ | |
| background-color:rgba(255,255,255,.04) | |
| } | |
| .theme-dark .wrapper-1HIH0j .guildIconExpired-2BFmZC{ | |
| position:relative; | |
| background-size:0; | |
| background:rgba(255,255,255,.04) | |
| } | |
| .theme-dark .wrapper-1HIH0j .guildIconExpired-2BFmZC:before,.theme-dark .wrapper-1HIH0j .guildIconExpired-2BFmZC:after{ | |
| content:""; | |
| position:absolute; | |
| top:10%; | |
| bottom:10%; | |
| left:50%; | |
| width:6px; | |
| background:var(--danger-color); | |
| border-radius:1px | |
| } | |
| .theme-dark .wrapper-1HIH0j .guildIconExpired-2BFmZC:after{ | |
| transform:translateX(-50%) rotate(45deg) | |
| } | |
| .theme-dark .wrapper-1HIH0j .guildIconExpired-2BFmZC:before{ | |
| transform:translateX(-50%) rotate(-45deg) | |
| } | |
| .theme-dark .wrapper-1HIH0j .guildDetail-3EJhW_{ | |
| padding-left:1px; | |
| margin-left:-1px; | |
| color:rgba(255,255,255,.3) | |
| } | |
| .theme-dark .wrapper-1HIH0j .statusOnline-Iw3r2o{ | |
| background:var(--online-color); | |
| color:var(--online-color) | |
| } | |
| .theme-dark .wrapper-1HIH0j .statusOffline-2R-ArP{ | |
| background:var(--offline-color); | |
| color:var(--offline-color) | |
| } | |
| .theme-dark .wrapper-1HIH0j .button-2b4VEQ{ | |
| border-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .wrapper-1HIH0j .lookFilled-1H2Jvj.colorGreen-jIPCAS{ | |
| background:rgba(0,0,0,0); | |
| border:1px solid var(--success-color); | |
| transition:all .3s ease-in-out | |
| } | |
| .theme-dark .wrapper-1HIH0j .lookFilled-1H2Jvj.colorGreen-jIPCAS:hover{ | |
| background:var(--success-color) | |
| } | |
| .theme-dark .wrapper-1HIH0j .lookFilled-1H2Jvj.colorBrand-2M3O3N{ | |
| background:rgba(0,0,0,0); | |
| border:1px solid var(--danger-color); | |
| transition:all .3s ease-in-out | |
| } | |
| .theme-dark .wrapper-1HIH0j .lookFilled-1H2Jvj.colorBrand-2M3O3N:hover{ | |
| background:var(--danger-color) | |
| } | |
| .theme-dark .wrapper-1FP9YQ{ | |
| background-color:rgba(0,0,0,.4); | |
| border-color:rgba(0,0,0,0) | |
| } | |
| .audioControls-3fmemK{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .videoControls-2NzHnF{ | |
| background:rgba(0,0,0,.6) | |
| } | |
| .wrapper-1FP9YQ .metadataDownload-3IY84h,.wrapper-1FP9YQ .controlIcon-1grhw_{ | |
| opacity:.5; | |
| transition:all .15s ease-in-out | |
| } | |
| .wrapper-1FP9YQ .metadataDownload-3IY84h:hover,.wrapper-1FP9YQ .controlIcon-1grhw_:hover{ | |
| opacity:1 | |
| } | |
| .wrapper-1FP9YQ .metadataIcon-3QMhu9{ | |
| color:#fff | |
| } | |
| .wrapper-1FP9YQ .metadataIcon-3QMhu9:hover{ | |
| color:#fff | |
| } | |
| .audioMetadata-1Hrt8T:before{ | |
| content:""; | |
| width:36px; | |
| height:36px; | |
| background:url(https://clearvision.github.io/icons/file_music.svg) center/100% no-repeat; | |
| opacity:.5 | |
| } | |
| .audioMetadata-1Hrt8T .metadataSize-2A2s1T{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .mediaBarWrapper-33h1oY{ | |
| background:rgba(255,255,255,.07) | |
| } | |
| .mediaBarWrapper-33h1oY:before,.mediaBarWrapper-33h1oY:after{ | |
| background:rgba(255,255,255,.07) | |
| } | |
| .buffer-3eVqKK{ | |
| background:rgba(255,255,255,.04); | |
| opacity:1 | |
| } | |
| .buffer-3eVqKK:before,.buffer-3eVqKK:after{ | |
| background:rgba(255,255,255,.04); | |
| opacity:1 | |
| } | |
| .mediaBarGrabber-FvJKJg,.mediaBarProgress-38I317{ | |
| background:var(--main-color); | |
| transition:background .15s ease-in-out | |
| } | |
| .mediaBarProgress-38I317:before,.mediaBarProgress-38I317:after{ | |
| background:var(--main-color) | |
| } | |
| .mediaBarPreview-1gUbVy{ | |
| background:#fff; | |
| opacity:0; | |
| transition:opacity .15s ease-in-out | |
| } | |
| .mediaBarPreview-1gUbVy:before,.mediaBarPreview-1gUbVy:after{ | |
| background:#fff | |
| } | |
| .bubble-3XikHF{ | |
| background:var(--main-color); | |
| box-shadow:0 2px 10px rgba(0,0,0,.2); | |
| color:#fff; | |
| transform:translateX(-50%) rotateX(-90deg); | |
| transform-origin:50% 100%; | |
| transition:all .15s ease-in-out,left 0s | |
| } | |
| .bubble-3XikHF:before{ | |
| border-top-color:var(--main-color) | |
| } | |
| .mediaBarInteraction-tUE5dq:hover .mediaBarGrabber-FvJKJg{ | |
| background:var(--main-color) | |
| } | |
| .mediaBarInteraction-tUE5dq:hover .mediaBarPreview-1gUbVy{ | |
| opacity:.1 | |
| } | |
| .mediaBarInteractionDragging-3XLL8k .mediaBarProgress-38I317,.mediaBarInteractionDragging-3XLL8k .mediaBarGrabber-FvJKJg,.mediaBarInteractionDragging-3XLL8k .bubble-3XikHF{ | |
| background:var(--hover-color) | |
| } | |
| .mediaBarInteractionDragging-3XLL8k .bubble-3XikHF:before{ | |
| border-top-color:var(--hover-color) | |
| } | |
| .mediaBarInteraction-tUE5dq:hover .mediaBarWrapper-33h1oY,.mediaBarInteractionDragging-3XLL8k .mediaBarWrapper-33h1oY{ | |
| box-shadow:none; | |
| filter:drop-shadow(0 0 1px rgba(0, 0, 0, 0.3)) | |
| } | |
| .mediaBarInteraction-tUE5dq:hover .bubble-3XikHF,.mediaBarInteractionDragging-3XLL8k .bubble-3XikHF{ | |
| transform:translateX(-50%) | |
| } | |
| .theme-dark .mention{ | |
| padding:0 4px; | |
| border-radius:5px; | |
| line-height:22px; | |
| font-weight:500; | |
| white-space:nowrap; | |
| transition:all .15s ease-in-out; | |
| cursor:pointer; | |
| background-color:rgba(255,255,255,.04); | |
| color:rgba(255,255,255,.7) | |
| } | |
| .theme-dark .mention:hover{ | |
| background-color:var(--main-color); | |
| color:#fff | |
| } | |
| .theme-dark .mention.iconMention-3WxjBe{ | |
| padding-left:1.2rem | |
| } | |
| .theme-dark strong>.mention{ | |
| font-weight:600 | |
| } | |
| .theme-dark .mentioned-Tre-dv .mention.interactive{ | |
| color:var(--main-color) | |
| } | |
| .theme-dark .mentioned-Tre-dv .mention.interactive:hover{ | |
| color:#fff; | |
| text-decoration:none | |
| } | |
| .mentioned-Tre-dv{ | |
| background-color:rgba(255,255,255,.05) | |
| } | |
| .mentioned-Tre-dv.message-2CShn3.selected-2LX7Jy,.mouse-mode.full-motion .mentioned-Tre-dv:hover{ | |
| background-color:rgba(255,255,255,.08) | |
| } | |
| .mentioned-Tre-dv::before{ | |
| background-color:var(--main-color) | |
| } | |
| .reaction-3vwAF2{ | |
| background-color:rgba(255,255,255,.05); | |
| border-radius:3px; | |
| transition:all .15s ease-in-out | |
| } | |
| .reaction-3vwAF2:hover{ | |
| background-color:rgba(255,255,255,.2) | |
| } | |
| .reaction-3vwAF2:hover .reactionCount-26U4As{ | |
| color:rgba(255,255,255,.9) | |
| } | |
| .reaction-3vwAF2 .reactionInner-YJjOtT{ | |
| padding:0 5px | |
| } | |
| .reaction-3vwAF2 .reactionCount-26U4As{ | |
| color:rgba(255,255,255,.4) | |
| } | |
| .reaction-3vwAF2.reactionMe-1PwQAc{ | |
| background-color:rgba(255,255,255,.1); | |
| border-color:rgba(0,0,0,0) | |
| } | |
| .reaction-3vwAF2.reactionMe-1PwQAc .reactionCount-26U4As{ | |
| color:var(--main-color) | |
| } | |
| .reaction-3vwAF2.reactionMe-1PwQAc:hover{ | |
| background-color:rgba(255,255,255,.2) | |
| } | |
| .reaction-3vwAF2.reactionMe-1PwQAc:hover .reactionCount-26U4As{ | |
| color:var(--hover-color) | |
| } | |
| .reaction-102jx9{ | |
| background-color:rgba(255,255,255,.05); | |
| border-radius:3px; | |
| transition:all .15s ease-in-out | |
| } | |
| .reaction-102jx9:hover{ | |
| background-color:rgba(255,255,255,.2) | |
| } | |
| .reaction-102jx9:hover .reactionCount-SWXh9W{ | |
| color:rgba(255,255,255,.9) | |
| } | |
| .reaction-102jx9 .reactionInner-1po5__{ | |
| padding:0 5px | |
| } | |
| .reaction-102jx9 .reactionCount-SWXh9W{ | |
| color:rgba(255,255,255,.4) | |
| } | |
| .reaction-102jx9.reactionMe-2zhiyZ{ | |
| background-color:rgba(255,255,255,.1); | |
| border-color:rgba(0,0,0,0) | |
| } | |
| .reaction-102jx9.reactionMe-2zhiyZ .reactionCount-SWXh9W{ | |
| color:var(--main-color) | |
| } | |
| .reaction-102jx9.reactionMe-2zhiyZ:hover{ | |
| background-color:rgba(255,255,255,.2) | |
| } | |
| .reaction-102jx9.reactionMe-2zhiyZ:hover .reactionCount-SWXh9W{ | |
| color:var(--hover-color) | |
| } | |
| .addReactButton-3bSQb6,.buttonInner-3aRbcx{ | |
| background-color:rgba(255,255,255,.05); | |
| border-radius:3px; | |
| transition:all .15s ease-in-out | |
| } | |
| .addReactButton-3bSQb6:hover,.buttonInner-3aRbcx:hover{ | |
| background-color:rgba(255,255,255,.2); | |
| border-color:hsla(0, calc(var(--saturation-factor, 1) * 0%), 100%, 0.2); | |
| color:#fff !important | |
| } | |
| .contents-2MsGLg .spoilerText-27bIiA{ | |
| background:rgba(255,255,255,.04); | |
| transition:all .15s ease-in-out | |
| } | |
| .contents-2MsGLg .spoilerText-27bIiA>.inlineContent-2YnoDy{ | |
| opacity:1; | |
| transition:inherit | |
| } | |
| .contents-2MsGLg .spoilerText-27bIiA.hidden-3B-Rum{ | |
| background:rgba(0,0,0,.8) | |
| } | |
| .contents-2MsGLg .spoilerText-27bIiA.hidden-3B-Rum:hover{ | |
| background:rgba(0,0,0,.6) | |
| } | |
| .contents-2MsGLg .spoilerText-27bIiA.hidden-3B-Rum>.inlineContent-2YnoDy{ | |
| opacity:0 | |
| } | |
| .markup-eYLPri .spoilerText-27bIiA{ | |
| padding:1px 4px | |
| } | |
| .spoilerContainer-3wsC0k>.spoilerWarning-8ovW0v{ | |
| background:rgba(0,0,0,.5); | |
| color:rgba(255,255,255,.7); | |
| transition:all .15s ease-in-out | |
| } | |
| .spoilerContainer-3wsC0k .spoiler-3aUoEX,.spoilerContainer-3wsC0k .spoilerEmbed-1LYr3G>.grid-1aWVsE{ | |
| transition:all .15s ease-in-out | |
| } | |
| .spoilerContainer-3wsC0k .hiddenSpoilers-19m4Pg,.spoilerContainer-3wsC0k .hiddenSpoiler-3pPzRF>.grid-1aWVsE{ | |
| filter:blur(40px) | |
| } | |
| .spoilerContainer-3wsC0k .hiddenSpoiler-3pPzRF{ | |
| border-radius:0 | |
| } | |
| .spoilerContainer-3wsC0k:hover>.spoilerWarning-8ovW0v{ | |
| background:rgba(0,0,0,.7); | |
| color:#fff | |
| } | |
| .spoilerContainer-3wsC0k:hover .hiddenSpoilers-19m4Pg{ | |
| filter:blur(30px) | |
| } | |
| .spoilerContainer-3wsC0k:hover .hiddenSpoiler-3pPzRF>.grid-1aWVsE{ | |
| filter:blur(30px) | |
| } | |
| .textContainer-36wgKK{ | |
| background-color:rgba(0,0,0,.42); | |
| border:2px solid rgba(255,255,255,.05); | |
| border-radius:8px 8px 0 0 | |
| } | |
| .footer-GXWBBp{ | |
| background-color:rgba(255,255,255,.1); | |
| border:none | |
| } | |
| .colorHeaderSecondary-g5teka{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .colorHeaderSecondary-g5teka:hover{ | |
| color:rgba(255,255,255,.9) | |
| } | |
| .attachmentName-vgRpzs{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .attachmentName-vgRpzs:hover{ | |
| color:rgba(255,255,255,.9) | |
| } | |
| .formattedSize-1YbZww{ | |
| color:rgba(255,255,255,.5); | |
| margin:0 5px | |
| } | |
| .formattedSize-1YbZww:hover{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .languageSelector-2e1IuO{ | |
| background-color:rgba(0,0,0,.8) | |
| } | |
| .languageSelector-2e1IuO .item-1BCeuB:hover{ | |
| background-color:rgba(255,255,255,.05) | |
| } | |
| .languageSelector-2e1IuO .item-1BCeuB.selected-22ukbQ{ | |
| background-color:var(--main-color) | |
| } | |
| .modalTextContainer-1FUO2W{ | |
| background-color:rgba(0,0,0,.5); | |
| border:none | |
| } | |
| .theme-dark .modal-3Hrb0S,.theme-dark .root-1CAIjD{ | |
| background:rgba(0,0,0,.5); | |
| box-shadow:none | |
| } | |
| .theme-dark .modal-3Hrb0S .footer-IubaaS,.theme-dark .modal-3Hrb0S .formFieldWrapper-2LV3S6,.theme-dark .modal-3Hrb0S .guildSidebar-UHnQqs,.theme-dark .modal-3Hrb0S .settingsFormFieldWrapper-U99c9i,.theme-dark .root-1CAIjD .footer-IubaaS,.theme-dark .root-1CAIjD .formFieldWrapper-2LV3S6,.theme-dark .root-1CAIjD .guildSidebar-UHnQqs,.theme-dark .root-1CAIjD .settingsFormFieldWrapper-U99c9i{ | |
| background:rgba(0,0,0,0); | |
| box-shadow:none | |
| } | |
| .header-1sd0RU{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .circle-2tR2Qh{ | |
| background-color:var(--main-color) | |
| } | |
| .eventCard-2ZL9GD{ | |
| background-color:rgba(0,0,0,.4); | |
| border:2px solid var(--main-color) | |
| } | |
| .eventStatusBrand-3D-ae6,.eventStatusLabel-1og3vG,.eventStatusGreen-2-f2N8{ | |
| color:var(--main-color) | |
| } | |
| .eventStatusBrand-3D-ae6 .previewCard-E137i2,.eventStatusLabel-1og3vG .previewCard-E137i2,.eventStatusGreen-2-f2N8 .previewCard-E137i2{ | |
| color:var(--success-color) | |
| } | |
| .rsvpCount-iCkObl{ | |
| background-color:var(--main-color) | |
| } | |
| .rsvpCount-iCkObl .rsvpIcon-1R5Esx,.rsvpCount-iCkObl .colorHeaderSecondary-g5teka{ | |
| color:#fff | |
| } | |
| .card-8UsK4b:hover{ | |
| background-color:var(--hover-color) | |
| } | |
| .container-3EBHNg .item-2GWPIy:hover{ | |
| border-bottom-color:var(--hover-color) | |
| } | |
| .container-3EBHNg .item-2GWPIy.selected-1sf9UK,.container-3EBHNg .item-2GWPIy:active{ | |
| border-bottom-color:var(--main-color) | |
| } | |
| .contentContainer-BWAau5{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .circle-1g-jMn{ | |
| background-color:var(--main-color) | |
| } | |
| .progressBar-18rmp1{ | |
| background-color:rgba(255,255,255,.3) | |
| } | |
| .progressBar-18rmp1.selectedProgressBar-11z5d9{ | |
| background-color:var(--main-color) | |
| } | |
| .progressBar-18rmp1+.colorMuted-20987_{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .progressBar-18rmp1+.colorBrand-21Le_q{ | |
| color:var(--main-color) | |
| } | |
| .container-1hz3gm,.form-1ejeax{ | |
| margin-left:2px; | |
| margin-right:2px; | |
| margin-bottom:2px | |
| } | |
| .container-3zZkKh{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .textInput-3g8y92{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .theme-dark .previewCard-E137i2{ | |
| background-color:rgba(0,0,0,.4); | |
| border:2px solid var(--main-color) | |
| } | |
| .iconContainer-36kI2p{ | |
| background-color:var(--main-color) | |
| } | |
| .theme-dark .layer-2aCOJ3 .calendarPicker-sDhzdi .react-datepicker{ | |
| background-color:rgba(0,0,0,.8) | |
| } | |
| .theme-light .defaultColor-1GKx81{ | |
| color:#fff | |
| } | |
| .theme-light .subtitle-3m-md1,.theme-light .subtitle-bIoUVX,.theme-light .optionHeader-27AHfD{ | |
| color:rgba(255,255,255,.7) !important | |
| } | |
| .theme-light .iconContainer-GFfNaA>svg>circle{ | |
| fill:var(--main-color) | |
| } | |
| .theme-light .sampleLink-5BWNy9{ | |
| color:var(--main-color); | |
| font-weight:500 | |
| } | |
| .theme-light .skip-2hTIXL{ | |
| color:rgba(255,255,255,.7) !important | |
| } | |
| .container-x8Y1ix{ | |
| background-color:var(--main-color) | |
| } | |
| .container-x8Y1ix:hover{ | |
| background-color:var(--hover-color) | |
| } | |
| .container-x8Y1ix .text-PdAsFQ{ | |
| color:#fff | |
| } | |
| .container-x8Y1ix .arrow-2yY1Tm{ | |
| filter:brightness(0) invert(1) | |
| } | |
| .rowContainer-3t7486{ | |
| background-color:var(--main-color) | |
| } | |
| .rowContainer-3t7486:hover{ | |
| background-color:var(--hover-color) | |
| } | |
| .rowContainer-3t7486 .rowText-3MQqQi{ | |
| color:#fff | |
| } | |
| .rowContainer-3t7486 .rowArrow-TIwwIc{ | |
| filter:brightness(0) invert(1) | |
| } | |
| .theme-dark .keyboardShortcutsModal-2CRmCm{ | |
| background-color:rgba(0,0,0,.5) | |
| } | |
| .theme-dark .combo-3PNrpQ .key-RP8gj3{ | |
| background:rgba(0,0,0,0); | |
| border:1px solid var(--hover-color); | |
| border-radius:3px; | |
| box-shadow:inset 0 -4px var(--main-color); | |
| color:rgba(255,255,255,.7); | |
| transition:all .15s ease-in-out | |
| } | |
| .theme-dark .combo-3PNrpQ .key-RP8gj3:hover{ | |
| background:var(--hover-color); | |
| color:#fff | |
| } | |
| .theme-dark .combo-3PNrpQ .key-RP8gj3:active{ | |
| border:1px solid var(--hover-color); | |
| box-shadow:inset 0 -2px var(--main-color); | |
| color:rgba(255,255,255,.7) | |
| } | |
| .theme-dark .message-G6O-Wv{ | |
| background-color:rgba(0,0,0,0); | |
| box-shadow:0 0 2px 2px var(--main-color) | |
| } | |
| .theme-dark .override-1sK4r0:hover{ | |
| border-color:var(--main-color) | |
| } | |
| .selectedIcon-19TbzU{ | |
| color:var(--interactive-active) | |
| } | |
| .lookFilled-1GseHa.select-1Ia3hD{ | |
| background-color:rgba(255,255,255,.05); | |
| border-color:rgba(0,0,0,.07) | |
| } | |
| .popout-1KHNAq{ | |
| background-color:rgba(0,0,0,.8); | |
| border:none; | |
| border-radius:4px | |
| } | |
| .theme-dark .scroller-2GkvCq,.theme-dark .reactors-1VXca7{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .reactionDefault-1Sjj1f{ | |
| margin-bottom:10px | |
| } | |
| .theme-dark .reactionSelected-1aMb2K{ | |
| background-color:var(--main-color); | |
| margin-bottom:10px | |
| } | |
| .theme-dark .reactionSelected-1aMb2K .colorStandard-21JIj7{ | |
| color:#fff | |
| } | |
| .upsellCard-11CKVn{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .quickswitcher-pKcM9U{ | |
| background-color:rgba(0,0,0,.5) | |
| } | |
| .input-3r5zZY{ | |
| background-color:rgba(255,255,255,.07) | |
| } | |
| .scroller-2qwVWY{ | |
| background-color:rgba(0,0,0,0); | |
| margin-top:10px | |
| } | |
| .scroller-2qwVWY::-webkit-scrollbar-track{ | |
| background-color:rgba(0,0,0,0) !important | |
| } | |
| .result-u66Ywh[aria-selected=true]{ | |
| background:var(--background-modifier-hover) | |
| } | |
| .spinner-1HUPsi{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .wrapper-wOVKdL,.body-2qXItL{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .table-17_dGF{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .planOptionDiscount-2nex9n{ | |
| background-color:var(--main-color) | |
| } | |
| .contents-1X8z-d{ | |
| background-color:rgba(0,0,0,.5) | |
| } | |
| .cardNumberWrapper-3JnfVP{ | |
| margin:0 2px | |
| } | |
| .cardInput-33x7OF{ | |
| background-color:rgba(255,255,255,.07); | |
| box-shadow:0 0 0 2px rgba(255,255,255,.09) | |
| } | |
| .cardInputFocused-31lFD1{ | |
| box-shadow:0 0 2px 2px var(--main-color) | |
| } | |
| .cardIcon-1rZ5-N{ | |
| top:9px | |
| } | |
| .upsellFooter-1H_OCF{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .icon-2TbMdT{ | |
| color:#fff | |
| } | |
| .icon-2TbMdT:hover{ | |
| color:#fff; | |
| background-color:var(--hover-color) | |
| } | |
| .theme-dark .iconWrapper-2_MXbk{ | |
| background:rgba(0,0,0,.8) | |
| } | |
| .actions-10aT1z .input-2g-os5{ | |
| box-shadow:none | |
| } | |
| .subscription-1wJwQk{ | |
| background-color:rgba(0,0,0,.5) | |
| } | |
| .theme-dark .tierPill-l7DvKo{ | |
| background-color:var(--main-color) | |
| } | |
| .theme-dark .contentWrapper-3oy4Xo{ | |
| background:rgba(0,0,0,.5) | |
| } | |
| .pillIconOnline-2JLgFw{ | |
| background-color:var(--online-color) | |
| } | |
| .pillIconTotal-3rJafa{ | |
| background-color:var(--offline-color) | |
| } | |
| .inviteRow-3vmB7i:hover{ | |
| background-color:rgba(255,255,255,.07) | |
| } | |
| .theme-dark .inviteBannerUpsell-1t_LYM{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .item-2OyinQ:hover{ | |
| background-color:var(--hover-color) | |
| } | |
| .selectorButtonSelected-1VZ6hz{ | |
| background-color:var(--main-color) | |
| } | |
| .tips-39ZVzW{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .list-3-WAYB{ | |
| background-color:rgba(0,0,0,.5) | |
| } | |
| .activeIcon-1ykRnF>circle:not([fill^="hsl(0"]),.activeIcon-1ykRnF>g>path:not([fill^="hsl(0"]){ | |
| fill:var(--main-color) | |
| } | |
| .theme-dark .authBox-1HR6Ha,.theme-dark .navRow-dG-XX8{ | |
| background-color:rgba(0,0,0,.5) | |
| } | |
| .phoneField-3NAPDv .inputField-1iYysB{ | |
| background-color:rgba(255,255,255,.07) | |
| } | |
| .phoneField-3NAPDv{ | |
| background-color:rgba(255,255,255,.07); | |
| border:1px solid rgba(255,255,255,.07) | |
| } | |
| .modalHeader-3X0A4K,.modalDivider-MtZbPb{ | |
| background:rgba(0,0,0,.4) | |
| } | |
| .activityTag-3C3YK5{ | |
| background-color:rgba(0,0,0,.5) | |
| } | |
| .activityItem-1Z9CTr{ | |
| background:rgba(0,0,0,.4) | |
| } | |
| .activityItem-1Z9CTr:hover{ | |
| background:var(--hover-color); | |
| box-sizing:border-box; | |
| border:2px solid var(--main-color) | |
| } | |
| .scrollTierBackground-BnWR8k{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .authorize-2xTTr-{ | |
| background-color:rgba(0,0,0,0); | |
| border-radius:5px | |
| } | |
| .scopeTimes-KsAOBb{ | |
| background-color:rgba(255,255,255,.15) | |
| } | |
| .footer-3Gu_Tl{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .segmentControlOption-3MnJdT{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .theme-dark .segmentControlOption-3MnJdT.selected-2xa993{ | |
| color:var(--main-color); | |
| border-bottom:2px solid var(--main-color) | |
| } | |
| .tile-3POX2m:hover .sourceThumbnail-ERDcZE{ | |
| box-shadow:inset 0 0 0 2px var(--hover-color) | |
| } | |
| .tile-3POX2m .sourceThumbnail-ERDcZE.selected-1i-g6T{ | |
| box-shadow:inset 0 0 0 2px var(--main-color) | |
| } | |
| .card-m7VgZ8{ | |
| background-color:rgba(255,255,255,.07); | |
| border:2px solid rgba(255,255,255,.09) | |
| } | |
| .theme-dark .selectorButton-3fWZ0_{ | |
| background-color:rgba(255,255,255,.07); | |
| border-color:rgba(255,255,255,.09) | |
| } | |
| .theme-dark .selectorButton-3fWZ0_:not(.selectorButtonPremiumRequired-IZXhgV):hover{ | |
| background-color:var(--hover-color) | |
| } | |
| .theme-dark .selectorButton-3fWZ0_.selectorButtonSelected-3cQUnj:not(.selectorButtonPremiumRequired-IZXhgV){ | |
| background-color:var(--main-color) | |
| } | |
| .modal-ZdazA8{ | |
| background-color:rgba(0,0,0,.6) !important | |
| } | |
| .modal-ZdazA8.container-18GwIk{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .list-1uSVgu .tabBar-3N44FC .tab-1tp4jL{ | |
| color:#fff | |
| } | |
| .theme-dark .list-1uSVgu .tabBar-3N44FC .tab-1tp4jL.active-3WMEyE{ | |
| background-color:var(--main-color) | |
| } | |
| .theme-dark .list-1uSVgu .tabBar-3N44FC .tab-1tp4jL:hover:not(.active-3WMEyE){ | |
| background-color:rgba(255,255,255,.06); | |
| color:#fff | |
| } | |
| .container-2rzKKA{ | |
| background-color:rgba(0,0,0,.3); | |
| border:2px solid var(--main-color) | |
| } | |
| .container-2rzKKA:hover{ | |
| border:2px solid var(--hover-color) | |
| } | |
| .userProfileModalOuter-1FYL8T.userProfileOuterUnthemed-2b2rsv{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .userProfileModalOuter-1FYL8T.userProfileOuterUnthemed-2b2rsv .userProfileModalInner-3fh3QA{ | |
| background:rgba(0,0,0,.7) | |
| } | |
| .userProfileModalOuter-1FYL8T.userProfileOuterUnthemed-2b2rsv .userProfileModalInner-3fh3QA::before{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| background:var(--user-modal-image) var(--user-modal-position)/var(--user-modal-size) var(--user-modal-repeat) var(--user-modal-attachment); | |
| filter:grayscale(var(--user-modal-grayscale)) sepia(var(--user-modal-sepia)) invert(var(--user-modal-invert)) brightness(var(--user-modal-brightness)) contrast(var(--user-modal-contrast)) saturate(var(--user-modal-saturation)) blur(var(--user-modal-blur)); | |
| width:100%; | |
| height:100%; | |
| z-index:-1 | |
| } | |
| .userProfileModalOverlayBackground-8p3-eU{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .profileBanner-2zIsK7{ | |
| -webkit-mask:linear-gradient(to bottom, #000 50%, transparent); | |
| mask:linear-gradient(to bottom, #000 50%, transparent) | |
| } | |
| .badgeList-2pMvZX{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .tabBarContainer-2UG0vy{ | |
| padding:0 20px; | |
| border-color:rgba(255,255,255,.04) | |
| } | |
| .tabBar-2StdUa .item-2GWPIy{ | |
| position:relative; | |
| margin:10px 0 0; | |
| padding:0 10px; | |
| color:rgba(255,255,255,.5) !important; | |
| transition:color .15s ease-in-out; | |
| z-index:1 | |
| } | |
| .tabBar-2StdUa .item-2GWPIy:before{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| background:linear-gradient(to top, transparent, hsla(0deg, 0%, 100%, 0.07) 50%); | |
| border-radius:3px 3px 0 0; | |
| opacity:0; | |
| transition:all .15s ease-in-out,bottom .2s ease-in-out; | |
| z-index:-1 | |
| } | |
| .tabBar-2StdUa .item-2GWPIy:after{ | |
| content:""; | |
| position:absolute; | |
| top:100%; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| background:rgba(0,0,0,.25); | |
| border-radius:3px 3px 0 0; | |
| transition:all .2s ease-in-out; | |
| z-index:-1 | |
| } | |
| .tabBar-2StdUa .item-2GWPIy:hover:before,.tabBar-2StdUa [style*="color: rgb(255, 255, 255)"].item-2GWPIy:before{ | |
| opacity:1 | |
| } | |
| .tabBar-2StdUa .item-2GWPIy.selected-1sf9UK:after{ | |
| top:0; | |
| animation:cv-slide-top .2s ease-in-out | |
| } | |
| .tabBar-2StdUa .item-2GWPIy.selected-1sf9UK:before{ | |
| bottom:100%; | |
| animation:cv-slide-bottom .2s ease-in-out reverse | |
| } | |
| .userProfileModalOuter-1FYL8T.userProfileOuterUnthemed-2b2rsv .tabBar-2StdUa .item-2GWPIy:hover{ | |
| border-bottom-color:var(--hover-color) | |
| } | |
| .userProfileModalOuter-1FYL8T.userProfileOuterUnthemed-2b2rsv .tabBar-2StdUa .item-2GWPIy.selected-1sf9UK{ | |
| border-bottom-color:var(--main-color) | |
| } | |
| .body-1Ukv50 .userInfoSection-2u2hir+.userInfoSection-2u2hir{ | |
| border-color:rgba(255,255,255,.04) | |
| } | |
| .body-1Ukv50 .userInfoSection-2u2hir>.userInfoSectionHeader-2mYYun{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .body-1Ukv50 .userInfoSection-2u2hir>.note-3M15gE>textarea{ | |
| background:rgba(0,0,0,0); | |
| color:rgba(255,255,255,.8) | |
| } | |
| .body-1Ukv50 .userInfoSection-2u2hir>.note-3M15gE>textarea:focus{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .body-1Ukv50 .userInfoSection-2u2hir>.note-3M15gE>textarea::placeholder{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .connectedAccounts-2R5M4w .connectedAccountContainer-3aLMHJ{ | |
| position:relative; | |
| background:rgba(255,255,255,.04); | |
| border-color:rgba(0,0,0,0); | |
| border-radius:5px; | |
| transition:all .15s ease-in-out | |
| } | |
| .connectedAccounts-2R5M4w .connectedAccountContainer-3aLMHJ:hover{ | |
| background:rgba(255,255,255,.07) | |
| } | |
| .connectedAccounts-2R5M4w .connectedAccountContainer-3aLMHJ:hover .connectedAccountOpenIcon-3i81Tz{ | |
| opacity:.7 | |
| } | |
| .connectedAccounts-2R5M4w .connectedAccountContainer-3aLMHJ:active{ | |
| transform:scale(0.95) | |
| } | |
| .connectedAccountVerifiedIcon-3EPFPC{ | |
| background:url(https://clearvision.github.io/icons/verified.svg) center/18px no-repeat; | |
| opacity:.5; | |
| z-index:1 | |
| } | |
| .connectedAccountVerifiedIcon-3EPFPC .flowerStar-2tNFCR{ | |
| opacity:0 | |
| } | |
| .connectedAccountVerifiedIcon-3EPFPC .childContainer-U_a6Yh{ | |
| display:none | |
| } | |
| .connectedAccountOpenIcon-3i81Tz{ | |
| background:url(https://clearvision.github.io/icons/popout.svg) center/18px no-repeat; | |
| opacity:.3; | |
| transition:all .15s ease-in-out; | |
| transform:none | |
| } | |
| .connectedAccountOpenIcon-3i81Tz>polygon{ | |
| display:none | |
| } | |
| .listScroller-entkMk .listRow-2nO1T6{ | |
| position:relative; | |
| color:rgba(255,255,255,.5); | |
| transition:all .15s ease-in-out; | |
| z-index:1 | |
| } | |
| .listScroller-entkMk .listRow-2nO1T6:after{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| background:linear-gradient(to right, transparent, hsla(0deg, 0%, 100%, 0.04) 10%, hsla(0deg, 0%, 100%, 0.04) 90%, transparent); | |
| opacity:0; | |
| transition:inherit; | |
| z-index:-1 | |
| } | |
| .listScroller-entkMk .listRow-2nO1T6:hover{ | |
| background:rgba(0,0,0,0); | |
| color:rgba(255,255,255,.7) | |
| } | |
| .listScroller-entkMk .listRow-2nO1T6:hover:after{ | |
| opacity:1 | |
| } | |
| .listScroller-entkMk .listRow-2nO1T6:active{ | |
| transform:scale(0.97) | |
| } | |
| .listAvatar-2GhWlb{ | |
| background-color:rgba(0,0,0,.2) | |
| } | |
| .base-2jDfDU .pageWrapper-2PwDoS,.base-2jDfDU .scroller-RfJjkV{ | |
| background:rgba(0, 0, 0, calc(var(--background-shading) * 0.5)) | |
| } | |
| .categoryItem-Kc_HK_.selectedCategoryItem-ZjqSui .itemInner-3e_4G4{ | |
| background-color:var(--main-color) | |
| } | |
| .search-25t1e9 .searchBox-pyIJJj{ | |
| background:rgba(0,0,0,.6); | |
| border:none; | |
| box-shadow:0 0 0 2px rgba(255,255,255,.09) | |
| } | |
| .search-25t1e9 .searchBox-pyIJJj:focus-within{ | |
| border:none; | |
| box-shadow:0 0 2px 2px var(--main-color) | |
| } | |
| .search-25t1e9 .searchBox-pyIJJj .input-2g-os5{ | |
| border:none; | |
| box-shadow:none | |
| } | |
| .search-25t1e9 .searchBox-pyIJJj .searchBoxInput-P0mWHW{ | |
| color:var(--text-normal) | |
| } | |
| .search-25t1e9 .searchBox-pyIJJj .searchBoxInput-P0mWHW::placeholder{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .search-25t1e9 .searchBox-pyIJJj .searchIcon-34RNw9{ | |
| color:var(--main-color) | |
| } | |
| .search-25t1e9 .searchBox-pyIJJj .closeIcon-BMGxx0{ | |
| color:var(--main-color) | |
| } | |
| .search-25t1e9 .searchBox-pyIJJj .closeIcon-BMGxx0:hover{ | |
| color:var(--hover-color) | |
| } | |
| .searchPage-1Rxeav .search-25t1e9 .searchBox-pyIJJj{ | |
| background:rgba(255,255,255,.07); | |
| border:none; | |
| box-shadow:0 0 0 2px rgba(255,255,255,.09) | |
| } | |
| .searchPage-1Rxeav .search-25t1e9 .searchBox-pyIJJj:focus-within{ | |
| border:none; | |
| box-shadow:0 0 2px 2px var(--main-color) | |
| } | |
| .searchPage-1Rxeav .search-25t1e9 .searchBox-pyIJJj .input-2g-os5{ | |
| border:none; | |
| box-shadow:none | |
| } | |
| .searchPage-1Rxeav .search-25t1e9 .searchBox-pyIJJj .searchBoxInput-P0mWHW{ | |
| color:var(--text-normal) | |
| } | |
| .searchPage-1Rxeav .search-25t1e9 .searchBox-pyIJJj .searchBoxInput-P0mWHW::placeholder{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .searchPage-1Rxeav .search-25t1e9 .searchBox-pyIJJj .closeIcon-BMGxx0{ | |
| color:var(--main-color) | |
| } | |
| .searchPage-1Rxeav .search-25t1e9 .searchBox-pyIJJj .closeIcon-BMGxx0:hover{ | |
| color:var(--hover-color) | |
| } | |
| .theme-dark .card-2TuZPZ,.theme-dark .container-1wv6C6,.theme-dark .iconMask-2fMR98{ | |
| background-color:rgba(0,0,0,.4); | |
| transition:all .15s ease-in-out | |
| } | |
| .theme-dark .card-2TuZPZ:hover,.theme-dark .card-2TuZPZ:hover .iconMask-2fMR98,.theme-dark .container-1wv6C6:hover,.theme-dark .container-1wv6C6:hover .iconMask-2fMR98,.theme-dark .iconMask-2fMR98:hover,.theme-dark .iconMask-2fMR98:hover .iconMask-2fMR98{ | |
| background-color:rgba(0,0,0,.6) | |
| } | |
| .loading-3ozbwt{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .guildList-3GXKvP .spinner-2ID8f1{ | |
| background-color:rgba(0,0,0,.8) | |
| } | |
| .dotOnline-j08lOY{ | |
| background-color:var(--online-color) | |
| } | |
| .dotOffline-38lJFn{ | |
| background-color:var(--offline-color) | |
| } | |
| .languageSelector-1hjSyO>div>div{ | |
| background-color:rgba(0,0,0,.6) | |
| } | |
| .categoryPill-1zjNrr.selected-bLcqYK{ | |
| background-color:var(--main-color) | |
| } | |
| .emptyContainer-poti7J{ | |
| background-color:rgba(0,0,0,.6) | |
| } | |
| .theme-dark .container-3wLKDe{ | |
| background:rgba(0, 0, 0, calc(var(--background-shading) * 0.3)) | |
| } | |
| .container-2qVG6q.isOpen-2OXbFs{ | |
| background:rgba(0,0,0,.3) | |
| } | |
| .mainCard-3KBsBI{ | |
| background:rgba(0,0,0,.3); | |
| border:2px solid var(--main-color) | |
| } | |
| .mainCard-3KBsBI:hover{ | |
| background:rgba(0,0,0,.3); | |
| border:2px solid var(--hover-color) | |
| } | |
| .mainCard-3KBsBI .channelTextArea-1VQBuV{ | |
| background:rgba(255,255,255,.07); | |
| width:95% | |
| } | |
| .mainCard-3KBsBI .channelTextArea-1VQBuV .scrollableContainer-15eg7h{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .mainCard-3KBsBI .contentContainer-2xwoXK{ | |
| padding:10px 0px 0px 0px | |
| } | |
| .theme-dark .mainCard-3KBsBI.isOpen-2OXbFs{ | |
| background-color:rgba(255,255,255,.1) | |
| } | |
| .headerRow-1MKoR- .mainCard-3KBsBI{ | |
| border:2px solid rgba(0,0,0,0) | |
| } | |
| .headerBorder-jrk0Ic{ | |
| box-shadow:0 0 0 2px rgba(0,0,0,0) | |
| } | |
| .channelName-1On3TJ{ | |
| color:#fff !important | |
| } | |
| .pill-3pRQlO{ | |
| background:rgba(0,0,0,.6); | |
| border:2px solid var(--main-color) | |
| } | |
| .pill-3pRQlO.clickable-3YTfAq:not(.disabled-3Rezaw):hover{ | |
| background:rgba(0,0,0,0); | |
| border:2px solid var(--hover-color) | |
| } | |
| .pill-3pRQlO.selected-24z1Ou{ | |
| border:2px solid var(--success-color) | |
| } | |
| .sidebarCard-1Gn1ch,.container-2IhveL{ | |
| background:rgba(0,0,0,.3); | |
| border:none | |
| } | |
| .pencilIcon-1d4fcw,.searchIcon-2Nw0OL,.closeIcon-3xe5xL{ | |
| color:rgba(255,255,255,.9); | |
| width:20px; | |
| height:20px; | |
| left:10px; | |
| top:10px | |
| } | |
| .pencilIcon-1d4fcw:hover,.searchIcon-2Nw0OL:hover,.closeIcon-3xe5xL:hover{ | |
| color:#fff | |
| } | |
| .title-1v5ZfI{ | |
| font-family:var(--main-font); | |
| font-weight:300; | |
| padding:0 5px 0 5px; | |
| background:rgba(0,0,0,0); | |
| border-radius:4px | |
| } | |
| .matchingPostsRow-2IiEQ1{ | |
| background-color:rgba(0,0,0,.3) | |
| } | |
| .container-3kfp0r{ | |
| background:rgba(0,0,0,.7) | |
| } | |
| .container-3kfp0r .countContainer-3DOo5v{ | |
| background-color:var(--main-color) | |
| } | |
| .container-3kfp0r .contents-3ca1mk{ | |
| color:var(--main-color) | |
| } | |
| .container-3kfp0r .contents-3ca1mk:hover{ | |
| color:var(--hover-color) | |
| } | |
| .countContainer-3uQ087{ | |
| background-color:var(--main-color) | |
| } | |
| .sortDropdown-hY93nR{ | |
| background-color:var(--main-color) | |
| } | |
| .sortDropdown-hY93nR>*,.sortDropdown-hY93nR .sortDropdownText-3smleu{ | |
| color:#fff !important | |
| } | |
| .tagsButton-4pwOKH{ | |
| background-color:rgba(0,0,0,.3) | |
| } | |
| .tagsButton-4pwOKH .tagsButtonInner-2pvSm1{ | |
| color:#fff | |
| } | |
| .theme-dark .textContentFooter-2JnNv8{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .container-3arpDl{ | |
| background:rgba(0,0,0,.3); | |
| border:2px solid var(--main-color) | |
| } | |
| .container-3arpDl .descriptionContainer-2ylKGk{ | |
| background:rgba(0,0,0,.3) | |
| } | |
| .container-3arpDl .gradient-1SYq38{ | |
| background:linear-gradient(0deg, rgba(0, 0, 0, 0.8), transparent) | |
| } | |
| .container-3arpDl .linkContainer-2xEQjX{ | |
| background:rgba(0,0,0,.8) | |
| } | |
| .container-3arpDl .text-sm-bold-1Dtt0R,.container-3arpDl .text-sm-semibold-3TWn25{ | |
| color:var(--main-color) | |
| } | |
| .container-3arpDl .text-sm-bold-1Dtt0R:hover,.container-3arpDl .text-sm-semibold-3TWn25:hover{ | |
| color:var(--hover-color) | |
| } | |
| .loadingCard-3pIp9h{ | |
| background:rgba(0,0,0,.3) | |
| } | |
| .uploadInput-3fblkw{ | |
| background:var(--main-color); | |
| transition:all .15s ease-in-out | |
| } | |
| .uploadInput-3fblkw:hover{ | |
| background:var(--hover-color); | |
| transition:all .15s ease-in-out | |
| } | |
| .iconWrapper-3FqQ75{ | |
| background:var(--main-color) | |
| } | |
| .container-3YcgdM,.divider-AZrXIA,.box-2iMsQm{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .optionContainer-yOpaLq{ | |
| background-color:var(--main-color) | |
| } | |
| .optionContainer-yOpaLq:hover{ | |
| background-color:var(--hover-color) | |
| } | |
| .optionContainer-yOpaLq .optionArrow-1kVloh{ | |
| color:#fff | |
| } | |
| .channelIcon-QyaRxN{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .notice-12Koq-{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .notice-12Koq- .header-26uvhX::before{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| left:0; | |
| bottom:0; | |
| background-color:var(--main-color); | |
| opacity:.6; | |
| pointer-events:none; | |
| z-index:-1; | |
| border-radius:3px | |
| } | |
| .container-2dXT_2{ | |
| background-color:rgba(0,0,0,.8) | |
| } | |
| .button-3_1yil:hover{ | |
| background-color:var(--hover-color) | |
| } | |
| .card-PQEqCK{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .checkmark-bW9BK8{ | |
| background-color:var(--main-color) | |
| } | |
| .communityInfoPill-2Mll66{ | |
| background:rgba(0,0,0,.6) | |
| } | |
| .container-2Hi7Km,.container-xwOzwi{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .icon-2IDTxf{ | |
| border:4px solid rgba(0,0,0,0) | |
| } | |
| .interactiveCard-2iMtdk,.interactiveCard-2iMtdk.selected-sszUNx{ | |
| border:1px solid var(--main-color) | |
| } | |
| .interactiveCard-2iMtdk:active,.interactiveCard-2iMtdk:hover{ | |
| border:1px solid var(--hover-color) | |
| } | |
| .card-3x20HF{ | |
| background:rgba(0,0,0,.4) | |
| } | |
| .iconContainer-2R-3M1{ | |
| background:var(--main-color); | |
| color:#fff | |
| } | |
| .container-3HMTms:hover{ | |
| background:var(--hover-color) | |
| } | |
| .conversationRoot-3DieBj:after,.replySpine-3HmFN7{ | |
| border-left:2px solid var(--main-color) | |
| } | |
| .conversationMessage-hy6ISK:after{ | |
| border-left:2px solid var(--main-color); | |
| border-bottom:2px solid var(--main-color) | |
| } | |
| .theme-dark .perksModal-CLcR1c{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .ctaBar-Nhk8yY{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .theme-dark .ctaBar-Nhk8yY .guildIcon-2xKEtM{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .ctaBar-Nhk8yY .badgeIconWithoutSubscribers-1hjTfX{ | |
| color:#fff; | |
| opacity:.8 | |
| } | |
| .theme-dark .ctaBar-Nhk8yY .giftIcon-2kmx1K{ | |
| color:currentColor | |
| } | |
| .theme-dark .tierMarkerBackground-G8FoN4{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .tierMarkerInProgress-2Tdxjz,.theme-dark .barBackground-unEPDT{ | |
| background-color:rgba(0,0,0,.4) !important | |
| } | |
| .theme-dark .tierBody-3ju-rc,.theme-dark .tierHeaderLocked-3ItHYn,.theme-dark .perk-19D_HN{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .theme-dark .tierHeaderLocked-3ItHYn{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .theme-dark .tierLock-1uBqZ0{ | |
| color:#fff; | |
| opacity:.3 | |
| } | |
| .notice-5OG6bf{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .upsellContainer-3qKRln{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .base-2jDfDU .pageContainer-36uo3F{ | |
| background:rgba(0, 0, 0, calc(var(--background-shading) * 0.5)) | |
| } | |
| .optionItem-2tdutc.selected-1-Z6gm .layout-1qmrhw{ | |
| background-color:var(--main-color) | |
| } | |
| .avatar-3VNtDW>svg>path{ | |
| fill:var(--interactive-active) | |
| } | |
| .tabBar-2WseS-{ | |
| margin-bottom:0 | |
| } | |
| .card-3N2v9t{ | |
| background-color:rgba(0,0,0,.4); | |
| transition:all .15s ease-in-out | |
| } | |
| .card-3N2v9t:hover{ | |
| background-color:rgba(0,0,0,.6) | |
| } | |
| .card-3N2v9t .iconMask-24Ybpm{ | |
| background-color:rgba(0,0,0,.4); | |
| transition:all .15s ease-in-out | |
| } | |
| .card-3N2v9t .icon-3Oacog{ | |
| background-color:var(--main-color); | |
| color:#fff | |
| } | |
| .splash-1Rnkv-{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .headerContent-3_EO-5 .searchBox-pyIJJj{ | |
| background:#231c5f; | |
| border:none; | |
| box-shadow:0 0 0 2px rgba(255,255,255,.09) | |
| } | |
| .headerContent-3_EO-5 .searchBox-pyIJJj:focus-within{ | |
| border:none; | |
| box-shadow:0 0 2px 2px var(--main-color) | |
| } | |
| .headerContent-3_EO-5 .searchBox-pyIJJj .input-2g-os5{ | |
| border:none; | |
| box-shadow:none | |
| } | |
| .headerContent-3_EO-5 .searchBox-pyIJJj .searchBoxInput-P0mWHW{ | |
| color:var(--text-normal) | |
| } | |
| .headerContent-3_EO-5 .searchBox-pyIJJj .searchBoxInput-P0mWHW::placeholder{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .headerContent-3_EO-5 .searchBox-pyIJJj .searchIcon-34RNw9{ | |
| color:var(--main-color) | |
| } | |
| .headerContent-3_EO-5 .searchBox-pyIJJj .closeIcon-BMGxx0{ | |
| color:var(--main-color) | |
| } | |
| .headerContent-3_EO-5 .searchBox-pyIJJj .closeIcon-BMGxx0:hover{ | |
| color:var(--hover-color) | |
| } | |
| .searchHeader-UFC-sz .searchPageBox-2yxhpp{ | |
| background:rgba(255,255,255,.07); | |
| border:none; | |
| box-shadow:0 0 0 2px rgba(255,255,255,.09) | |
| } | |
| .searchHeader-UFC-sz .searchPageBox-2yxhpp:focus-within{ | |
| border:none; | |
| box-shadow:0 0 2px 2px var(--main-color) | |
| } | |
| .searchHeader-UFC-sz .searchPageBox-2yxhpp .input-2g-os5{ | |
| border:none; | |
| box-shadow:none | |
| } | |
| .searchHeader-UFC-sz .searchPageBox-2yxhpp .searchBoxInput-P0mWHW{ | |
| color:var(--text-normal) | |
| } | |
| .searchHeader-UFC-sz .searchPageBox-2yxhpp .searchBoxInput-P0mWHW::placeholder{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .searchHeader-UFC-sz .searchPageBox-2yxhpp .closeIcon-BMGxx0{ | |
| color:var(--main-color) | |
| } | |
| .searchHeader-UFC-sz .searchPageBox-2yxhpp .closeIcon-BMGxx0:hover{ | |
| color:var(--hover-color) | |
| } | |
| .popout-2iWAc-{ | |
| box-shadow:none | |
| } | |
| [style*="overflow: hidden"].popout-2iWAc-{ | |
| box-shadow:0 0 10px rgba(0,0,0,.5) | |
| } | |
| .popout-2iWAc- header{ | |
| background:var(--main-color); | |
| border-radius:3px 3px 0 0 | |
| } | |
| .popout-2iWAc- section{ | |
| background:rgba(0,0,0,.7); | |
| border-radius:0 0 3px 3px | |
| } | |
| .popouts-2bnG9Z>.popoutTop-3WSJtH:after,.popouts-2bnG9Z>.popoutTopLeft-3B0mFf:after,.popouts-2bnG9Z>.popoutTopRight-1lc8Mq:after{ | |
| border-top-color:rgba(0,0,0,.7) | |
| } | |
| .popouts-2bnG9Z>.popoutRight-1veHKi:after{ | |
| border-right-color:rgba(0,0,0,.7) | |
| } | |
| .popouts-2bnG9Z>.popoutLeft-3aViER:after{ | |
| border-left-color:rgba(0,0,0,.7) | |
| } | |
| .popouts-2bnG9Z>.popoutBottom-2GAFPg:after,.popouts-2bnG9Z>.popoutBottomLeft-1pG8B4:after,.popouts-2bnG9Z>.popoutBottomRight-2Rno5S:after{ | |
| border-bottom-color:var(--main-color) | |
| } | |
| .layer-2aCOJ3 .container-1S70rv .autocompleteShadow-2nfsSy{ | |
| box-shadow:0 0 1px rgba(0,0,0,.82),0 1px 4px rgba(0,0,0,.1) | |
| } | |
| .layer-2aCOJ3 .container-1S70rv .autocompleteArrow-jJE9TQ{ | |
| background:rgba(0,0,0,.7) | |
| } | |
| .layer-2aCOJ3 .container-1S70rv.positionBottom-1pd-ap .autocompleteArrow-jJE9TQ{ | |
| background:var(--main-color) | |
| } | |
| .layer-2aCOJ3 .container-1S70rv .header-3i_Csh{ | |
| background:rgba(0,0,0,.8) | |
| } | |
| .layer-2aCOJ3 .container-1S70rv .headerText-27z-EV,.layer-2aCOJ3 .container-1S70rv .input-2lpFVz{ | |
| color:#fff | |
| } | |
| .layer-2aCOJ3 .container-1S70rv .input-2lpFVz::placeholder{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .layer-2aCOJ3 .container-1S70rv .sectionTag-28mLyE{ | |
| background:rgba(0,0,0,.8) | |
| } | |
| .layer-2aCOJ3 .container-1S70rv .autocompleteScroller-3L6kmy{ | |
| overflow-y:auto | |
| } | |
| .layer-2aCOJ3 .container-1S70rv .row-1Ib2uD{ | |
| position:relative; | |
| border-radius:5px; | |
| font-weight:500; | |
| z-index:1 | |
| } | |
| .layer-2aCOJ3 .container-1S70rv .row-1Ib2uD span{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .layer-2aCOJ3 .container-1S70rv .row-1Ib2uD span:after{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| background:rgba(0,0,0,0); | |
| z-index:-1; | |
| transition:all .15s ease-in-out | |
| } | |
| .layer-2aCOJ3 .container-1S70rv .row-1Ib2uD span[style*="color:"]:after{ | |
| opacity:.3 | |
| } | |
| .layer-2aCOJ3 .container-1S70rv .row-1Ib2uD>span:after{ | |
| display:none | |
| } | |
| .layer-2aCOJ3 .container-1S70rv .row-1Ib2uD.selected-1IWCoj{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .layer-2aCOJ3 .container-1S70rv .row-1Ib2uD.selected-1IWCoj span{ | |
| color:#fff | |
| } | |
| .layer-2aCOJ3 .container-1S70rv .row-1Ib2uD.selected-1IWCoj span:after{ | |
| background:rgba(255,255,255,.1) | |
| } | |
| .layer-2aCOJ3 .container-1S70rv .row-1Ib2uD.selected-1IWCoj span[style*="color:"]:after{ | |
| background:currentColor | |
| } | |
| .layer-2aCOJ3 .container-1ILvLB{ | |
| box-shadow:0 0 10px rgba(0,0,0,.5) | |
| } | |
| .layer-2aCOJ3 .container-1ILvLB>.header-2C89wJ{ | |
| background:var(--main-color); | |
| color:#fff; | |
| border-radius:3px 3px 0 0 | |
| } | |
| .layer-2aCOJ3 .container-1ILvLB>section{ | |
| background:rgba(0,0,0,.7); | |
| border-radius:0 0 3px 3px | |
| } | |
| .layer-2aCOJ3 .container-1ILvLB>section>p{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .layer-2aCOJ3 .container-1ILvLB>section>p>strong{ | |
| color:var(--main-color) | |
| } | |
| .container-1ILvLB>section .popoutBottom-15-vLu>a{ | |
| color:var(--main-color); | |
| transition:all .1s ease-in-out | |
| } | |
| .container-1ILvLB>section .popoutBottom-15-vLu>a:hover{ | |
| text-shadow:0 0 1px; | |
| text-decoration:none !important | |
| } | |
| .sparkline-3A-8OK>svg>line{ | |
| stroke:rgba(255,255,255,.5) !important; | |
| stroke-dasharray:5,3 !important | |
| } | |
| .sparkline-3A-8OK>svg>g>circle{ | |
| fill:var(--main-color) !important; | |
| fill-opacity:1 !important | |
| } | |
| .sparkline-3A-8OK>svg>g>polyline{ | |
| stroke:var(--main-color) !important; | |
| stroke-opacity:.7 !important | |
| } | |
| .appMount-2yBXZl .contextMenu-HLZMGh{ | |
| padding:2px 3px; | |
| background:rgba(0,0,0,.7); | |
| box-shadow:0 0 10px rgba(0,0,0,.5); | |
| animation:cv-menu-fold-y .2s cubic-bezier(0.2, 0.6, 0.5, 1.1); | |
| transform-origin:50% 0; | |
| z-index:3003 | |
| } | |
| .contextMenu-HLZMGh .itemGroup-1tL0uz{ | |
| border-top-color:rgba(255,255,255,.04) | |
| } | |
| .contextMenu-HLZMGh .item-1Yvehc{ | |
| background-color:rgba(0,0,0,0); | |
| color:rgba(255,255,255,.6); | |
| border-radius:3px; | |
| transition:all .15s ease-in-out | |
| } | |
| .contextMenu-HLZMGh .item-1Yvehc:hover{ | |
| background-color:rgba(0,0,0,.8); | |
| color:#fff | |
| } | |
| .contextMenu-HLZMGh .item-1Yvehc.brand-3igrJY{ | |
| color:rgba(255,255,255,.6) !important | |
| } | |
| .contextMenu-HLZMGh .item-1Yvehc.brand-3igrJY:hover{ | |
| color:#fff !important | |
| } | |
| .contextMenu-HLZMGh .item-1Yvehc.danger-2dXSTE{ | |
| position:relative; | |
| background-color:rgba(0,0,0,0); | |
| color:rgba(255,255,255,.6) !important; | |
| width:calc(100% - 4px); | |
| margin:2px | |
| } | |
| .contextMenu-HLZMGh .item-1Yvehc.danger-2dXSTE:after{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| background:var(--danger-color); | |
| opacity:.5; | |
| transition:inherit; | |
| z-index:-1 | |
| } | |
| .contextMenu-HLZMGh .item-1Yvehc.danger-2dXSTE:hover{ | |
| color:#fff !important | |
| } | |
| .contextMenu-HLZMGh .item-1Yvehc.danger-2dXSTE:hover:after{ | |
| opacity:.7 | |
| } | |
| .subMenuContext-2n_9YM{ | |
| margin:0 -5px | |
| } | |
| .subMenuContext-2n_9YM .contextMenu-HLZMGh{ | |
| transform-origin:50% 50% | |
| } | |
| .drawerSizingWrapper-1txdWG{ | |
| min-width:430px | |
| } | |
| .contentWrapper-3vHNP2{ | |
| background-color:rgba(0,0,0,.8); | |
| border:none; | |
| border-radius:5px; | |
| box-shadow:0 0 10px rgba(0,0,0,.5) | |
| } | |
| .navButtonActive-1EqC5l{ | |
| background-color:var(--main-color) | |
| } | |
| .emojiPicker-6YCk8a{ | |
| background-color:rgba(0,0,0,.8); | |
| min-width:430px; | |
| border-radius:0 | |
| } | |
| .header-11eigE{ | |
| background-color:rgba(0,0,0,.8) | |
| } | |
| .searchBar-2M9mRP{ | |
| background-color:rgba(255,255,255,.07); | |
| box-shadow:0 0 0 2px rgba(255,255,255,.09); | |
| margin-top:2px | |
| } | |
| .searchBar-2M9mRP:focus-within{ | |
| box-shadow:0 0 2px 2px var(--main-color); | |
| transition:all .15s ease-in-out | |
| } | |
| .searchBar-2M9mRP:focus-within .input-2FSSDe{ | |
| color:#fff | |
| } | |
| .searchBar-2M9mRP:focus-within .input-2FSSDe::placeholder{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .diversitySelectorOptions-3DhNYs{ | |
| border:none; | |
| padding:2px; | |
| background-color:rgba(0,0,0,.8) | |
| } | |
| .diversitySelectorOptions-3DhNYs .diversityEmojiItem-2bgZKv{ | |
| border-radius:3px; | |
| transition:all .15s ease-in-out | |
| } | |
| .diversitySelectorOptions-3DhNYs .diversityEmojiItem-2bgZKv:hover{ | |
| background-color:rgba(255,255,255,.07) | |
| } | |
| .wrapper-1NNaWG{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .wrapper-1NNaWG .header-1XpmZs{ | |
| color:#fff | |
| } | |
| .emojiItem-277VFM{ | |
| border-radius:3px; | |
| transition:all .15s ease-in-out,filter 0s | |
| } | |
| .emojiItem-277VFM.emojiItemSelected-2Lg50V{ | |
| background-color:rgba(255,255,255,.07) | |
| } | |
| .emojiItem-277VFM.emojiItemDisabled-3VVnwp{ | |
| filter:grayscale(1) | |
| } | |
| .theme-dark .imageLoading-2uloYN{ | |
| background-image:none | |
| } | |
| .inspector-DFKXwB{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .categoryList-2qRrlj{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .categoryItem-1sHzUv:hover{ | |
| background-color:rgba(255,255,255,.07); | |
| border-radius:4px | |
| } | |
| .categoryItem-1sHzUv.categoryItemDefaultCategorySelected-2YeRUu{ | |
| background-color:rgba(255,255,255,.07); | |
| border-radius:4px | |
| } | |
| .categoryIcon-2cYeku{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .categoryItemDefaultCategorySelected-2YeRUu .categoryIcon-2cYeku{ | |
| color:#fff | |
| } | |
| .guildIcon-2SUGiq{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .unicodeShortcut-3N8oDe{ | |
| background-color:var(--main-color) | |
| } | |
| .unicodeShortcut-3N8oDe svg{ | |
| color:rgba(255,255,255,.9) | |
| } | |
| .unicodeShortcut-3N8oDe:hover{ | |
| background-color:var(--hover-color) | |
| } | |
| .unicodeShortcut-3N8oDe:hover svg{ | |
| color:#fff | |
| } | |
| .premiumPromo-1eKAIB{ | |
| background-color:rgba(0,0,0,.9) | |
| } | |
| .premiumPromoClose-Nuntxy{ | |
| filter:brightness(0) invert(1); | |
| opacity:.6 | |
| } | |
| .premiumPromoClose-Nuntxy:hover{ | |
| opacity:.8 | |
| } | |
| .premiumPromoTitle-3tWrPT{ | |
| color:#fff | |
| } | |
| .premiumPromoTitle-3tWrPT{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .notice-1Qe0b_{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .upsell-3B1lnN{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .perks-2IIbWQ{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .perkRow-10K6XE{ | |
| border-bottom:none | |
| } | |
| .header-JHwfVI .searchBar-gJe8lY{ | |
| background-color:rgba(255,255,255,.07); | |
| border:none; | |
| box-shadow:0 0 0 2px rgba(255,255,255,.09); | |
| margin-top:2px | |
| } | |
| .header-JHwfVI .searchBar-gJe8lY:focus-within{ | |
| box-shadow:0 0 2px 2px var(--main-color); | |
| transition:all .15s ease-in-out | |
| } | |
| .header-JHwfVI .searchBar-gJe8lY .input-2m5SfJ{ | |
| color:#fff | |
| } | |
| .header-JHwfVI .searchBar-gJe8lY .input-2m5SfJ::placeholder{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .header-JHwfVI .icon-3CDcPB,.header-JHwfVI .backButton-bSKWLe{ | |
| color:rgba(255,255,255,.7); | |
| transition:all .15s ease-in-out | |
| } | |
| .header-JHwfVI .icon-3CDcPB:hover,.header-JHwfVI .backButton-bSKWLe:hover{ | |
| color:#fff | |
| } | |
| .header-JHwfVI .searchHeader-3w5h-0{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .content-A8TzKf .categoryFade-3RRG67,.content-A8TzKf .categoryFadeBlurple-1l49_Q{ | |
| transition:all .15s ease-in-out | |
| } | |
| .content-A8TzKf .categoryFade-3RRG67:hover{ | |
| background:rgba(0,0,0,.7) | |
| } | |
| .content-A8TzKf .categoryFadeBlurple-1l49_Q{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .content-A8TzKf .categoryFadeBlurple-1l49_Q:hover{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .content-A8TzKf .categoryFadeBlurple-1l49_Q:after{ | |
| content:""; | |
| width:100%; | |
| height:100%; | |
| display:block; | |
| background:var(--main-color); | |
| border-radius:4px; | |
| opacity:.7 | |
| } | |
| .content-A8TzKf .categoryText-3B1jLN{ | |
| color:#fff; | |
| filter:drop-shadow(0 1px 1px rgba(0, 0, 0, 0.7)) | |
| } | |
| .content-A8TzKf .result-pzZrwj:after{ | |
| transition:all .15s ease-in-out | |
| } | |
| .content-A8TzKf [style*="background-color:"].result-pzZrwj{ | |
| background:var(--main-color) !important | |
| } | |
| .content-A8TzKf [style*="background-color: rgb(179, 174, 255)"].result-pzZrwj{ | |
| filter:brightness(1.3) | |
| } | |
| .content-A8TzKf [style*="background-color: rgb(115, 142, 245)"].result-pzZrwj{ | |
| filter:grayscale(0.3) | |
| } | |
| .content-A8TzKf [style*="background-color: rgb(146, 154, 250)"].result-pzZrwj{ | |
| filter:brightness(0.7) | |
| } | |
| .content-A8TzKf .result-pzZrwj:hover:after,.content-A8TzKf .focused-q9B2e4:after{ | |
| box-shadow:inset 0 0 0 2px var(--main-color),inset 0 0 0 3px rgba(0,0,0,.3) | |
| } | |
| .content-A8TzKf .placeholder-2Mfkde{ | |
| background:rgba(255,255,255,.07) | |
| } | |
| .content-A8TzKf .theme-dark .focused-16Owih:after,.content-A8TzKf .theme-dark .result-pzZrwj:hover:after{ | |
| box-shadow:inset 0 0 0 2px var(--main-color),inset 0 0 0 3px rgba(0,0,0,.7) | |
| } | |
| .content-A8TzKf .emptyHintCard-3Btf0V{ | |
| background:rgba(255,255,255,.04); | |
| color:rgba(255,255,255,.5) | |
| } | |
| .content-A8TzKf .endContainer-3FEUTM:after{ | |
| filter:grayscale(1) brightness(0.7); | |
| opacity:.3 | |
| } | |
| .searchSuggestion-PfUKKS{ | |
| background:rgba(255,255,255,.04) | |
| } | |
| .theme-dark .popout-3gby1q.root-1CAIjD{ | |
| background-color:rgba(0,0,0,.8) | |
| } | |
| .title-3hptVQ{ | |
| color:#fff | |
| } | |
| .subtitle-3v29zT{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .searchBar-14YqL- .searchBarComponent-18D6hD{ | |
| background-color:rgba(255,255,255,.07); | |
| box-shadow:0 0 0 2px rgba(255,255,255,.09) | |
| } | |
| .tag-15zcD_{ | |
| background:var(--main-color); | |
| color:#fff | |
| } | |
| .friend-8ZraY7{ | |
| transition:all .15s ease-in-out | |
| } | |
| .theme-dark .friend-8ZraY7.friendSelected-3cwmD7{ | |
| background:rgba(255,255,255,.1) | |
| } | |
| .theme-dark .friend-8ZraY7.friendSelected-3cwmD7 .nickname-1PdAp3{ | |
| color:#fff | |
| } | |
| .theme-dark .friend-8ZraY7.friendSelected-3cwmD7 .discordTag-2ke74W{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .nickname-1PdAp3{ | |
| color:rgba(255,255,255,.7); | |
| transition:all .15s ease-in-out | |
| } | |
| .discordTag-2ke74W{ | |
| color:rgba(255,255,255,.3); | |
| opacity:1; | |
| transition:all .15s ease-in-out | |
| } | |
| .footerSeparator-b6VH1V{ | |
| box-shadow:0 -1px 0 rgba(255,255,255,.04) | |
| } | |
| .theme-dark .contentWarningPopout-WKdbDG{ | |
| background-color:rgba(0,0,0,.8) | |
| } | |
| .theme-dark .footer-2aeMle{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .menu-2TXYjN{ | |
| background-color:rgba(0,0,0,.8) | |
| } | |
| .menu-2TXYjN .item-5ApiZt{ | |
| color:rgba(255,255,255,.7); | |
| transition:all .15s ease-in-out | |
| } | |
| .menu-2TXYjN .item-5ApiZt.focused-3LIdPu{ | |
| background-color:var(--hover-color); | |
| color:#fff | |
| } | |
| .menu-2TXYjN .item-5ApiZt.focused-3LIdPu .checkbox-397WsK,.menu-2TXYjN .item-5ApiZt.focused-3LIdPu .radioSelection-3PDNAQ{ | |
| color:#fff | |
| } | |
| .menu-2TXYjN .item-5ApiZt.focused-3LIdPu .check-3-73a4{ | |
| color:var(--main-color) | |
| } | |
| .menu-2TXYjN .item-5ApiZt.colorDefault-2_rLdz:active:not(.hideInteraction-1vQrZJ){ | |
| background-color:var(--hover-color); | |
| color:#fff; | |
| border-color:var(--hover-color) | |
| } | |
| .menu-2TXYjN .item-5ApiZt .checkbox-397WsK,.menu-2TXYjN .item-5ApiZt .radioSelection-3PDNAQ{ | |
| color:var(--main-color) | |
| } | |
| .menu-2TXYjN .colorBrand-26tvUE{ | |
| color:var(--main-color) | |
| } | |
| .menu-2TXYjN .colorDanger-3umuSx{ | |
| color:var(--danger-color) | |
| } | |
| .menu-2TXYjN .colorDanger-3umuSx.focused-3LIdPu{ | |
| background-color:var(--danger-color); | |
| color:#fff | |
| } | |
| .menu-2TXYjN .colorDanger-3umuSx.focused-3LIdPu .icon-3XHs8t{ | |
| transform:rotateY(180deg); | |
| transition:all .15s ease-in-out | |
| } | |
| .button-1zW0-r{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .button-1zW0-r.focused-H4w81f,.button-1zW0-r:hover{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .button-1zW0-r.focused-H4w81f{ | |
| box-shadow:0 0 2px 2px var(--hover-color) | |
| } | |
| .premiumUpsell-2K2V_c{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .popout-TdhJ6Z{ | |
| background-color:rgba(0,0,0,.8) | |
| } | |
| .popout-TdhJ6Z .row-1qtctT:hover{ | |
| background-color:var(--hover-color) | |
| } | |
| .popout-TdhJ6Z .more-2c3Z-T{ | |
| color:var(--main-color) | |
| } | |
| .option-1O-Hwt{ | |
| color:#fff; | |
| background:var(--main-color); | |
| border-bottom:1px solid rgba(255,255,255,.08); | |
| transition:all .15s ease-in-out | |
| } | |
| .option-1O-Hwt:hover{ | |
| background:var(--hover-color) | |
| } | |
| .checkbox-1ycfTw .checkboxInner-1aRh1d .checkboxElement-uwAa9F:checked+span{ | |
| background-color:var(--main-color); | |
| border-color:var(--main-color) | |
| } | |
| #account-status-picker--online.item-5ApiZt:not(.focused-3LIdPu) .status-2DiCMd{ | |
| background-color:var(--online-color) | |
| } | |
| #account-status-picker--online.item-5ApiZt.focused-3LIdPu{ | |
| background-color:var(--online-color) | |
| } | |
| #account-status-picker--idle.item-5ApiZt:not(.focused-3LIdPu) .status-2DiCMd{ | |
| background-color:var(--idle-color) | |
| } | |
| #account-status-picker--idle.item-5ApiZt.focused-3LIdPu{ | |
| background-color:var(--idle-color) | |
| } | |
| #account-status-picker--dnd.item-5ApiZt:not(.focused-3LIdPu) .status-2DiCMd{ | |
| background-color:var(--dnd-color) | |
| } | |
| #account-status-picker--dnd.item-5ApiZt.focused-3LIdPu{ | |
| background-color:var(--dnd-color) | |
| } | |
| #account-status-picker--invisible.item-5ApiZt:not(.focused-3LIdPu) .status-2DiCMd{ | |
| background-color:var(--offline-color) | |
| } | |
| #account-status-picker--invisible.item-5ApiZt.focused-3LIdPu{ | |
| background-color:var(--offline-color) | |
| } | |
| .theme-dark .regionSelectPopout-3sEzVB{ | |
| background-color:rgba(0,0,0,.5) | |
| } | |
| .theme-dark .regionSelectPopout-3sEzVB .quickSelectPopoutOption-2E2UmS{ | |
| background-color:rgba(0,0,0,0); | |
| border:none | |
| } | |
| .theme-dark .regionSelectPopout-3sEzVB .quickSelectPopoutOption-2E2UmS.selected{ | |
| background-color:var(--main-color) | |
| } | |
| .theme-dark .regionSelectPopout-3sEzVB .quickSelectPopoutOption-2E2UmS:hover{ | |
| background-color:var(--hover-color) | |
| } | |
| .theme-dark .regionSelectPopout-3sEzVB .quickSelectPopoutOption-2E2UmS .regionSelectName-1Tj9C9{ | |
| color:#fff | |
| } | |
| .layer-2aCOJ3 .container-3cGP6G{ | |
| border:1px solid rgba(0,0,0,0); | |
| background:rgba(0,0,0,.5); | |
| box-shadow:0 0 10px rgba(0,0,0,.3); | |
| animation:cv-menu-fold-y .2s cubic-bezier(0.2, 0.6, 0.5, 1.1); | |
| transform-origin:50% 0 | |
| } | |
| .layer-2aCOJ3 .container-3cGP6G .item-2J1YMK{ | |
| background:rgba(0,0,0,0) !important; | |
| color:rgba(255,255,255,.4); | |
| transition:all .15s ease-in-out | |
| } | |
| .layer-2aCOJ3 .container-3cGP6G .item-2J1YMK:hover{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .messagesPopoutWrap-3zryHW,.recentMentionsPopout-2bI1ZN{ | |
| background-color:rgba(0,0,0,.8); | |
| animation:cv-menu-fold-y .2s cubic-bezier(0.2, 0.6, 0.5, 1.1); | |
| transform-origin:50% 0; | |
| border-radius:5px; | |
| box-shadow:0 0 10px rgba(0,0,0,.5) | |
| } | |
| .header-1w9Q93,.footer-5ji8u1{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .header-1w9Q93 .tabBar-1qdMr5 .tab-TRrPC8{ | |
| color:#fff | |
| } | |
| .theme-dark .header-1w9Q93 .tabBar-1qdMr5 .tab-TRrPC8.active-1grPyy{ | |
| background-color:var(--main-color) | |
| } | |
| .theme-dark .header-1w9Q93 .tabBar-1qdMr5 .tab-TRrPC8:hover:not(.active-1grPyy){ | |
| background-color:rgba(255,255,255,.06); | |
| color:#fff | |
| } | |
| .channelHeader-DFRX8q{ | |
| background:rgba(0,0,0,.8); | |
| padding-right:10px; | |
| padding-left:20px | |
| } | |
| .messageGroupWrapper-1jf_7C{ | |
| margin:0; | |
| background-color:rgba(0,0,0,0); | |
| border:none; | |
| border-bottom:solid 1px rgba(255,255,255,.04); | |
| border-radius:0; | |
| transition:all .15s ease-in-out | |
| } | |
| .messageGroupWrapper-1jf_7C:last-child{ | |
| border-bottom:none | |
| } | |
| .messageGroupWrapper-1jf_7C+.messageGroupWrapper-1jf_7C{ | |
| margin-top:-1px | |
| } | |
| .jumpButton-1ZwI_j{ | |
| background-color:var(--main-color); | |
| color:#fff | |
| } | |
| .jumpButton-1ZwI_j:hover{ | |
| background-color:var(--hover-color); | |
| color:#fff | |
| } | |
| .container-iA3Qrz{ | |
| margin:0; | |
| background-color:rgba(0,0,0,0); | |
| border:none; | |
| border-bottom:solid 1px rgba(255,255,255,.08); | |
| border-radius:0 | |
| } | |
| .messageContainer-3VTXBC{ | |
| background:rgba(0,0,0,0); | |
| padding-right:10px; | |
| padding-left:20px | |
| } | |
| .jumpButton-1ITAeq{ | |
| background-color:var(--main-color) | |
| } | |
| .jumpButton-1ITAeq .text-2ifC_x{ | |
| color:#fff | |
| } | |
| .jumpButton-1ITAeq:hover{ | |
| background-color:var(--hover-color) | |
| } | |
| .jumpButton-1ITAeq:hover .text-2ifC_x{ | |
| color:#fff | |
| } | |
| .icon-2yhmi8{ | |
| background-color:var(--main-color); | |
| color:#fff | |
| } | |
| .tutorial-Nb3Zz5{ | |
| background:rgba(0,0,0,0); | |
| border-bottom:solid 1px rgba(255,255,255,.08) | |
| } | |
| .tutorialIcon-25VF3Q{ | |
| background-color:var(--main-color); | |
| color:#fff | |
| } | |
| .channel-3NJZ1V{ | |
| margin:0; | |
| background-color:rgba(0,0,0,0); | |
| border:none; | |
| border-bottom:solid 1px rgba(255,255,255,.08); | |
| border-radius:0 | |
| } | |
| .messages-23can0{ | |
| background:rgba(0,0,0,0); | |
| padding-right:10px; | |
| padding-left:20px | |
| } | |
| .collapseButton-39-IRc{ | |
| padding-left:9px | |
| } | |
| .popoutContainer-2wbmiM{ | |
| background-color:rgba(0,0,0,.8) | |
| } | |
| .emojiSection-3QtaWO{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .guildSection-2Zyzy8{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .loadingBackground-1p5N1j .loading-1lSwpg{ | |
| opacity:.3 | |
| } | |
| .toolbar-37BrJ5{ | |
| background-color:rgba(0,0,0,.8) | |
| } | |
| .toolbar-37BrJ5::before{ | |
| border-top:8px solid rgba(0,0,0,.8) | |
| } | |
| .active-136ioF,.hover-3OQb9Y:hover{ | |
| background-color:rgba(255,255,255,.05) | |
| } | |
| .icon-3g7qdA{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .theme-dark .streamPreview-I7itZ6{ | |
| background-color:rgba(0,0,0,.8) | |
| } | |
| .theme-dark .previewContainer-35LFgt{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .watchButton-2YRKxv{ | |
| border-color:var(--main-color); | |
| color:rgba(255,255,255,.8) | |
| } | |
| .theme-dark .watchButton-2YRKxv:not([disabled]):hover{ | |
| border-color:var(--hover-color); | |
| color:#fff | |
| } | |
| .sidebarContainer-gUKhtL{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .root-cw9rWQ{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .problemInfo-1QppuA .option-1O-Hwt{ | |
| color:#fff; | |
| background:rgba(255,255,255,.03); | |
| border:1px solid rgba(255,255,255,.05); | |
| border-top:none | |
| } | |
| .problemInfo-1QppuA .option-1O-Hwt:first-child{ | |
| border-top:1px solid rgba(255,255,255,.05) | |
| } | |
| .problemInfo-1QppuA:hover{ | |
| background:rgba(255,255,255,.06) | |
| } | |
| .theme-dark .container-2McqkF{ | |
| background-color:rgba(0,0,0,.8); | |
| box-shadow:0 0 10px rgba(0,0,0,.5); | |
| animation:cv-menu-fold-y .2s cubic-bezier(0.2, 0.6, 0.5, 1.1) .1s backwards; | |
| transform-origin:50% 0 | |
| } | |
| .container-2McqkF>.resultsGroup-cfY57t:after{ | |
| border-top:1px solid rgba(0,0,0,0) | |
| } | |
| .container-2McqkF>.resultsGroup-cfY57t+.resultsGroup-cfY57t:after{ | |
| border-top-color:rgba(255,255,255,.04) | |
| } | |
| .container-2McqkF>.resultsGroup-cfY57t>.header-1BR0Ro{ | |
| color:var(--main-color); | |
| font-weight:700 | |
| } | |
| .container-2McqkF>.resultsGroup-cfY57t>.searchLearnMore-1gNL3A,.container-2McqkF>.resultsGroup-cfY57t>.searchClearHistory-3nIKUO{ | |
| opacity:.5; | |
| transition:all .15s ease-in-out | |
| } | |
| .container-2McqkF>.resultsGroup-cfY57t>.searchLearnMore-1gNL3A:hover,.container-2McqkF>.resultsGroup-cfY57t>.searchClearHistory-3nIKUO:hover{ | |
| opacity:1 | |
| } | |
| .container-2McqkF>.resultsGroup-cfY57t>.searchLearnMore-1gNL3A>a,.container-2McqkF>.resultsGroup-cfY57t>.searchClearHistory-3nIKUO>a{ | |
| color:#fff | |
| } | |
| .container-2McqkF .option-ayUoaq{ | |
| transition:all .15s ease-in-out | |
| } | |
| .container-2McqkF .option-ayUoaq:after{ | |
| display:none | |
| } | |
| .container-2McqkF .option-ayUoaq .plusIcon-1RVszG{ | |
| display:block; | |
| color:#fff; | |
| opacity:0; | |
| transition:all .15s ease-in-out | |
| } | |
| .container-2McqkF .option-ayUoaq:hover .plusIcon-1RVszG{ | |
| opacity:.7 | |
| } | |
| .container-2McqkF .option-ayUoaq .filter-2QaH9y{ | |
| color:rgba(255,255,255,.3); | |
| transition:all .15s ease-in-out | |
| } | |
| .container-2McqkF .option-ayUoaq .answer-14OVbQ{ | |
| color:rgba(255,255,255,.5); | |
| font-weight:500; | |
| transition:all .15s ease-in-out | |
| } | |
| .container-2McqkF .option-ayUoaq .nonText-28q_Ot{ | |
| color:rgba(255,255,255,.5); | |
| transition:all .15s ease-in-out | |
| } | |
| .container-2McqkF .option-ayUoaq>strong{ | |
| color:rgba(255,255,255,.7); | |
| transition:all .15s ease-in-out | |
| } | |
| .container-2McqkF [aria-selected=true].option-ayUoaq{ | |
| background-color:rgba(255,255,255,.1) | |
| } | |
| .container-2McqkF [aria-selected=true].option-ayUoaq .plusIcon-1RVszG{ | |
| opacity:.3 | |
| } | |
| .container-2McqkF [aria-selected=true].option-ayUoaq .plusIcon-1RVszG:hover{ | |
| opacity:.7 | |
| } | |
| .container-2McqkF [aria-selected=true].option-ayUoaq .filter-2QaH9y{ | |
| color:rgba(255,255,255,.5) | |
| } | |
| .container-2McqkF [aria-selected=true].option-ayUoaq .answer-14OVbQ,.container-2McqkF [aria-selected=true].option-ayUoaq .nonText-28q_Ot{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .container-2McqkF [aria-selected=true].option-ayUoaq>strong{ | |
| color:#fff | |
| } | |
| .container-2McqkF .option-ayUoaq.user-1dKxvu .displayedNick-1atSpT{ | |
| color:rgba(255,255,255,.5); | |
| transition:all .15s ease-in-out | |
| } | |
| .container-2McqkF .option-ayUoaq.user-1dKxvu .displayUsername-UTerwm{ | |
| color:rgba(255,255,255,.3); | |
| transition:all .15s ease-in-out | |
| } | |
| .container-2McqkF .option-ayUoaq>.resultChannel-37MfX_>strong{ | |
| color:rgba(255,255,255,.7); | |
| transition:all .15s ease-in-out | |
| } | |
| .container-2McqkF .option-ayUoaq>.resultChannel-37MfX_>.searchResultChannelIcon-C-3P9x,.container-2McqkF .option-ayUoaq>.resultChannel-37MfX_>.searchResultChannelCategory-19ujDo{ | |
| color:rgba(255,255,255,.3); | |
| transition:all .15s ease-in-out | |
| } | |
| .container-2McqkF .queryContainer-ZunrLZ{ | |
| background-color:var(--main-color) | |
| } | |
| .container-2McqkF .queryContainer-ZunrLZ>.queryText-j8z984{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .container-2McqkF .queryContainer-ZunrLZ>.queryText-j8z984>strong{ | |
| color:#fff | |
| } | |
| .container-2McqkF .queryContainer-ZunrLZ .keybindShortcutSearchPopout-pt_bn5>span{ | |
| border-color:rgba(255,255,255,.5); | |
| box-shadow:inset 0 -4px rgba(255,255,255,.7) | |
| } | |
| .container-2McqkF .queryContainer-ZunrLZ .keybindShortcutSearchPopout-pt_bn5>span:hover{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .container-2McqkF .queryContainer-ZunrLZ .keybindShortcutSearchPopout-pt_bn5>span:active{ | |
| border-color:rgba(255,255,255,.5); | |
| box-shadow:inset 0 -2px rgba(255,255,255,.7); | |
| color:#fff | |
| } | |
| .container-2McqkF .datePicker-3iA7_k .datePickerHint-Ir4715{ | |
| border-top:1px solid rgba(255,255,255,.04) | |
| } | |
| .container-2McqkF .datePicker-3iA7_k .datePickerHint-Ir4715 .hint-xfbpCV{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .container-2McqkF .datePicker-3iA7_k .datePickerHint-Ir4715 .hintValue-V9hd8l{ | |
| background-color:var(--main-color); | |
| color:#fff; | |
| transition:all .15s ease-in-out | |
| } | |
| .container-2McqkF .datePicker-3iA7_k .datePickerHint-Ir4715 .hintValue-V9hd8l:hover{ | |
| background-color:var(--hover-color) | |
| } | |
| .theme-dark .calendarPicker-sDhzdi .react-datepicker,.theme-dark .calendarPicker-sDhzdi .react-datepicker__header{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .calendarPicker-sDhzdi>.react-datepicker .react-datepicker__navigation{ | |
| background-color:rgba(255,255,255,.1); | |
| border:1px solid rgba(0,0,0,0); | |
| opacity:.7; | |
| transition:all .15s ease-in-out | |
| } | |
| .theme-dark .calendarPicker-sDhzdi>.react-datepicker .react-datepicker__navigation:hover{ | |
| background-color:var(--main-color); | |
| opacity:1 | |
| } | |
| .theme-dark .calendarPicker-sDhzdi .react-datepicker__current-month{ | |
| border-bottom:1px solid rgba(255,255,255,.04); | |
| color:var(--main-color); | |
| font-weight:600 | |
| } | |
| .theme-dark .calendarPicker-sDhzdi .react-datepicker__day-name{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .theme-dark .calendarPicker-sDhzdi .react-datepicker__week>.react-datepicker__day{ | |
| background-color:rgba(255,255,255,.1); | |
| border-left:1px solid rgba(255,255,255,.04); | |
| border-top:1px solid rgba(255,255,255,.04); | |
| color:rgba(255,255,255,.7); | |
| transition:all .15s ease-in-out | |
| } | |
| .theme-dark .calendarPicker-sDhzdi .react-datepicker__week>.react-datepicker__day:last-of-type{ | |
| border-right:1px solid rgba(255,255,255,.04) | |
| } | |
| .theme-dark .calendarPicker-sDhzdi .react-datepicker__week>.react-datepicker__day:hover{ | |
| background-color:var(--main-color); | |
| color:#fff | |
| } | |
| .theme-dark .calendarPicker-sDhzdi .react-datepicker__week>.react-datepicker__day--selected{ | |
| box-shadow:inset 0 -3px var(--main-color) | |
| } | |
| .theme-dark .calendarPicker-sDhzdi .react-datepicker__week>.react-datepicker__day--selected:after{ | |
| display:none | |
| } | |
| .theme-dark .calendarPicker-sDhzdi .react-datepicker__week>.react-datepicker__day--today{ | |
| color:var(--main-color); | |
| font-weight:700 | |
| } | |
| .theme-dark .calendarPicker-sDhzdi .react-datepicker__week>.react-datepicker__day--disabled,.theme-dark .calendarPicker-sDhzdi .react-datepicker__week>.react-datepicker__day--outside-month{ | |
| background-color:rgba(0,0,0,0); | |
| color:rgba(255,255,255,.1) | |
| } | |
| .theme-dark .calendarPicker-sDhzdi .react-datepicker__week>.react-datepicker__day--disabled:hover,.theme-dark .calendarPicker-sDhzdi .react-datepicker__week>.react-datepicker__day--outside-month:hover{ | |
| background-color:rgba(0,0,0,0); | |
| color:rgba(255,255,255,.1) | |
| } | |
| .container-1SX9VC{ | |
| background-color:rgba(255,255,255,.07); | |
| border:none; | |
| box-shadow:0 0 0 2px rgba(255,255,255,.09); | |
| margin-top:2px | |
| } | |
| .container-1SX9VC:focus-within{ | |
| box-shadow:0 0 2px 2px var(--main-color); | |
| transition:all .15s ease-in-out | |
| } | |
| .container-1SX9VC .input-2FSSDe{ | |
| color:#fff | |
| } | |
| .container-1SX9VC .input-2FSSDe::placeholder{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .wrapper-22rqw6{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .stickerCategoryGeneric-29JiZ2{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .stickerCategoryGeneric-29JiZ2:hover{ | |
| background-color:rgba(255,255,255,.07); | |
| border-radius:4px | |
| } | |
| .stickerCategoryGenericSelected-DnO2K8{ | |
| background-color:var(--main-color); | |
| color:#fff | |
| } | |
| .upsellContent-1ppSei{ | |
| background-color:rgba(0,0,0,.8) | |
| } | |
| .row-2mBMW2{ | |
| column-gap:8px !important | |
| } | |
| .stickerInspected-mwnU6w .inspectedIndicator-27zwNZ{ | |
| background-color:var(--main-color) | |
| } | |
| .theme-dark .containerBackground-Ang24O{ | |
| opacity:1; | |
| background-color:rgba(0,0,0,.8); | |
| border:none | |
| } | |
| .maskBackground-F7QD-A{ | |
| background:var(--hover-color) | |
| } | |
| .container-18GwIk{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .layer-2aCOJ3 .container-18GwIk{ | |
| background-color:rgba(0,0,0,.8); | |
| animation:cv-menu-fold-y .2s cubic-bezier(0.2, 0.6, 0.5, 1.1); | |
| transform-origin:50% 0; | |
| border-radius:5px; | |
| box-shadow:0 0 10px rgba(0,0,0,.5) | |
| } | |
| .header-3_zmOb{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .icon-mJhEWn{ | |
| background-color:var(--main-color); | |
| color:#fff | |
| } | |
| .theme-dark .header-3_zmOb .tabBar-2WhZ9G .tab-2Jo-cu{ | |
| color:#fff | |
| } | |
| .theme-dark .header-3_zmOb .tabBar-2WhZ9G .tab-2Jo-cu.active-346HgG{ | |
| background-color:var(--main-color) | |
| } | |
| .theme-dark .header-3_zmOb .tabBar-2WhZ9G .tab-2Jo-cu:hover:not(.active-346HgG){ | |
| background-color:rgba(255,255,255,.06); | |
| color:#fff | |
| } | |
| .userPopoutOuter-3AVBmJ.userProfileOuterUnthemed-2b2rsv{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .userPopoutOuter-3AVBmJ.userProfileOuterUnthemed-2b2rsv .userPopoutInner-1hXSeY{ | |
| background:var(--user-popout-overlay) | |
| } | |
| .userPopoutOuter-3AVBmJ.userProfileOuterUnthemed-2b2rsv:not(.profileCustomizationPreview-2-Y173) .userPopoutInner-1hXSeY::before{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| background:var(--user-popout-image) var(--user-popout-position)/var(--user-popout-size) var(--user-popout-repeat) var(--user-popout-attachment); | |
| filter:grayscale(var(--user-popout-grayscale)) sepia(var(--user-popout-sepia)) invert(var(--user-popout-invert)) brightness(var(--user-popout-brightness)) contrast(var(--user-popout-contrast)) saturate(var(--user-popout-saturation)) blur(var(--user-popout-blur)); | |
| width:100%; | |
| height:100%; | |
| z-index:-1 | |
| } | |
| .animatorLeft-3yvG13>.userPopoutOuter-3AVBmJ{ | |
| transform-origin:100% 50% | |
| } | |
| .popoutBanner-16rVDY{ | |
| -webkit-mask:linear-gradient(to bottom, #000, transparent 93%); | |
| mask:linear-gradient(to bottom, #000, transparent 93%) | |
| } | |
| .popoutBannerPremium-2RvDNZ{ | |
| -webkit-mask:linear-gradient(to bottom, #000 50%, transparent); | |
| mask:linear-gradient(to bottom, #000 50%, transparent) | |
| } | |
| .profileBadges-31rDHI{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .userPopoutOverlayBackground-dKOOda{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .userPopoutOverlayBackground-dKOOda>.menu-2TXYjN{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .userPopoutOverlayBackground-dKOOda .popoutNoBannerPremium-2TQa6P{ | |
| -webkit-mask:linear-gradient(to bottom, #000 50%, transparent); | |
| mask:linear-gradient(to bottom, #000 50%, transparent) | |
| } | |
| .userPopoutOverlayBackground-dKOOda #permissions-popout{ | |
| display:flex; | |
| flex-direction:column; | |
| flex-shrink:1 | |
| } | |
| .userProfileOuterUnthemed-2b2rsv .buttonColor-XIRMbp{ | |
| background-color:var(--main-color) | |
| } | |
| .messageInputContainer-2rGDH8{ | |
| border:none | |
| } | |
| .container-8Futzw{ | |
| background-color:rgba(0,0,0,.8) | |
| } | |
| .button-1Ofqs0:hover{ | |
| background-color:var(--hover-color); | |
| border-color:var(--main-color) !important | |
| } | |
| .iconButton-285DXF:hover{ | |
| background-color:var(--hover-color); | |
| border-color:var(--main-color) !important | |
| } | |
| .errorPage-2pZ2Kq{ | |
| background:rgba(0,0,0,0); | |
| box-shadow:inset 0 0 50vmin 10px var(--danger-color) | |
| } | |
| .errorPage-2pZ2Kq .contents-3NembX{ | |
| height:16px; | |
| font-size:0 | |
| } | |
| .errorPage-2pZ2Kq .contents-3NembX:after{ | |
| content:"Respawn at last Checkpoint"; | |
| font-size:14px | |
| } | |
| .image-35kDIs{ | |
| display:none | |
| } | |
| .text-3IbNaT{ | |
| width:auto; | |
| color:rgba(255,255,255,.7) | |
| } | |
| .text-3IbNaT h4{ | |
| height:150px; | |
| width:100vw; | |
| background:rgba(0,0,0,.5); | |
| box-shadow:0 0 30px 15px rgba(0,0,0,.5); | |
| color:var(--danger-color); | |
| font-family:Georgia,"Times New Roman",Times,serif; | |
| font-size:0; | |
| font-weight:normal; | |
| line-height:150px | |
| } | |
| .text-3IbNaT h4:after{ | |
| content:"YOU DIED"; | |
| font-size:150px | |
| } | |
| .text-3IbNaT .note-Ph806N{ | |
| font-size:0; | |
| white-space:pre-line | |
| } | |
| .note-Ph806N>div>p{ | |
| margin:0 | |
| } | |
| .note-Ph806N>div>p:before,.note-Ph806N>div>p:after{ | |
| margin-bottom:14px; | |
| display:block; | |
| font-size:16px | |
| } | |
| .note-Ph806N>div>p:first-child:before{ | |
| content:"Looks like you got slaughtered by an Error Level 9000." | |
| } | |
| .note-Ph806N>div>p:first-child:after{ | |
| content:"Might have been one of your plugins?" | |
| } | |
| .note-Ph806N>div>p:last-child:after{ | |
| content:"Press Ctrl + Shift + I or Cmd + Alt + I to check Console for errors." | |
| } | |
| .container-2RRFHK{ | |
| background:rgba(0,0,0,.9) | |
| } | |
| .links-30fqF9{ | |
| color:var(--main-color); | |
| opacity:1 !important; | |
| transition:all .1s ease-in-out | |
| } | |
| .links-30fqF9:hover{ | |
| text-shadow:0 0 1px; | |
| text-decoration:none !important | |
| } | |
| .path-lhsLSV{ | |
| stroke:var(--main-color) !important | |
| } | |
| .path2-F-M5gP{ | |
| opacity:.5 !important | |
| } | |
| .path3-3tVOpU{ | |
| opacity:.3 !important | |
| } | |
| .content-1jQy2l .searchResultsWrap-5RVOkx{ | |
| background-color:rgba(0,0,0,.6) | |
| } | |
| .searchResultsWrap-5RVOkx>.searchHeader-1r_ZSh{ | |
| background-color:rgba(0,0,0,.3); | |
| box-shadow:0 0 10px rgba(0,0,0,.3) | |
| } | |
| .searchResultsWrap-5RVOkx>.searchHeader-1r_ZSh .item-2GWPIy.selected-1sf9UK{ | |
| background-color:var(--main-color) | |
| } | |
| .searchResultsWrap-5RVOkx>.searchHeader-1r_ZSh .item-2GWPIy:hover:not(.disabled-2G98Nl){ | |
| background-color:var(--hover-color) | |
| } | |
| .searchResultsWrap-5RVOkx .channelName-3w2Y3c{ | |
| display:flex; | |
| align-items:center; | |
| justify-content:center; | |
| background-color:rgba(0,0,0,0); | |
| color:var(--main-color); | |
| text-shadow:0 0 1px; | |
| transition:all .15s ease-in-out | |
| } | |
| .searchResultsWrap-5RVOkx .channelName-3w2Y3c:before{ | |
| content:""; | |
| height:2px; | |
| border:none; | |
| flex-grow:1; | |
| transition:all .15s ease-in-out; | |
| opacity:.7; | |
| margin-right:5px; | |
| background:linear-gradient(to left, var(--main-color) 50%, transparent) | |
| } | |
| .searchResultsWrap-5RVOkx .channelName-3w2Y3c:after{ | |
| content:""; | |
| height:2px; | |
| border:none; | |
| flex-grow:1; | |
| transition:all .15s ease-in-out; | |
| opacity:.7; | |
| margin-left:5px; | |
| background:linear-gradient(to right, var(--main-color) 50%, transparent) | |
| } | |
| .searchResultsWrap-5RVOkx .channelName-3w2Y3c:hover{ | |
| text-shadow:0 0 3px; | |
| text-decoration:none | |
| } | |
| .searchResultsWrap-5RVOkx .channelName-3w2Y3c:hover:before,.searchResultsWrap-5RVOkx .channelName-3w2Y3c:hover:after{ | |
| opacity:1 | |
| } | |
| .searchResultsWrap-5RVOkx .searchResult-O9NDji{ | |
| padding-bottom:10px; | |
| border-bottom:1px solid rgba(255,255,255,.04); | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .searchResultsWrap-5RVOkx .searchResult-O9NDji:before,.searchResultsWrap-5RVOkx .searchResult-O9NDji:after{ | |
| display:none | |
| } | |
| .searchResultsWrap-5RVOkx .searchResult-O9NDji+.searchResult-O9NDji{ | |
| margin-top:-1px | |
| } | |
| .searchResultsWrap-5RVOkx .searchResult-O9NDji>.searchResultMessage-2VxO12{ | |
| background-color:rgba(0,0,0,0); | |
| border:2px solid rgba(0,0,0,0); | |
| transition:background-color .3s ease-in-out,transform .3s ease-in-out,opacity .3s ease-in-out | |
| } | |
| .searchResultsWrap-5RVOkx .searchResult-O9NDji>.searchResultMessage-2VxO12.hit-NLlWXA{ | |
| background-color:rgba(0,0,0,.3); | |
| border:2px solid rgba(0,0,0,0); | |
| border-radius:5px; | |
| box-shadow:none | |
| } | |
| .searchResultsWrap-5RVOkx .searchResult-O9NDji>.searchResultMessage-2VxO12.before-1x1q5S,.searchResultsWrap-5RVOkx .searchResult-O9NDji>.searchResultMessage-2VxO12.after-2g0jjc{ | |
| opacity:0; | |
| transition:background-color .3s ease-in-out,transform .3s ease-in-out,opacity 0s | |
| } | |
| .searchResultsWrap-5RVOkx .searchResult-O9NDji>.searchResultMessage-2VxO12.sibling-3tUBeh{ | |
| opacity:.3; | |
| transition:background-color .3s ease-in-out,transform .3s ease-in-out,opacity .3s ease-in-out | |
| } | |
| .searchResultsWrap-5RVOkx .searchResult-O9NDji:not(.expanded-v2Szsz)>.sibling-3tUBeh{ | |
| -webkit-mask-image:linear-gradient(to bottom, transparent 10%, #000 30%, #000 70%, transparent 90%); | |
| mask-image:linear-gradient(to bottom, transparent 10%, #000 30%, #000 70%, transparent 90%) | |
| } | |
| .searchResultsWrap-5RVOkx .searchResult-O9NDji.expanded-v2Szsz{ | |
| background-color:rgba(255,255,255,.04); | |
| border:none; | |
| border-bottom:1px solid rgba(255,255,255,.04); | |
| border-radius:0 | |
| } | |
| .searchResultsWrap-5RVOkx .searchResult-O9NDji.expanded-v2Szsz>.searchResultMessage-2VxO12.hit-NLlWXA{ | |
| background-color:rgba(255,255,255,.1); | |
| border:2px solid rgba(0,0,0,0); | |
| border-radius:5px | |
| } | |
| .searchResultsWrap-5RVOkx .searchResult-O9NDji.expanded-v2Szsz>.searchResultMessage-2VxO12.before-1x1q5S,.searchResultsWrap-5RVOkx .searchResult-O9NDji.expanded-v2Szsz>.searchResultMessage-2VxO12.after-2g0jjc{ | |
| opacity:1 | |
| } | |
| .searchResultsWrap-5RVOkx .actionButtons-14P9IC{ | |
| background-color:rgba(0,0,0,0); | |
| box-shadow:none; | |
| opacity:0; | |
| transition:all .15s ease-in-out | |
| } | |
| .searchResultsWrap-5RVOkx .hit-NLlWXA:hover>.actionButtons-14P9IC{ | |
| opacity:1 | |
| } | |
| .searchResultsWrap-5RVOkx .button-cfOvv-{ | |
| background-color:rgba(255,255,255,.04); | |
| color:rgba(255,255,255,.5); | |
| border-radius:3px; | |
| transition:all .3s ease-in-out | |
| } | |
| .searchResultsWrap-5RVOkx .button-cfOvv-:hover{ | |
| background-color:var(--main-color); | |
| color:#fff; | |
| transition-duration:.15s | |
| } | |
| .searchResultsWrap-5RVOkx .expanded-v2Szsz .button-cfOvv-{ | |
| background-color:rgba(0,0,0,.3) | |
| } | |
| .searchResultsWrap-5RVOkx .highlight{ | |
| position:relative; | |
| padding:0 2px; | |
| background-color:var(--hover-color); | |
| border-radius:3px; | |
| color:#fff; | |
| text-shadow:0 0 3px | |
| } | |
| .resultsBlocked-2lCGyA{ | |
| background-color:rgba(0,0,0,0); | |
| border:none | |
| } | |
| .connection-YOVI9j,.connectionHeader-Ixbb1s{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .connectionIcon-1iZ6F_+div:before{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| border-radius:8px 8px 0 0; | |
| pointer-events:none; | |
| z-index:-1 | |
| } | |
| .connectionIcon-1iZ6F_+div:after{ | |
| content:""; | |
| position:absolute; | |
| top:68px; | |
| right:0; | |
| bottom:-64px; | |
| left:0; | |
| border-radius:0 0 8px 8px; | |
| pointer-events:none; | |
| z-index:-1 | |
| } | |
| .connectionIcon-1iZ6F_[alt*=Reddit]+div:before{ | |
| background-color:rgba(255,69,0,.6) | |
| } | |
| .connectionIcon-1iZ6F_[alt*=Reddit]+div:after{ | |
| background-color:rgba(255,69,0,.5) | |
| } | |
| .connectionIcon-1iZ6F_[alt*=Steam]+div:before{ | |
| background-color:rgba(0,0,0,.6) | |
| } | |
| .connectionIcon-1iZ6F_[alt*=Steam]+div:after{ | |
| background-color:rgba(0,0,0,.5) | |
| } | |
| .connectionIcon-1iZ6F_[alt*=Twitter]+div:before{ | |
| background-color:rgba(0,158,247,.6) | |
| } | |
| .connectionIcon-1iZ6F_[alt*=Twitter]+div:after{ | |
| background-color:rgba(0,158,247,.5) | |
| } | |
| .connectionIcon-1iZ6F_[alt*=Spotify]+div:before{ | |
| background-color:rgba(29,185,84,.6) | |
| } | |
| .connectionIcon-1iZ6F_[alt*=Spotify]+div:after{ | |
| background-color:rgba(29,185,84,.5) | |
| } | |
| .connectionIcon-1iZ6F_[alt*="Xbox Live"]+div:before{ | |
| background-color:rgba(16,124,16,.6) | |
| } | |
| .connectionIcon-1iZ6F_[alt*="Xbox Live"]+div:after{ | |
| background-color:rgba(16,124,16,.5) | |
| } | |
| .connectionIcon-1iZ6F_[alt*="Battle.net"]+div:before{ | |
| background-color:rgba(5,102,176,.6) | |
| } | |
| .connectionIcon-1iZ6F_[alt*="Battle.net"]+div:after{ | |
| background-color:rgba(5,102,176,.5) | |
| } | |
| .connectionIcon-1iZ6F_[alt*=Facebook]+div:before{ | |
| background-color:rgba(24,119,242,.6) | |
| } | |
| .connectionIcon-1iZ6F_[alt*=Facebook]+div:after{ | |
| background-color:rgba(24,119,242,.5) | |
| } | |
| .connectionIcon-1iZ6F_[alt*=GitHub]+div:before{ | |
| background-color:rgba(34,34,34,.6) | |
| } | |
| .connectionIcon-1iZ6F_[alt*=GitHub]+div:after{ | |
| background-color:rgba(34,34,34,.5) | |
| } | |
| .connectionIcon-1iZ6F_[alt*=Twitch]+div:before{ | |
| background-color:rgba(145,70,255,.6) | |
| } | |
| .connectionIcon-1iZ6F_[alt*=Twitch]+div:after{ | |
| background-color:rgba(145,70,255,.5) | |
| } | |
| .connectionIcon-1iZ6F_[alt*=YouTube]+div:before{ | |
| background-color:rgba(255,0,0,.6) | |
| } | |
| .connectionIcon-1iZ6F_[alt*=YouTube]+div:after{ | |
| background-color:rgba(255,0,0,.5) | |
| } | |
| .connectionIcon-1iZ6F_[alt*=Steam]+div:after,.connectionIcon-1iZ6F_[alt*=Twitter]+div:after,.connectionIcon-1iZ6F_[alt*=Spotify]+div:after,.connectionIcon-1iZ6F_[alt*="Xbox Live"]+div:after,.connectionIcon-1iZ6F_[alt*=Facebook]+div:after{ | |
| bottom:-108px | |
| } | |
| .connectionAccountLabel-28GEPk{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .connectionDelete-3YgMVq{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .integrationsWrapper-1V-5L9{ | |
| background-color:#9146ff; | |
| border-radius:0 0 8px 8px | |
| } | |
| .integration-1qC-fv{ | |
| background-color:#9146ff | |
| } | |
| .group-LWHoGI{ | |
| border:1px solid rgba(255,255,255,.07) | |
| } | |
| .item-4m-12I{ | |
| background-color:rgba(0,0,0,.4); | |
| border-color:rgba(255,255,255,.07); | |
| cursor:pointer | |
| } | |
| .item-4m-12I.selected-3jieYB.deny-1GO6vI{ | |
| background-color:rgba(240,71,71,.6); | |
| border-color:#f04747 | |
| } | |
| .item-4m-12I.selected-3jieYB.passthrough--fbdFR{ | |
| background-color:rgba(250,166,26,.6); | |
| border-color:#faa61a | |
| } | |
| .item-4m-12I.selected-3jieYB.allow-1h61-Z{ | |
| background-color:rgba(67,181,129,.6); | |
| border-color:#43b581 | |
| } | |
| .settingCard-xZSDjS{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .settingCard-xZSDjS.active-3EK-ed{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .cardFolder-3H4uH4{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .iconWrapper-1sOtkE{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .staticToolbar-x12NJC{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .addTags-2AjBTc{ | |
| background:var(--main-color) | |
| } | |
| .container-16urgA{ | |
| border-color:var(--main-color) | |
| } | |
| .placeholderLine-86Fsd9,.placeholderMedia-34JHvE,.reaction-BL6n45{ | |
| background-color:rgba(255,255,255,.15) | |
| } | |
| .standardSidebarView-E9Pc3j>.contentRegion-3HkfJJ{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .contentRegion-3HkfJJ .contentRegionScroller-2_GT_N,.contentRegion-3HkfJJ .scroller-3_YDR2{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .theme-dark .closeButton-PCZcma{ | |
| border-color:rgba(255,255,255,.4) | |
| } | |
| .theme-dark .closeButton-PCZcma:hover{ | |
| border-color:rgba(255,255,255,.6); | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .closeButton-PCZcma>svg>path{ | |
| fill:rgba(255,255,255,.6) | |
| } | |
| .theme-dark .keybind-13vtq8{ | |
| color:rgba(255,255,255,.6) | |
| } | |
| .container-20TyK0{ | |
| background-color:rgba(0,0,0,.8) !important | |
| } | |
| .imageUploaderInner-IIRaFr{ | |
| background-color:rgba(255,255,255,.05) | |
| } | |
| .theme-dark .imageUploaderIcon-2OHmFu{ | |
| background-color:var(--main-color); | |
| background-image:none | |
| } | |
| .theme-dark .imageUploaderIcon-2OHmFu:after{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| left:0; | |
| bottom:0; | |
| background-image:url(https://discord.com/assets/d5c25e76af04cea8997e4a060572feae.svg); | |
| background-repeat:no-repeat; | |
| background-position:50%; | |
| filter:brightness(0) invert(1); | |
| pointer-events:none | |
| } | |
| .theme-dark .card-2guEcY:not(.outline-3kFzf8),.theme-dark .outline-3kFzf8.card-2guEcY{ | |
| background-color:rgba(0,0,0,.4); | |
| border-color:rgba(255,255,255,.07) | |
| } | |
| .theme-dark .card-2guEcY a{ | |
| color:var(--url-color) | |
| } | |
| .cardWrapper-1bSePP{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .customColorPicker-C_jddW{ | |
| background-color:rgba(0,0,0,.8); | |
| border-color:rgba(0,0,0,0); | |
| border-radius:5px | |
| } | |
| [style*=transform].app-2CXKsg{ | |
| transform:none !important | |
| } | |
| [style*=transform].app-2CXKsg .bg-1QIAus{ | |
| animation:cv-shake .5s ease-in | |
| } | |
| .lookFilled-GPyucw.select-Zz0IcO{ | |
| background-color:rgba(255,255,255,.07); | |
| border-color:rgba(255,255,255,.09) | |
| } | |
| .popout-15UxD6{ | |
| background-color:rgba(0,0,0,.8); | |
| border:none; | |
| border-radius:5px; | |
| box-shadow:0 0 10px rgba(0,0,0,.5) | |
| } | |
| .option-Uc12mm:hover,.option-Uc12mm:focus,.option-Uc12mm.focused-10mbp-{ | |
| background-color:rgba(255,255,255,.05); | |
| border:rgba(255,255,255,.07) | |
| } | |
| .option-Uc12mm[aria-selected=true]:not(.option-Uc12mm.multi-2vPqc4){ | |
| background-color:var(--main-color) | |
| } | |
| .option-Uc12mm[aria-selected=true]:not(.option-Uc12mm.multi-2vPqc4) .selectedIcon-122rMx circle{ | |
| fill:var(--main-color) | |
| } | |
| .option-Uc12mm[aria-selected=true]:not(.option-Uc12mm.multi-2vPqc4) path{ | |
| fill:#fff | |
| } | |
| .input-3O04eu{ | |
| color:var(--text-normal); | |
| background-color:rgba(255,255,255,.07); | |
| border:none; | |
| box-shadow:0 0 0 2px rgba(255,255,255,.09) | |
| } | |
| .input-3O04eu:focus{ | |
| box-shadow:0 0 2px 2px var(--main-color) | |
| } | |
| .sidebar-nqHbhN .item-2GWPIy:before{ | |
| content:""; | |
| position:absolute; | |
| width:0; | |
| height:24px; | |
| left:15px; | |
| margin-top:-2px; | |
| z-index:999; | |
| transition:all .15s ease-in-out | |
| } | |
| .sidebar-nqHbhN .item-2GWPIy.selected-1sf9UK{ | |
| padding-left:50px !important | |
| } | |
| .sidebar-nqHbhN .item-2GWPIy.selected-1sf9UK:before{ | |
| width:24px | |
| } | |
| .sidebar-nqHbhN [aria-controls=my-account-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/person.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=profile-customization-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/user_profile.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls="privacy-&-safety-tab"].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/security.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=authorized-apps-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/apps.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=sessions-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/devices.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=connections-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/link.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=friend-requests-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/person_add.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=discord-nitro-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/nitro.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=nitro-server-boost-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/server_boost.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=subscriptions-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/subscriptions.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=library-inventory-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/gift.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=billing-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/payment.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=appearance-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/camera.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=accessibility-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/accessibility.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls="voice-&-video-tab"].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/mic.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls="text-&-images-tab"].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/chat.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=notifications-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/notifications.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=keybinds-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/keyboard.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=language-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/language.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=windows-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/windows.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=linux-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/linux.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=streamer-mode-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/videocam.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=advanced-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/bug.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=activity-privacy-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/controller-off.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=game-activity-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/games.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=overlay-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/aspect_ratio.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=changelog-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/history.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=hypesquad-online-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/hypesquad.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=overview-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/info.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=roles-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/flag.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=emoji-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/emoji.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=stickers-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/sticker.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=moderation-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/security.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=guild_automod-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/robot.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=audit_log-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/list.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=integrations-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/puzzle.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=widget-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/widgets.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=guild_templates-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/website.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=vanity_url-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/link_plus.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=community-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/people.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=analytics-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/insights.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=partner-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/handshake.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=discovery-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/explore.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=member_verification-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/person_search.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=community_welcome-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/waving_hand.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=guild_premium-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/server_boost.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=members-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/group.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=instant_invites-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/person_add.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=bans-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/hammer.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=permissions-tab].item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/rule.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=logout-tab].item-2GWPIy:before{ | |
| -webkit-mask:url(https://clearvision.github.io/icons/exit.svg); | |
| mask:url(https://clearvision.github.io/icons/exit.svg) | |
| } | |
| .sidebar-nqHbhN [aria-controls=delete-tab].item-2GWPIy:before{ | |
| -webkit-mask:url(https://clearvision.github.io/icons/delete.svg); | |
| mask:url(https://clearvision.github.io/icons/delete.svg) | |
| } | |
| .premiumLabel-3HPvdB>svg,.tabBarItemContainer-2HdIlr>svg,.icon-3FU6Ir,.side-2ur1Qk .textBadge-1fdDPJ{ | |
| margin-right:15px | |
| } | |
| .guildFeatureAvailabilityIndicator-34eQAP{ | |
| background-color:var(--main-color) | |
| } | |
| .container-3EtAkD{ | |
| background-color:var(--main-color); | |
| color:#fff | |
| } | |
| .container-3EtAkD:hover{ | |
| background-color:var(--hover-color) | |
| } | |
| .icon-2DGsye{ | |
| background-color:rgba(0,0,0,.6) | |
| } | |
| .roleRow-230vCm:before,.roleRow-230vCm:last-child:after{ | |
| background-color:rgba(255,255,255,.1) | |
| } | |
| .roleRow-230vCm:hover:not(.roleRowDisableHover-3En0vy){ | |
| background-color:rgba(255,255,255,.05) | |
| } | |
| .button-1_oXub{ | |
| background-color:rgba(0,0,0,.6); | |
| color:#fff | |
| } | |
| .button-1_oXub:hover:not(.disabled-184-il){ | |
| background-color:var(--hover-color); | |
| color:#fff | |
| } | |
| .roleRow-230vCm:hover:not(.roleRowDisableHover-3En0vy) .button-1_oXub{ | |
| background-color:rgba(0,0,0,.6); | |
| color:#fff | |
| } | |
| .roleRow-230vCm:hover:not(.roleRowDisableHover-3En0vy) .button-1_oXub:hover{ | |
| background-color:var(--hover-color); | |
| color:#fff | |
| } | |
| .titleContainer-3fPic2{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .header-JUTO-g{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .header-JUTO-g:before{ | |
| content:""; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| position:absolute; | |
| z-index:-1; | |
| background:var(--background-image) var(--background-position)/var(--background-size) var(--background-repeat) var(--background-attachment); | |
| filter:grayscale(var(--background-grayscale)) sepia(var(--background-sepia)) invert(var(--background-invert)) brightness(var(--background-brightness)) contrast(var(--background-contrast)) saturate(var(--background-saturation)) blur(var(--background-blur)) | |
| } | |
| .header-JUTO-g:after{ | |
| content:""; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| position:absolute; | |
| z-index:-1; | |
| background:var(--background-overlay) | |
| } | |
| .top-Ktfr_T .brand-2EKq3J.item-2GWPIy:hover{ | |
| border-bottom-color:var(--hover-color) | |
| } | |
| .top-Ktfr_T .brand-2EKq3J.item-2GWPIy.selected-1sf9UK,.top-Ktfr_T .brand-2EKq3J.item-2GWPIy:active{ | |
| border-bottom-color:var(--main-color) | |
| } | |
| .side-1lrxIh .themed-2-lozF.item-2GWPIy:hover:not(.disabled-2G98Nl){ | |
| background-color:rgba(255,255,255,.07) | |
| } | |
| .side-1lrxIh .themed-2-lozF.item-2GWPIy.selected-1sf9UK{ | |
| background-color:rgba(255,255,255,.1) | |
| } | |
| .side-1lrxIh .themed-2-lozF.item-2GWPIy.selected-1sf9UK .roleCircle-3TFUOr::before{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:0; | |
| bottom:0; | |
| left:0; | |
| z-index:-1; | |
| background-color:inherit; | |
| opacity:.2; | |
| border-radius:4px; | |
| transition:all .1 ease-in-out | |
| } | |
| .previewContainer-1GxmBJ{ | |
| background-color:rgba(0,0,0,.6) | |
| } | |
| .container-3ssFyj{ | |
| background-color:rgba(0,0,0,.8) | |
| } | |
| .container-2oNtJn{ | |
| background-color:rgba(255,255,255,.07) | |
| } | |
| .wrapper-24fR1R{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .tierLock-1eabw6{ | |
| color:#fff; | |
| opacity:.3 | |
| } | |
| .clickableContainer-3YtEIY{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .textBadge-v9EW9y{ | |
| border:none; | |
| padding:4px 6px | |
| } | |
| .editCard-K9Q9mb{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .editCard-K9Q9mb.active-Xi2rnV,.editCard-K9Q9mb.active-Xi2rnV.toggled-35JcVc{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .ruleIconContainer-dXW56-{ | |
| background-color:rgba(255,255,255,.1) | |
| } | |
| .ruleIcon-jIriNN{ | |
| color:#fff | |
| } | |
| .actionContainer-EzNGrb{ | |
| background-color:rgba(255,255,255,.1) | |
| } | |
| .actionIcon-2VtFPq,.actionTextHeader-yeCKjC{ | |
| color:rgba(255,255,255,.9) !important | |
| } | |
| .stepCountIcon-1A2Rxd{ | |
| background-color:rgba(255,255,255,.1) | |
| } | |
| .keywordListContainer-9ux8nU,.actionContainer-2krsiT{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .keywordsTextArea-3QkFoG{ | |
| color:var(--text-normal); | |
| background-color:rgba(255,255,255,.07); | |
| border:none; | |
| box-shadow:0 0 0 2px rgba(255,255,255,.09) | |
| } | |
| .keywordsTextArea-3QkFoG:focus{ | |
| box-shadow:0 0 2px 2px var(--main-color) | |
| } | |
| .keywordsTextArea-3QkFoG::placeholder{ | |
| color:rgba(255,255,255,.3) | |
| } | |
| .resultsList-2d3x5p{ | |
| background-color:rgba(0,0,0,.8); | |
| border:1px solid rgba(255,255,255,.07); | |
| box-shadow:0 0 10px rgba(0,0,0,.5) | |
| } | |
| .channelRowLabel-3fw5wf,.roleLabel-1ML0Dw{ | |
| background-color:rgba(255,255,255,.1) | |
| } | |
| .channelIcon-36DzP5{ | |
| color:#fff | |
| } | |
| .theme-dark .auditLog-1NVAY0{ | |
| border-color:rgba(255,255,255,.07) | |
| } | |
| .theme-dark .headerClickable-zGQJz3,.theme-dark .headerDefault-1e6yjj{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .theme-dark .headerExpanded-1-zwDr,.theme-dark .divider-M3saWq,.theme-dark .changeDetails-1kMZqI{ | |
| background-color:rgba(0,0,0,.7) | |
| } | |
| .selectedBrand-1AtwYE{ | |
| background-color:var(--main-color) | |
| } | |
| .descriptionBox-SKGNgB{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .upsellContainer-2a5eMP{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .upsellFooter-3M1V33{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .analyticsCard-2fnrVG{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .developerPortalCtaWrapper-2PniQs{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .notEnoughMembersError-3-VD0N{ | |
| background-color:var(--info-warning-background) | |
| } | |
| .memberInsightsContainer-3TdlTJ{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .insightsActions-3cTXpa{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .guildDetails-1il1dn{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .featureCard-1RR4Tl,.featureIcon-2sTnDK{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .checkboxWrapper-2fDzaA.row-31nALW.checked-1pZh2h{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .checkboxWrapper-2fDzaA.row-31nALW{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .checklistContainer-12xGp5{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .checklistContainer-12xGp5 .checklistHeader-3liG7E{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .checklistContainer-12xGp5 .separator-2qVfIV{ | |
| background-color:rgba(255,255,255,.06); | |
| opacity:1 | |
| } | |
| .featureCard-3XHbjy{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .checklist-Asy_56{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .checklist-Asy_56 .header-Wl8ec-{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .checklist-Asy_56 .separator-1py8Bj{ | |
| background-color:rgba(255,255,255,.06) | |
| } | |
| .exampleContainer-2O-nVK,.exampleModal-1lRfuE{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .guildSidebar-pjuGkm,.content-pHpkq8,.formFieldWrapper-2LV3S6,.theme-dark .footer-11k_3m{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .fakeButton-3RWbMY{ | |
| background-color:var(--main-color) | |
| } | |
| .enableContainer-H2cRts,.previewContainer-29oeA6{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .editCircle-2aQAUC{ | |
| background-color:var(--main-color); | |
| color:#fff | |
| } | |
| .welcomeChannel-_Q4qAA{ | |
| background-color:rgba(255,255,255,.05) | |
| } | |
| .channelIcon-2N5-5h{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .background-3xJH_4{ | |
| color:rgba(0,0,0,.4) | |
| } | |
| .theme-dark .tierInProgress-1vFUnw{ | |
| background-color:rgba(0,0,0,.4); | |
| border:3px solid #f47fff | |
| } | |
| .theme-dark .tierHeaderLocked-30MLlO,.theme-dark .tierHeaderUnlocked-1OpOLf,.theme-dark .tierBody-1d3UiS{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .searchBar-3joS_I{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .theme-dark .popoutList-10IFAa{ | |
| background-color:rgba(0,0,0,.4); | |
| box-shadow:0 0 0 1px rgba(255,255,255,.07) | |
| } | |
| .theme-dark .popoutList-10IFAa .selectableItem-3-fmiM.selected-1l_Bxn[style*="background: rgb(114, 137, 218)"]{ | |
| background-color:var(--main-color) !important | |
| } | |
| .theme-dark .popoutListInput-1w4TxY{ | |
| background-color:rgba(255,255,255,.05) | |
| } | |
| .searchBar-30dqPB{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .css-rzbxvl-option{ | |
| background:var(--hover-color) | |
| } | |
| .css-rzbxvl-option:hover{ | |
| background:var(--hover-color) | |
| } | |
| .css-3vaxre-menu{ | |
| background-color:rgba(0,0,0,.5); | |
| border:rgba(255,255,255,.07) | |
| } | |
| .standardSidebarView-E9Pc3j .sidebarRegion-1VBisG{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .standardSidebarView-E9Pc3j .sidebarRegion-1VBisG .sidebar-nqHbhN{ | |
| height:100%; | |
| width:260px; | |
| padding:0px 6px 0px 20px | |
| } | |
| .sidebarRegion-1VBisG .sidebarRegionScroller-FXiQOh{ | |
| margin:30px 8px 30px 0; | |
| background:rgba(0,0,0,0); | |
| -webkit-mask-image:linear-gradient(to bottom, transparent, #000 5%, #000 95%, transparent); | |
| mask-image:linear-gradient(to bottom, transparent, #000 5%, #000 95%, transparent) | |
| } | |
| .sidebarRegion-1VBisG .sidebarRegionScroller-FXiQOh::-webkit-scrollbar{ | |
| width:0 !important | |
| } | |
| .side-1lrxIh{ | |
| padding:30px 0 | |
| } | |
| .side-1lrxIh .header-2F5_LB{ | |
| color:var(--main-color); | |
| font-weight:700 | |
| } | |
| .side-1lrxIh .separator-2N511j{ | |
| background:rgba(255,255,255,.07) | |
| } | |
| .sidebar-nqHbhN .header-2F5_LB{ | |
| padding-top:20px; | |
| display:flex; | |
| align-items:center; | |
| justify-content:center | |
| } | |
| .sidebar-nqHbhN .header-2F5_LB:before{ | |
| content:""; | |
| height:2px; | |
| flex-grow:1; | |
| background:linear-gradient(to left, var(--main-color) 50%, transparent); | |
| margin-right:5px | |
| } | |
| .sidebar-nqHbhN .header-2F5_LB:after{ | |
| content:""; | |
| height:2px; | |
| flex-grow:1; | |
| background:linear-gradient(to right, var(--main-color) 50%, transparent); | |
| margin-left:5px | |
| } | |
| .sidebar-nqHbhN .header-2F5_LB>span{ | |
| max-width:100%; | |
| overflow:hidden; | |
| text-overflow:ellipsis | |
| } | |
| .sidebar-nqHbhN .item-2GWPIy:nth-child(6)+.separator-2N511j,.sidebar-nqHbhN .item-2GWPIy:nth-child(13)+.separator-2N511j,.sidebar-nqHbhN .item-2GWPIy:nth-child(25)+.separator-2N511j{ | |
| display:none | |
| } | |
| .standardSidebarView-E9Pc3j .sidebar-nqHbhN .side-1lrxIh .item-2GWPIy{ | |
| position:relative; | |
| padding:8px 0 8px 20px; | |
| color:rgba(255,255,255,.4); | |
| margin:0; | |
| background:rgba(0,0,0,0); | |
| transition:all .15s ease-in-out; | |
| cursor:pointer | |
| } | |
| .standardSidebarView-E9Pc3j .sidebar-nqHbhN .side-1lrxIh .item-2GWPIy:before{ | |
| opacity:.4; | |
| transition:inherit | |
| } | |
| .standardSidebarView-E9Pc3j .sidebar-nqHbhN .side-1lrxIh .item-2GWPIy:after{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:100%; | |
| bottom:0; | |
| left:0; | |
| opacity:.9; | |
| transition:all .3s ease-in-out; | |
| z-index:-1; | |
| pointer-events:none; | |
| border-radius:4px | |
| } | |
| .standardSidebarView-E9Pc3j .sidebar-nqHbhN .side-1lrxIh .item-2GWPIy:hover{ | |
| background:rgba(255,255,255,.07); | |
| color:rgba(255,255,255,.7) | |
| } | |
| .standardSidebarView-E9Pc3j .sidebar-nqHbhN .side-1lrxIh .item-2GWPIy:hover:before{ | |
| opacity:.7 | |
| } | |
| .standardSidebarView-E9Pc3j .sidebar-nqHbhN .side-1lrxIh .item-2GWPIy.selected-1sf9UK:before{ | |
| opacity:1 | |
| } | |
| .standardSidebarView-E9Pc3j .sidebar-nqHbhN .side-1lrxIh .item-2GWPIy.selected-1sf9UK:after{ | |
| right:0; | |
| background:var(--main-color); | |
| animation:cv-channel-select .3s ease-in-out | |
| } | |
| .standardSidebarView-E9Pc3j .sidebar-nqHbhN .side-1lrxIh .item-2GWPIy.selected-1sf9UK{ | |
| background:rgba(0,0,0,0); | |
| color:#fff; | |
| transition:all .15s ease-in-out,background .3s .2s | |
| } | |
| .standardSidebarView-E9Pc3j .sidebar-nqHbhN .side-1lrxIh .item-2GWPIy.selected-1sf9UK .selectedBackground-1t6xXq{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .standardSidebarView-E9Pc3j .sidebar-nqHbhN .side-1lrxIh [aria-controls=logout-tab].item-2GWPIy,.standardSidebarView-E9Pc3j .sidebar-nqHbhN .side-1lrxIh [aria-controls=delete-tab].item-2GWPIy{ | |
| color:var(--danger-color) | |
| } | |
| .standardSidebarView-E9Pc3j .sidebar-nqHbhN .side-1lrxIh [aria-controls=logout-tab].item-2GWPIy:hover,.standardSidebarView-E9Pc3j .sidebar-nqHbhN .side-1lrxIh [aria-controls=delete-tab].item-2GWPIy:hover{ | |
| background-color:var(--danger-color); | |
| color:#fff | |
| } | |
| .standardSidebarView-E9Pc3j .sidebar-nqHbhN .side-1lrxIh [aria-controls=logout-tab].item-2GWPIy:before,.standardSidebarView-E9Pc3j .sidebar-nqHbhN .side-1lrxIh [aria-controls=delete-tab].item-2GWPIy:before{ | |
| background-color:var(--danger-color); | |
| opacity:1 | |
| } | |
| .standardSidebarView-E9Pc3j .sidebar-nqHbhN .side-1lrxIh [aria-controls=logout-tab].item-2GWPIy:hover:before,.standardSidebarView-E9Pc3j .sidebar-nqHbhN .side-1lrxIh [aria-controls=delete-tab].item-2GWPIy:hover:before{ | |
| background-color:#fff; | |
| opacity:1 | |
| } | |
| .socialLinks-3ywLUf .link-1-SDSV{ | |
| color:rgba(255,255,255,.4) | |
| } | |
| .socialLinks-3ywLUf .link-1-SDSV:hover{ | |
| color:rgba(255,255,255,.7) | |
| } | |
| .accountProfileCard-lbN7n-{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .background-3d_SjE,.fieldList-in8WkP{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .avatar-3mTjvZ{ | |
| background:rgba(0,0,0,0); | |
| border-color:rgba(0,0,0,0) | |
| } | |
| .profileBannerPreview-3mLIdO{ | |
| background-color:var(--user-popout-overlay) | |
| } | |
| .avatarUploaderInner-p38nm2{ | |
| border:6px solid rgba(0,0,0,0); | |
| background-clip:padding-box | |
| } | |
| .optionBox-1UOevl{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .contentCircle-15IFyT{ | |
| background-color:var(--main-color) | |
| } | |
| .notice-1Qe0b_{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .editingContainer-1_nnqZ{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .premiumFeatureBorder-1i95si{ | |
| background:rgba(0,0,0,.4); | |
| border-color:#ff73fa | |
| } | |
| .premiumBackground-34OIdE{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .upsellOverlayContainer-3NMgTS{ | |
| background:rgba(0,0,0,.4); | |
| border-color:#ff73fa | |
| } | |
| .theme-dark .upsellOverlay-3sCO8V,.upsellContainer-TwfTaF{ | |
| background:rgba(0,0,0,.4) | |
| } | |
| .profileThemeSectionPremiumBorder-pH_ioT{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .inlineUpsell-3zPTgw{ | |
| background:rgba(0,0,0,.5) | |
| } | |
| .authedApp-1tw-eT{ | |
| background-color:rgba(0,0,0,.4); | |
| border-color:rgba(255,255,255,.07) | |
| } | |
| .sessionIcon-2fwSzb{ | |
| background-color:var(--main-color); | |
| color:#fff | |
| } | |
| .connectContainer-1hylYM{ | |
| background-color:rgba(0,0,0,.4); | |
| border-color:rgba(255,255,255,.07) | |
| } | |
| .accountButtonInner-33vCDY,.accountBtnInner-1DCgBm{ | |
| background-color:rgba(255,255,255,.05) | |
| } | |
| .accountButtonInner-33vCDY:hover,.accountBtnInner-1DCgBm:hover{ | |
| background-color:rgba(255,255,255,.07) | |
| } | |
| .theme-dark .defaultIndicator-2ndWks{ | |
| background-color:var(--main-color) | |
| } | |
| .theme-dark .paymentPane-ut5qKZ,.theme-dark .paginator-1eqD2g{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .bottomDivider-ZmTm-j{ | |
| border-color:rgba(0,0,0,.07) | |
| } | |
| .theme-dark .hoverablePayment-lE1s4t:hover{ | |
| background-color:rgba(255,255,255,.05) | |
| } | |
| .theme-dark .payment-2bOh4k{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .payment-2bOh4k:not(.hoverablePayment-lE1s4t){ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .theme-dark .expandedInfo-1W31i3{ | |
| background-color:rgba(0,0,0,0); | |
| box-shadow:0 0 2px 2px var(--main-color) | |
| } | |
| .theme-dark .codeRedemptionRedirect-3SBiCp{ | |
| background-color:rgba(0,0,0,.4); | |
| border-color:rgba(255,255,255,.07) | |
| } | |
| .bigPerkCard-1uwmWV,.smallPerkCard-2sX_--{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .theme-dark .noItemsIcon-1rZlXZ,.theme-dark .noItemsIcon-2OeOld{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .noItemsIcon-1rZlXZ>g>*,.theme-dark .noItemsIcon-2OeOld>g>*{ | |
| fill-opacity:.8 !important; | |
| stroke-opacity:.8 !important | |
| } | |
| .noItemsCard-2V85P5,.noItemsCard-5EOcCl{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .scroller-29cQFV{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .detailsBlock-24pLFz,.banner-WELp4M{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .promotionCard-mo7ClH{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .copyInput-3AbKWB{ | |
| background-color:rgba(255,255,255,.07) | |
| } | |
| .cardWrapper-CyvwQv{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .gemIndicatorContainer-PqApbX{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .guildSubscriptionSlots-1i_C21{ | |
| background-color:rgba(0,0,0,.4) | |
| } | |
| .previewMessage-2g_aBv{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .micTest-19EtdQ .container-3NTP7o{ | |
| background:var(--main-color) !important; | |
| -webkit-mask-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' width='8' height='20' fill='yellow'%3E%3Cpath fill-rule='evenodd' d='M 4 2 C 2.895 2 2 2.895 2 4 L 2 16 C 2 17.54 3.667 18.502 5 17.732 C 5.619 17.375 6 16.715 6 16 L 6 4 C 6 2.895 5.105 2 4 2 Z'/%3E%3C/svg%3E") | |
| } | |
| .theme-dark .micTest-19EtdQ .progress-1S-TDF{ | |
| background-color:rgba(0,0,0,.7) | |
| } | |
| .theme-dark .micTest-19EtdQ .notches-2w7UZJ rect{ | |
| fill:none | |
| } | |
| .cameraWrapper-nG8dpo{ | |
| background-color:rgba(0,0,0,.7); | |
| border-color:rgba(255,255,255,.07) | |
| } | |
| .backgroundOption-2mIYjm{ | |
| background-color:rgba(0,0,0,.7) | |
| } | |
| .backgroundOptionRing-1vvQ0C{ | |
| border:2px solid var(--main-color) | |
| } | |
| .backgroundOptionInner-SSz19O{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .nowPlaying-3UpuKc{ | |
| background-color:rgba(67,181,129,.6) | |
| } | |
| .wrapper-SdcMKg{ | |
| border-color:var(--main-color) | |
| } | |
| .option-1QI4c9{ | |
| background-color:rgba(255,255,255,.05); | |
| opacity:1 | |
| } | |
| .option-1QI4c9:hover{ | |
| background-color:rgba(255,255,255,.07); | |
| opacity:1 | |
| } | |
| .option-1QI4c9.selected-18Wszc{ | |
| background-color:var(--main-color); | |
| border-color:var(--main-color) | |
| } | |
| .theme-dark .container-30qY7E{ | |
| background-color:rgba(255,255,255,.05); | |
| box-shadow:0 0 0 2px rgba(255,255,255,.07); | |
| border-color:rgba(0,0,0,0) | |
| } | |
| .theme-dark .container-30qY7E:not(.disabled-3S7pz8):hover{ | |
| border-color:rgba(0,0,0,0); | |
| box-shadow:0 0 2px 2px var(--main-color) | |
| } | |
| .theme-dark .container-30qY7E.recording-3ny5_E{ | |
| color:#fff; | |
| box-shadow:0 0 2px 2px var(--main-color); | |
| animation:cv-shadow-pulse 1s ease-in infinite | |
| } | |
| .theme-dark .notDetected-M3Ghh2{ | |
| background-color:rgba(0,0,0,.4); | |
| border:rgba(255,255,255,.07) | |
| } | |
| .theme-dark .addGamePopout-2SKNIV{ | |
| background-color:rgba(0,0,0,.7) | |
| } | |
| .theme-dark .game-2f2vPC{ | |
| box-shadow:0 1px 0 0 rgba(255,255,255,.04) | |
| } | |
| .theme-dark .gameNameInput-2wbDJ9:hover,.theme-dark .gameNameInput-2wbDJ9:focus{ | |
| background-color:rgba(255,255,255,.05); | |
| border:rgba(255,255,255,.07) | |
| } | |
| .activityUserPopout-2MzGCj .nameNormal-2fPMD2,.activityProfile-1712BN .nameNormal-2fPMD2{ | |
| color:var(--main-color); | |
| text-shadow:0 0 5px rgba(0,0,0,.5); | |
| font-weight:600 | |
| } | |
| .activityUserPopout-2MzGCj .nameNormal-2fPMD2>.activityName-3YXl6e,.activityProfile-1712BN .nameNormal-2fPMD2>.activityName-3YXl6e{ | |
| color:inherit | |
| } | |
| .activityUserPopout-2MzGCj .nameNormal-2fPMD2>.activityName-3YXl6e.bodyLink-1E-g-R:hover,.activityProfile-1712BN .nameNormal-2fPMD2>.activityName-3YXl6e.bodyLink-1E-g-R:hover{ | |
| text-shadow:0 0 5px rgba(0,0,0,.5),0 0 1px | |
| } | |
| .activityUserPopout-2MzGCj .nameNormal-2fPMD2>.activityName-3YXl6e.textHover-3f_j3D,.activityProfile-1712BN .nameNormal-2fPMD2>.activityName-3YXl6e.textHover-3f_j3D{ | |
| transition:all .1s ease-in-out | |
| } | |
| .activityUserPopout-2MzGCj .nameNormal-2fPMD2>.activityName-3YXl6e.textHover-3f_j3D:hover,.activityProfile-1712BN .nameNormal-2fPMD2>.activityName-3YXl6e.textHover-3f_j3D:hover{ | |
| text-shadow:0 0 5px rgba(0,0,0,.5),0 0 1px; | |
| text-decoration:none | |
| } | |
| .activityUserPopout-2MzGCj .timestamp-2f1NmH,.activityProfile-1712BN .timestamp-2f1NmH{ | |
| font-style:italic | |
| } | |
| .activityUserPopout-2MzGCj .bodyLink-1E-g-R,.activityProfile-1712BN .bodyLink-1E-g-R{ | |
| transition:all .1s ease-in-out | |
| } | |
| .activityUserPopout-2MzGCj .bodyLink-1E-g-R:hover,.activityProfile-1712BN .bodyLink-1E-g-R:hover{ | |
| text-shadow:0 0 1px; | |
| text-decoration:none !important | |
| } | |
| .mask-1y0tyc{ | |
| filter:drop-shadow(0 0 5px rgba(0, 0, 0, 0.5)) | |
| } | |
| .botTag-7aX5WZ{ | |
| padding:1px 2px; | |
| background:rgba(255,255,255,.1); | |
| color:rgba(255,255,255,.6); | |
| font-weight:700; | |
| text-shadow:0 0 1px rgba(0,0,0,.3); | |
| border-radius:3px | |
| } | |
| .botTagInvert-1nKcq_{ | |
| padding:2px 3px; | |
| background:rgba(0,0,0,.3); | |
| color:rgba(255,255,255,.8) | |
| } | |
| .member-2gU6Ar .botTag-7aX5WZ{ | |
| transition:all .15s ease-in-out | |
| } | |
| .roles-3zC7MX .role-2TIOKu,.roleWrapper-2IhvNd .role-2TIOKu{ | |
| position:relative; | |
| display:flex; | |
| flex-direction:row-reverse; | |
| border-radius:3px; | |
| transition:all .1s ease-in-out; | |
| background:rgba(0,0,0,0); | |
| cursor:default | |
| } | |
| .roles-3zC7MX [style].role-2TIOKu:not(:hover),.roleWrapper-2IhvNd [style].role-2TIOKu:not(:hover){ | |
| border-color:rgba(0,0,0,0) !important | |
| } | |
| .roles-3zC7MX .role-2TIOKu:not([style]),.roleWrapper-2IhvNd .role-2TIOKu:not([style]){ | |
| background:rgba(255,255,255,.1); | |
| border-color:rgba(0,0,0,0) | |
| } | |
| .roles-3zC7MX .role-2TIOKu>.roleName-2ZJJYR,.roleWrapper-2IhvNd .role-2TIOKu>.roleName-2ZJJYR{ | |
| margin-right:0; | |
| margin-left:4px; | |
| color:rgba(255,255,255,.9); | |
| transition:all .1s ease-in-out | |
| } | |
| .roles-3zC7MX .role-2TIOKu:hover .roleCircle-3TFUOr:before,.roleWrapper-2IhvNd .role-2TIOKu:hover .roleCircle-3TFUOr:before{ | |
| opacity:.3 | |
| } | |
| .roles-3zC7MX .role-2TIOKu:hover>.roleName-2ZJJYR,.roleWrapper-2IhvNd .role-2TIOKu:hover>.roleName-2ZJJYR{ | |
| color:#fff | |
| } | |
| .roles-3zC7MX .roleRemoveButton-17oXnT,.roleWrapper-2IhvNd .roleRemoveButton-17oXnT{ | |
| position:static | |
| } | |
| .roles-3zC7MX .roleRemoveIcon-387wKV>path,.roleWrapper-2IhvNd .roleRemoveIcon-387wKV>path{ | |
| margin-left:2px; | |
| fill:#fff | |
| } | |
| .roles-3zC7MX .roleRemoveIcon-387wKV,.roleWrapper-2IhvNd .roleRemoveIcon-387wKV{ | |
| left:calc(100% - 7px) | |
| } | |
| .roles-3zC7MX .roleCircle-3TFUOr,.roleWrapper-2IhvNd .roleCircle-3TFUOr{ | |
| width:0; | |
| height:0 | |
| } | |
| .roles-3zC7MX .roleCircle-3TFUOr:not(:empty),.roleWrapper-2IhvNd .roleCircle-3TFUOr:not(:empty){ | |
| margin-left:6px | |
| } | |
| .roles-3zC7MX .roleCircle-3TFUOr:before,.roleWrapper-2IhvNd .roleCircle-3TFUOr:before{ | |
| content:""; | |
| border-radius:3px; | |
| position:absolute; | |
| top:-1px; | |
| right:-1px; | |
| bottom:-1px; | |
| left:-1px; | |
| background:inherit; | |
| opacity:.2; | |
| transition:all .1s ease-in-out; | |
| pointer-events:none | |
| } | |
| .roles-3zC7MX .addButton-1_dZYu,.roleWrapper-2IhvNd .addButton-1_dZYu{ | |
| background:rgba(255,255,255,.1); | |
| transition:all .1s ease-in-out; | |
| cursor:pointer | |
| } | |
| .roles-3zC7MX .addButton-1_dZYu>svg,.roleWrapper-2IhvNd .addButton-1_dZYu>svg{ | |
| width:7px; | |
| height:7px; | |
| color:rgba(255,255,255,.5); | |
| transition:inherit | |
| } | |
| .roles-3zC7MX .addButton-1_dZYu:hover,.roleWrapper-2IhvNd .addButton-1_dZYu:hover{ | |
| background:rgba(255,255,255,.2) | |
| } | |
| .roles-3zC7MX .addButton-1_dZYu:hover>svg,.roleWrapper-2IhvNd .addButton-1_dZYu:hover>svg{ | |
| color:#fff | |
| } | |
| .row-1Ib2uD.selected-1IWCoj .rowInner-3uonq8{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .row-1Ib2uD:hover .rowInner-3uonq8{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| .container-2O1UgZ{ | |
| background-color:rgba(0,0,0,.8); | |
| border:none | |
| } | |
| .mask-1y0tyc rect[mask="url(#svg-mask-status-online)"],.mask-1y0tyc rect[mask="url(#svg-mask-status-online-mobile)"],.mask-2Me5HY rect[mask="url(#svg-mask-status-online)"],.mask-2Me5HY rect[mask="url(#svg-mask-status-online-mobile)"]{ | |
| fill:var(--online-color) | |
| } | |
| .mask-1y0tyc rect[mask="url(#svg-mask-status-idle)"],.mask-2Me5HY rect[mask="url(#svg-mask-status-idle)"]{ | |
| fill:var(--idle-color) | |
| } | |
| .mask-1y0tyc rect[mask="url(#svg-mask-status-dnd)"],.mask-2Me5HY rect[mask="url(#svg-mask-status-dnd)"]{ | |
| fill:var(--dnd-color) | |
| } | |
| .mask-1y0tyc rect[mask="url(#svg-mask-status-streaming)"],.mask-2Me5HY rect[mask="url(#svg-mask-status-streaming)"]{ | |
| fill:var(--streaming-color) | |
| } | |
| .mask-1y0tyc rect[mask="url(#svg-mask-status-offline)"],.mask-2Me5HY rect[mask="url(#svg-mask-status-offline)"]{ | |
| fill:var(--offline-color) | |
| } | |
| .bd-select,.bd-select.menu-open{ | |
| background-color:rgba(0,0,0,.5) | |
| } | |
| .bd-switch input:checked+.bd-switch-body{ | |
| --switch-color: var(--main-color) | |
| } | |
| #bd-customcss-detach-container{ | |
| background-color:rgba(0,0,0,0) | |
| } | |
| #bd-editor-controls{ | |
| background:var(--background-overlay) | |
| } | |
| #bda-qem{ | |
| background-color:rgba(0,0,0,.5); | |
| border:none !important | |
| } | |
| #bda-qem~.emojiPicker-6YCk8a{ | |
| border-radius:0 0 5px 5px | |
| } | |
| #bda-qem>button{ | |
| border-color:rgba(0,0,0,0); | |
| box-shadow:none; | |
| color:rgba(255,255,255,.7); | |
| transition:all .15s ease-in-out | |
| } | |
| #bda-qem>button:hover{ | |
| background-color:rgba(255,255,255,.07) | |
| } | |
| #bda-qem>#bda-qem-twitch.active,#bda-qem>#bda-qem-favourite.active,#bda-qem>#bda-qem-emojis.active{ | |
| background-color:var(--main-color); | |
| color:#fff | |
| } | |
| #bda-qem-twitch-container,#bda-qem-favourite-container{ | |
| height:326px; | |
| width:344px; | |
| background-color:rgba(0,0,0,.5); | |
| border-radius:0 0 5px 5px; | |
| box-shadow:0 0 10px rgba(0,0,0,.5) | |
| } | |
| .emote-container{ | |
| border-radius:3px; | |
| transition:all .15s ease-in-out | |
| } | |
| .emote-container:hover{ | |
| background-color:rgba(255,255,255,.07) | |
| } | |
| .bd-emote-header{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .bd-emote-item:hover{ | |
| background:var(--hover-color); | |
| cursor:pointer | |
| } | |
| .sidebar-nqHbhN .bd-settings-tab.item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/betterdiscord.svg) | |
| } | |
| .sidebar-nqHbhN .bd-emotes-tab.item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/emote.svg) | |
| } | |
| .sidebar-nqHbhN .bd-customcss-tab.item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/code_braces.svg) | |
| } | |
| .sidebar-nqHbhN .bd-plugins-tab.item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/puzzle.svg) | |
| } | |
| .sidebar-nqHbhN .bd-themes-tab.item-2GWPIy:before{ | |
| background-image:url(https://clearvision.github.io/icons/palette.svg) | |
| } | |
| .bd-modal-wrapper .header{ | |
| background-color:var(--backdrop-overlay) | |
| } | |
| .bd-modal-wrapper .bd-modal-body{ | |
| background-color:var(--backdrop-overlay) | |
| } | |
| .bd-modal-wrapper .footer button:hover{ | |
| background-color:var(--hover-color) | |
| } | |
| .bd-modal-wrapper .bd-modal-inner{ | |
| border:rgba(0,0,0,0) | |
| } | |
| .side-1lrxIh #bd-settings-sidebar .ui-tab-bar-header{ | |
| padding-top:20px; | |
| display:flex; | |
| align-items:center; | |
| justify-content:center; | |
| color:var(--main-color); | |
| font-weight:700 | |
| } | |
| .side-1lrxIh #bd-settings-sidebar .ui-tab-bar-header:before{ | |
| content:""; | |
| height:2px; | |
| flex-grow:1; | |
| background:linear-gradient(to left, var(--main-color) 50%, transparent); | |
| margin-right:5px | |
| } | |
| .side-1lrxIh #bd-settings-sidebar .ui-tab-bar-header:after{ | |
| content:""; | |
| height:2px; | |
| flex-grow:1; | |
| background:linear-gradient(to right, var(--main-color) 50%, transparent); | |
| margin-left:5px | |
| } | |
| .side-1lrxIh #bd-settings-sidebar .ui-tab-bar-item{ | |
| color:rgba(255,255,255,.3); | |
| padding:8px 0 8px 20px; | |
| margin:0; | |
| transition:all .15s ease-in-out,background-size .3s ease-in-out; | |
| cursor:pointer | |
| } | |
| .side-1lrxIh #bd-settings-sidebar .ui-tab-bar-item:before{ | |
| opacity:.3; | |
| transition:all .15s ease-in-out | |
| } | |
| .side-1lrxIh #bd-settings-sidebar .ui-tab-bar-item:after{ | |
| content:""; | |
| position:absolute; | |
| top:0; | |
| right:100%; | |
| bottom:0; | |
| left:0; | |
| opacity:.9; | |
| transition:all .3s ease-in-out; | |
| z-index:-1; | |
| pointer-events:none | |
| } | |
| .side-1lrxIh #bd-settings-sidebar .ui-tab-bar-item:hover{ | |
| background:rgba(255,255,255,.07); | |
| color:rgba(255,255,255,.7) | |
| } | |
| .side-1lrxIh #bd-settings-sidebar .ui-tab-bar-item:hover:before{ | |
| opacity:.7 | |
| } | |
| .side-1lrxIh #bd-settings-sidebar .ui-tab-bar-item.selected{ | |
| background:rgba(0,0,0,0); | |
| color:#fff; | |
| transition:all .15s ease-in-out,background .3s .2s | |
| } | |
| .side-1lrxIh #bd-settings-sidebar .ui-tab-bar-item.selected:before{ | |
| opacity:1 | |
| } | |
| .side-1lrxIh #bd-settings-sidebar .ui-tab-bar-item.selected:after{ | |
| right:0; | |
| background:var(--main-color); | |
| animation:cv-channel-select .3s ease-in-out | |
| } | |
| .side-1lrxIh #bd-settings-sidebar .ui-tab-bar-separator{ | |
| background:rgba(255,255,255,.07) | |
| } | |
| .side-1lrxIh #bd-settings-sidebar .ui-tab-bar-separator:first-child{ | |
| display:none | |
| } | |
| .side-1lrxIh #bd-settings-sidebar div[style]{ | |
| color:rgba(255,255,255,.3) !important | |
| } | |
| .side-1lrxIh #bd-settings-sidebar a{ | |
| color:var(--main-color); | |
| transition:all .1s ease-in-out | |
| } | |
| .side-1lrxIh #bd-settings-sidebar a:hover{ | |
| text-shadow:0 0 1px; | |
| text-decoration:none !important | |
| } | |
| .replyer,.btn-quote,.citar-btn{ | |
| background-color:rgba(0,0,0,.4) !important; | |
| border-radius:3px; | |
| transition:background-color .3s ease-in-out | |
| } | |
| .replyer:hover,.btn-quote:hover,.citar-btn:hover{ | |
| background-color:var(--main-color) !important | |
| } | |
| #pluginNotice #outdatedPlugins span{ | |
| color:#fff; | |
| transition:all .1s ease-in-out | |
| } | |
| #pluginNotice #outdatedPlugins span:hover{ | |
| text-shadow:0 0 1px; | |
| text-decoration:none !important | |
| } | |
| .bd-search-wrapper{ | |
| background-color:rgba(0,0,0,.4) !important | |
| } | |
| .bd-select .bd-select-options{ | |
| background-color:rgba(0,0,0,.4) !important; | |
| border:hidden !important | |
| } | |
| .bd-select .bd-select-option:hover{ | |
| background-color:rgba(255,255,255,.1) !important | |
| } | |
| .bd-select .bd-select-option.selected{ | |
| background-color:var(--main-color) !important | |
| } | |
| .bd-addon-list .bd-addon-card{ | |
| background-color:rgba(0,0,0,.4) !important | |
| } | |
| .bd-addon-list .bd-addon-header{ | |
| background-color:var(--backdrop-overlay) | |
| } | |
| .bd-button{ | |
| background-color:var(--main-color) | |
| } | |
| .bd-button:hover{ | |
| background-color:var(--hover-color) | |
| } | |
| .bd-button:active{ | |
| background-color:var(--main-color) | |
| } | |
| .bd-addon-views .bd-view-button.selected{ | |
| background-color:var(--main-color) | |
| } | |
| .bd-switch input:checked+.bd-switch-body{ | |
| background-color:var(--main-color) !important | |
| } | |
| .bd-switch-body{ | |
| background-color:rgba(255,255,255,.15) !important | |
| } | |
| .bd-switch-symbol{ | |
| color:var(--main-color) !important | |
| } | |
| .bd-toast{ | |
| background-color:var(--main-color) | |
| } | |
| .bd-toast.toast-info{ | |
| background-color:var(--main-color) | |
| } | |
| .bd-toast.toast-success{ | |
| background-color:var(--main-color) | |
| } | |
| .bd-link{ | |
| color:var(--url-color) | |
| } | |
| .bd-settings-title{ | |
| color:#fff | |
| } | |
| .members-3WRCEx>#MemberCount{ | |
| position:static; | |
| height:40px; | |
| width:100%; | |
| padding-left:16px; | |
| padding-right:8px; | |
| background:rgba(0,0,0,0); | |
| color:rgba(255,255,255,.3); | |
| font-size:11px; | |
| font-weight:600; | |
| text-align:center | |
| } | |
| .members-3WRCEx>#MemberCount:before,.members-3WRCEx>#MemberCount:after{ | |
| display:none | |
| } | |
| .members-3WRCEx>#MemberCount+.membersGroup-2eiWxl{ | |
| margin-top:-10px | |
| } | |
| .sidebar-2K8pFh.hideElement .container-YkUktl{ | |
| background:rgba(0,0,0,0) | |
| } | |
| .BE-badge{ | |
| filter:drop-shadow(0 0 3px rgba(0, 0, 0, 0.7)) | |
| } | |
| .creationDate,.joinedAtDate,.lastMessageDate{ | |
| font-size:10px; | |
| margin-bottom:-2px | |
| } | |
| .theme-dark .gameActivityToggleAdded-Yd-YxC .withTagAsButton-OsgQ9L,.theme-dark .gameActivityToggleAdded-Yd-YxC .withTagless-10ooWt{ | |
| min-width:calc(100% - 140px) | |
| } | |
| .owner-tag{ | |
| color:rgba(255,255,255,.6) | |
| } | |
| .owner-tag[style*=background]{ | |
| color:#fff | |
| } | |
| .BE-badges+.owner-tag{ | |
| margin-left:0 | |
| } | |
| .container-hidden{ | |
| opacity:.3 | |
| } | |
| .BDFDB-tooltip>.tooltipTop-CgYHUZ{ | |
| position:relative; | |
| margin-top:-36px | |
| } | |
| .BDFDB-tooltip>.tooltipRight-1UPNyA{ | |
| position:relative; | |
| margin-left:10px | |
| } | |
| .hljs .copybutton{ | |
| background:rgba(255,255,255,.1) !important; | |
| color:rgba(255,255,255,.7) !important; | |
| border:none !important; | |
| border-top-left-radius:3px; | |
| opacity:0; | |
| transition:all .3s ease-in-out; | |
| user-select:none | |
| } | |
| .hljs .copybutton:hover{ | |
| color:#fff !important | |
| } | |
| .hljs .copybutton:active{ | |
| color:var(--main-color) !important | |
| } | |
| .hljs:hover .copybutton{ | |
| opacity:1 | |
| } | |
| .hljs>.kawaii-linenumbers{ | |
| list-style:none; | |
| counter-reset:linenumbers; | |
| border-left:2.6ch solid rgba(255,255,255,.04); | |
| margin:-6px; | |
| padding:6px | |
| } | |
| .hljs>.kawaii-linenumbers>li{ | |
| text-indent:-3ch; | |
| margin-left:0; | |
| padding:0; | |
| border:none | |
| } | |
| .hljs>.kawaii-linenumbers>li:before{ | |
| content:counter(linenumbers); | |
| counter-increment:linenumbers; | |
| color:rgba(255,255,255,.3); | |
| display:inline-block; | |
| width:2ch; | |
| margin-right:.5ch; | |
| padding-right:.5ch; | |
| text-align:right; | |
| overflow:hidden; | |
| vertical-align:top; | |
| user-select:none | |
| } |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment